ETH Price: $2,817.26 (-0.91%)

Contract

0xF19EaaAB5432086EeeDc7e5E24007202dA2B5420

Overview

ETH Balance

0 ETH

ETH Value

$0.00

More Info

Private Name Tags

Multichain Info

No addresses found
Transaction Hash
Method
Block
From
To

There are no matching entries

> 10 Internal Transactions found.

Latest 25 internal transactions (View All)

Advanced mode:
Parent Transaction Hash Block From To
172435532025-11-24 12:12:441 hr ago1763986364
0xF19EaaAB...2dA2B5420
0 ETH
172433352025-11-24 12:09:061 hr ago1763986146
0xF19EaaAB...2dA2B5420
0 ETH
172432812025-11-24 12:08:121 hr ago1763986092
0xF19EaaAB...2dA2B5420
0 ETH
172431382025-11-24 12:05:491 hr ago1763985949
0xF19EaaAB...2dA2B5420
0 ETH
172431302025-11-24 12:05:411 hr ago1763985941
0xF19EaaAB...2dA2B5420
0 ETH
172430702025-11-24 12:04:411 hr ago1763985881
0xF19EaaAB...2dA2B5420
0 ETH
172429942025-11-24 12:03:251 hr ago1763985805
0xF19EaaAB...2dA2B5420
0 ETH
172428802025-11-24 12:01:311 hr ago1763985691
0xF19EaaAB...2dA2B5420
0 ETH
172427862025-11-24 11:59:571 hr ago1763985597
0xF19EaaAB...2dA2B5420
0 ETH
172427312025-11-24 11:59:021 hr ago1763985542
0xF19EaaAB...2dA2B5420
0 ETH
172425932025-11-24 11:56:441 hr ago1763985404
0xF19EaaAB...2dA2B5420
0 ETH
172413022025-11-24 11:35:131 hr ago1763984113
0xF19EaaAB...2dA2B5420
0 ETH
172406162025-11-24 11:23:471 hr ago1763983427
0xF19EaaAB...2dA2B5420
0 ETH
172406162025-11-24 11:23:471 hr ago1763983427
0xF19EaaAB...2dA2B5420
0 ETH
172406162025-11-24 11:23:471 hr ago1763983427
0xF19EaaAB...2dA2B5420
0 ETH
172361332025-11-24 10:09:043 hrs ago1763978944
0xF19EaaAB...2dA2B5420
0 ETH
172338932025-11-24 9:31:443 hrs ago1763976704
0xF19EaaAB...2dA2B5420
0 ETH
172304702025-11-24 8:34:414 hrs ago1763973281
0xF19EaaAB...2dA2B5420
0 ETH
172304702025-11-24 8:34:414 hrs ago1763973281
0xF19EaaAB...2dA2B5420
0 ETH
172304702025-11-24 8:34:414 hrs ago1763973281
0xF19EaaAB...2dA2B5420
0 ETH
172294032025-11-24 8:16:544 hrs ago1763972214
0xF19EaaAB...2dA2B5420
0 ETH
172269002025-11-24 7:35:115 hrs ago1763969711
0xF19EaaAB...2dA2B5420
0 ETH
172268312025-11-24 7:34:025 hrs ago1763969642
0xF19EaaAB...2dA2B5420
0 ETH
172268312025-11-24 7:34:025 hrs ago1763969642
0xF19EaaAB...2dA2B5420
0 ETH
172268312025-11-24 7:34:025 hrs ago1763969642
0xF19EaaAB...2dA2B5420
0 ETH
View All Internal Transactions

Cross-Chain Transactions
Loading...
Loading

Contract Source Code Verified (Exact Match)

Contract Name:
Router

Compiler Version
v0.8.20+commit.a1b79de6

Optimization Enabled:
Yes with 200 runs

Other Settings:
shanghai EvmVersion
// SPDX-License-Identifier: BUSL-1.1

pragma solidity 0.8.20;

import {Math} from "openzeppelin-math/Math.sol";
import {IERC3156FlashBorrower} from "openzeppelin-contracts/interfaces/IERC3156FlashBorrower.sol";
import {SafeERC20, IERC20} from "openzeppelin-contracts/token/ERC20/utils/SafeERC20.sol";
import {AccessManagedUpgradeable} from "openzeppelin-contracts-upgradeable/access/manager/AccessManagedUpgradeable.sol";
import {PausableUpgradeable} from "openzeppelin-contracts-upgradeable/utils/PausableUpgradeable.sol";
import {RayMath} from "../libraries/RayMath.sol";
import {IRouter} from "../interfaces/IRouter.sol";
import {Dispatcher} from "./Dispatcher.sol";

/**
 * @title Router contract
 * @author Spectra Finance
 * @notice Handles executions of complex sequences of actions in the Spectra protocol.
 */
contract Router is
    Dispatcher,
    AccessManagedUpgradeable,
    PausableUpgradeable,
    IRouter,
    IERC3156FlashBorrower
{
    using SafeERC20 for IERC20;
    using Math for uint256;

    /** @dev Maximum amount of tokens for which balance can be tracked in _previewRate(). */
    uint256 private constant MAX_INVOLVED_TOKENS = 30;

    /** @dev Expected return value from borrowers onFlashLoan function. */
    bytes32 private immutable ON_FLASH_LOAN = keccak256("ERC3156FlashBorrower.onFlashLoan");

    /* Events
     *********************************************************************************************************/
    event RouterUtilChange(address indexed previousRouterUtil, address indexed newRouterUtil);
    event KyberRouterChange(address indexed previousKyberRouter, address indexed newKyberRouter);

    /* Modifiers
     *********************************************************************************************************/
    modifier checkDeadline(uint256 deadline) {
        if (block.timestamp > deadline) revert TransactionDeadlinePassed();
        _;
    }

    /* Constructor
     *********************************************************************************************************/
    constructor(address _registry) Dispatcher(_registry) {
        _disableInitializers(); // using this so that the deployed logic contract later cannot be initialized.
    }

    /* Initializer
     *********************************************************************************************************/
    function initialize(
        address _routerUtil,
        address _kyberRouter,
        address _initialAuthority
    ) external initializer {
        __Dispatcher_init(_routerUtil, _kyberRouter);
        __AccessManaged_init(_initialAuthority);
    }

    /* Setters
     *********************************************************************************************************/

    /**
     * @inheritdoc IRouter
     */
    function pause() external override restricted {
        _pause();
    }

    /**
     * @inheritdoc IRouter
     */
    function unPause() external override restricted {
        _unpause();
    }

    /**
     * @inheritdoc IRouter
     */
    function setRouterUtil(address _routerUtil) external override restricted {
        if (_routerUtil == address(0)) {
            revert AddressError();
        }
        emit RouterUtilChange(routerUtil, _routerUtil);
        routerUtil = _routerUtil;
    }

    /**
     * @inheritdoc IRouter
     */
    function setKyberRouter(address _kyberRouter) external override restricted {
        emit KyberRouterChange(kyberRouter, _kyberRouter);
        kyberRouter = _kyberRouter;
    }

    /* Getters
     *********************************************************************************************************/

    /**
     * @inheritdoc IRouter
     */
    function getRegistry() external view override returns (address) {
        return registry;
    }

    /**
     * @inheritdoc IRouter
     */
    function getRouterUtil() external view override returns (address) {
        return routerUtil;
    }

    /**
     * @inheritdoc IRouter
     */
    function getKyberRouter() external view override returns (address) {
        return kyberRouter;
    }

    /* Executions
     *********************************************************************************************************/

    /**
     * @inheritdoc IRouter
     */
    function execute(
        bytes calldata _commands,
        bytes[] calldata _inputs,
        uint256 _deadline
    ) external payable override checkDeadline(_deadline) {
        execute(_commands, _inputs);
    }

    /**
     * @inheritdoc IRouter
     */
    function execute(
        bytes calldata _commands,
        bytes[] calldata _inputs
    ) public payable override whenNotPaused {
        uint256 numCommands = _commands.length;
        if (_inputs.length != numCommands) {
            revert LengthMismatch();
        }

        // Relying on msg.sender is problematic as it changes during a flash loan.
        // Thus, it's necessary to track who initiated the original Router execution.
        bool topLevel;
        if (msgSender == address(0)) {
            msgSender = msg.sender;
            topLevel = true;
            msgValue = msg.value;
        } else if (msg.sender != address(this)) {
            revert UnauthorizedReentrantCall();
        }
        // loop through all given commands, execute them and pass along outputs as defined
        for (uint256 commandIndex; commandIndex < numCommands; ) {
            bytes1 command = _commands[commandIndex];

            bytes calldata input = _inputs[commandIndex];

            _dispatch(command, input);
            unchecked {
                commandIndex++;
            }
        }
        if (topLevel) {
            // top-level reset
            msgSender = address(0);
            msgValue = 0;
        }
    }

    /* Previews
     *********************************************************************************************************/

    /**
     * @dev Simulates the execution of a sequence of commands and returns the expected resulting rate
     * @param _commands Encoded instructions passed to the dispatcher
     * @param _inputs An array of byte strings containing ABI-encoded inputs for each command
     * @param _spot If set to true, spot exchange rate is used for swaps. Additionally for all commands,
     *              input amounts are disregarded, and one unit of the token of interest is used instead.
     *              If set to false, the function includes price impact and curve pool fees for swaps.
     * @return The preview rate value, which represents the amount of output token obtained at the end of execution
     * for each wei of input token spent at the start of execution, multiplied by 1 ray unit.
     */
    function _previewRate(
        bytes calldata _commands,
        bytes[] calldata _inputs,
        bool _spot
    ) internal view whenNotPaused returns (uint256) {
        uint256 numCommands = _commands.length;
        if (_inputs.length != numCommands) {
            revert LengthMismatch();
        }

        TokenBalance[] memory balances = new TokenBalance[](MAX_INVOLVED_TOKENS);
        uint256 rate = RayMath.RAY_UNIT;

        // loop through all given commands, execute them and pass along outputs as defined
        for (uint256 commandIndex; commandIndex < numCommands; ) {
            bytes1 command = _commands[commandIndex];
            bytes calldata input = _inputs[commandIndex];

            uint256 commandRate = _dispatchPreviewRate(command, input, _spot, balances);

            if (commandRate != RayMath.RAY_UNIT) {
                rate = rate.mulDiv(commandRate, RayMath.RAY_UNIT);
            }

            unchecked {
                commandIndex++;
            }
        }
        return rate;
    }

    /**
     * @inheritdoc IRouter
     */
    function previewRate(
        bytes calldata _commands,
        bytes[] calldata _inputs
    ) external view override returns (uint256) {
        return _previewRate(_commands, _inputs, false);
    }

    /**
     * @inheritdoc IRouter
     */
    function previewSpotRate(
        bytes calldata _commands,
        bytes[] calldata _inputs
    ) external view override returns (uint256) {
        return _previewRate(_commands, _inputs, true);
    }

    /* Flashloans
     *********************************************************************************************************/

    /**
     * @inheritdoc IERC3156FlashBorrower
     */
    function onFlashLoan(
        address /* initiator */,
        address _token,
        uint256 _amount,
        uint256 _fee,
        bytes calldata _data
    ) external returns (bytes32) {
        if (msgSender == address(0)) {
            revert DirectOnFlashloanCall();
        }
        if (msg.sender != flashloanLender) {
            revert UnauthorizedOnFlashloanCaller();
        }
        (bytes memory commands, bytes[] memory inputs) = abi.decode(_data, (bytes, bytes[]));
        this.execute(commands, inputs); // https://ethereum.stackexchange.com/questions/103437/converting-bytes-memory-to-bytes-calldata
        uint256 repayAmount = _amount + _fee;
        uint256 allowance = IERC20(_token).allowance(address(this), msg.sender);
        if (allowance < repayAmount) {
            // Approve the lender to pull the funds if needed
            IERC20(_token).forceApprove(msg.sender, repayAmount);
        }
        uint256 balance = IERC20(_token).balanceOf(address(this));
        if (balance < repayAmount) {
            // Collect remaining debt from the original sender if needed
            IERC20(_token).safeTransferFrom(msgSender, address(this), repayAmount - balance);
        }
        return ON_FLASH_LOAN;
    }
}

// SPDX-License-Identifier: BUSL-1.1

pragma solidity ^0.8.20;

// https://github.com/Uniswap/universal-router/blob/main/contracts/interfaces/IUniversalRouter.sol

interface IRouter {
    /// @notice Thrown when executing commands with an expired deadline
    error TransactionDeadlinePassed();

    /// @notice Thrown when attempting to execute commands and an incorrect number of inputs are provided
    error LengthMismatch();

    /// @notice Thrown when onFlashloan() is called directly, rather than through a command execution
    error DirectOnFlashloanCall();

    /// @notice Thrown when onFlashloan() is called by an address other than flashloan lender
    error UnauthorizedOnFlashloanCaller();

    /// @notice Thrown when an address other than msgSender and Router reenters execute()
    error UnauthorizedReentrantCall();

    /**
     * @notice Toggle Pause
     * @dev Should only be called in extraordinary situations by the admin of the contract
     * @dev See {PausableUpgradeable-_pause}
     */
    function pause() external;

    /**
     * @notice Toggle UnPause
     * @dev Should only be called in extraordinary situations by the admin of the contract
     * @dev See {PausableUpgradeable-_unpause}
     */
    function unPause() external;

    /**
     * @notice Getter for the registry
     * @return The address of the registry
     */
    function getRegistry() external view returns (address);

    /**
     * @dev Getter for the router utility contract
     * @return The address of the router utility contract
     */
    function getRouterUtil() external view returns (address);

    /**
     * @dev Getter for the Kyberswap Router
     * @return The address of the Kyberswap Router
     */
    function getKyberRouter() external view returns (address);

    /**
     * @dev Setter for the router utility contract
     * @param _routerUtil The new address of the router utility contract
     */
    function setRouterUtil(address _routerUtil) external;

    /**
     * @dev Setter for the Kyberswap Router
     * @param _kyberRouter The new address of the Kyberswap Router
     */
    function setKyberRouter(address _kyberRouter) external;

    /**
     * @dev Executes encoded commands along with provided inputs
     * Reverts if deadline has expired
     * @param _commands A set of concatenated commands, each 1 byte in length
     * @param _inputs An array of byte strings containing ABI-encoded inputs for each command
     * @param _deadline The deadline by which the transaction must be executed
     */
    function execute(
        bytes calldata _commands,
        bytes[] calldata _inputs,
        uint256 _deadline
    ) external payable;

    /**
     * @dev Executes encoded commands along with provided inputs
     * @param _commands A set of concatenated commands, each 1 byte in length
     * @param _inputs An array of byte strings containing ABI-encoded inputs for each command
     */
    function execute(bytes calldata _commands, bytes[] calldata _inputs) external payable;

    /**
     * @dev Simulates encoded commands along with provided inputs and returns the resulting rate
     * The rate is calculated as follows: rate = ray_unit * output_token_amount / input_token_amount
     * @param _commands A set of concatenated commands, each 1 byte in length
     * @param _inputs An array of byte strings containing ABI-encoded inputs for each command
     * @return The preview rate value, which represents the amount of output token obtained at the end of execution
     * for each wei of input token spent at the start of execution, multiplied by 1 ray unit.
     */
    function previewRate(
        bytes calldata _commands,
        bytes[] calldata _inputs
    ) external view returns (uint256);

    /**
     * @dev Simulates encoded commands along with provided inputs and returns the resulting spot rate.
     * As opposed to `previewRate`, spot exchange rates will be used for swaps. Additionally for all commands,
     * input amounts are disregarded, and one unit of the token of interest is used instead.
     * @param _commands A set of concatenated commands, each 1 byte in length
     * @param _inputs An array of byte strings containing ABI-encoded inputs for each command
     * @return The preview spot rate value, which represents the amount of output token obtained at the end of execution
     * for each wei of input token spent at the start of execution, multiplied by 1 ray unit.
     */

    function previewSpotRate(
        bytes calldata _commands,
        bytes[] calldata _inputs
    ) external view returns (uint256);
}

File 3 of 36 : RouterUtil.sol
// SPDX-License-Identifier: BUSL-1.1

pragma solidity 0.8.20;

import {Math} from "openzeppelin-math/Math.sol";
import {IERC20Metadata} from "openzeppelin-contracts/token/ERC20/extensions/IERC20Metadata.sol";
import {IERC4626} from "openzeppelin-contracts/interfaces/IERC4626.sol";
import {IERC3156FlashLender} from "openzeppelin-contracts/interfaces/IERC3156FlashLender.sol";
import {SafeCast} from "openzeppelin-contracts/utils/math/SafeCast.sol";
import {CurvePoolUtil} from "../../libraries/CurvePoolUtil.sol";
import {ICurvePool} from "../../interfaces/ICurvePool.sol";
import {IStableSwapNG} from "../../interfaces/IStableSwapNG.sol";
import {ICurveNGPool} from "../../interfaces/ICurveNGPool.sol";
import {IPrincipalToken} from "../../interfaces/IPrincipalToken.sol";
import {Constants} from "../Constants.sol";

/**
 * @title Router Util contract
 * @author Spectra Finance
 * @notice Provides miscellaneous utils and preview functions related to Router executions.
 */
contract RouterUtil {
    using Math for uint256;
    using SafeCast for uint256;
    using SafeCast for int256;

    error InvalidTokenIndex(uint256 i, uint256 j);
    error PoolLiquidityError();
    error UnsufficientAmountForFlashFee();
    error ResultNotFound();

    /**
     * @dev Gives the spot exchange rate of token i in terms of token j. Exchange rate is in 18 decimals
     * @dev To be used with Curve Cryptoswap pools
     * @param _curvePool PT/IBT curve pool
     * @param _i token index, either 0 or 1
     * @param _j token index, either 0 or 1, must be different than _i
     * @return The spot exchange rate of _i in terms of _j
     */

    function spotExchangeRate(
        address _curvePool,
        uint256 _i,
        uint256 _j
    ) public view returns (uint256) {
        if (_i == 0 && _j == 1) {
            return
                CurvePoolUtil.CURVE_UNIT.mulDiv(
                    CurvePoolUtil.CURVE_UNIT,
                    ICurvePool(_curvePool).last_prices()
                );
        } else if (_i == 1 && _j == 0) {
            return ICurvePool(_curvePool).last_prices();
        } else {
            revert InvalidTokenIndex(_i, _j);
        }
    }

    /**
     * @dev Gives the spot exchange rate of token i in terms of token j. Exchange rate is in 18 decimals
     * @dev To be used with Curve Stableswap pools
     * @param _curvePool PT/IBT curve pool
     * @param _i token index, either 0 or 1
     * @param _j token index, either 0 or 1, must be different than _i
     * @return The spot exchange rate of _i in terms of _j
     */
    function spotExchangeRateSNG(
        address _curvePool,
        int128 _i,
        int128 _j
    ) public view returns (uint256) {
        uint256 last_prices = IStableSwapNG(_curvePool).last_price(0);
        uint256[] memory stored_rates = IStableSwapNG(_curvePool).stored_rates();

        if (_i == 0 && _j == 1) {
            last_prices = stored_rates[0].mulDiv(CurvePoolUtil.CURVE_UNIT, stored_rates[1]).mulDiv(
                CurvePoolUtil.CURVE_UNIT,
                last_prices
            );
            return last_prices;
        } else if (_i == 1 && _j == 0) {
            last_prices = last_prices.mulDiv(stored_rates[1], stored_rates[0]);
            return last_prices;
        } else {
            revert InvalidTokenIndex(uint256(uint128(_i)), uint256(uint128(_j)));
        }
    }

    /**
     * @dev To be used with Curve Cryptoswap pools
     * @dev Gives the upper bound of the interval to perform bisection search in previewFlashSwapExactIBTForYT().
     * @param _inputIBTAmount amount of IBT exchanged for YT
     * @param _curvePool PT/IBT curve pool
     * @return The upper bound for search interval in root finding algorithms
     */
    function convertIBTToYTSpot(
        uint256 _inputIBTAmount,
        address _curvePool
    ) public view returns (uint256) {
        // The spot exchange rate between IBT and YT is evaluated using the tokenization equation without fees.
        // This equation reads: ptRate = 1 PT + 1 YT .

        address pt = ICurvePool(_curvePool).coins(1);
        uint256 ibtRate = IPrincipalToken(pt).getIBTRate(); // Ray
        uint256 ptRate = IPrincipalToken(pt).getPTRate(); // Ray

        uint256 ptInUnderlyingRay = spotExchangeRate(_curvePool, 1, 0).mulDiv(
            ibtRate,
            CurvePoolUtil.CURVE_UNIT
        );
        if (ptInUnderlyingRay > ptRate) {
            revert PoolLiquidityError();
        }
        uint256 ytInUnderlyingRay = ptRate - ptInUnderlyingRay;

        return _inputIBTAmount.mulDiv(ibtRate, ytInUnderlyingRay);
    }

    /**
     * @dev Returns the maximal amount of YT one can obtain with a given amount of IBT (i.e without fees or slippage).
     * @dev To be used with Curve Stableswap NG pools
     * @dev Gives the upper bound of the interval to perform bisection search in previewFlashSwapExactIBTForYT().
     * @param _inputIBTAmount amount of IBT exchanged for YT
     * @param _curvePool PT/IBT curve pool
     * @return The upper bound for search interval in root finding algorithms
     */
    function convertIBTToYTSpotSNG(
        uint256 _inputIBTAmount,
        address _curvePool
    ) public view returns (uint256) {
        // The spot exchange rate between IBT and YT is evaluated using the tokenization equation without fees.
        // This equation reads: ptRate = 1 PT + 1 YT .

        address pt = ICurvePool(_curvePool).coins(1);
        uint256 ibtRate = IPrincipalToken(pt).getIBTRate(); // Ray
        uint256 ptRate = IPrincipalToken(pt).getPTRate(); // Ray

        uint256 ptInUnderlyingRay = spotExchangeRateSNG(_curvePool, 1, 0).mulDiv(
            ibtRate,
            CurvePoolUtil.CURVE_UNIT
        );
        if (ptInUnderlyingRay > ptRate) {
            revert PoolLiquidityError();
        }
        uint256 ytInUnderlyingRay = ptRate - ptInUnderlyingRay;

        return _inputIBTAmount.mulDiv(ibtRate, ytInUnderlyingRay);
    }

    /* PREVIEW FUNCTIONS FOR CURVE CRYPTOSWAP POOLS
     *****************************************************************************************************************/

    /**
     * @dev Computes the amount of IBT required to buy a given output amount of YT.
     * @dev Works for both Cryptoswap
     * @param _curvePool PT/IBT curve pool
     * @param _outputYTAmount desired output YT token amount
     * @return inputIBTAmount The amount of IBT needed for obtaining the defined amount of YT
     * @return borrowedIBTAmount the quantity of IBT borrowed to execute that swap
     */
    function previewFlashSwapIBTToExactYT(
        address _curvePool,
        uint256 _outputYTAmount
    ) public view returns (uint256 inputIBTAmount, uint256 borrowedIBTAmount) {
        // Tokens
        address pt = ICurvePool(_curvePool).coins(1);
        address ibt = IPrincipalToken(pt).getIBT();

        // Units and rates
        uint256 ibtRate = IPrincipalToken(pt).getIBTRate(); // Ray
        uint256 ptRate = IPrincipalToken(pt).getPTRate(); // Ray

        // Outputs
        uint256 swapPTForIBT = ICurvePool(_curvePool).get_dy(1, 0, _outputYTAmount);

        // y PT:YT = (x IBT * ((UNIT - tokenizationFee) / UNIT) * ibtRate) / ptRate
        // <=> x IBT = (y PT:YT * ptRate * UNIT) / (ibtRate * (UNIT - tokenizationFee))
        borrowedIBTAmount = (_outputYTAmount * ptRate * Constants.UNIT).ceilDiv(
            ibtRate * (Constants.UNIT - IPrincipalToken(pt).getTokenizationFee())
        );
        if (swapPTForIBT > borrowedIBTAmount) {
            revert PoolLiquidityError();
        }
        inputIBTAmount =
            borrowedIBTAmount +
            _getFlashFee(pt, ibt, borrowedIBTAmount) -
            swapPTForIBT;
    }

    /**
     * @dev Computes the amount of IBT required to buy a given output amount of YT.
     * @dev Works for both Stableswap NG pools
     * @param _curvePool PT/IBT curve pool
     * @param _outputYTAmount desired output YT token amount
     * @return inputIBTAmount The amount of IBT needed for obtaining the defined amount of YT
     * @return borrowedIBTAmount the quantity of IBT borrowed to execute that swap
     */
    function previewFlashSwapIBTToExactYTSNG(
        address _curvePool,
        uint256 _outputYTAmount
    ) public view returns (uint256 inputIBTAmount, uint256 borrowedIBTAmount) {
        // Tokens
        address pt = ICurvePool(_curvePool).coins(1);
        address ibt = IPrincipalToken(pt).getIBT();

        // Units and rates
        uint256 ibtRate = IPrincipalToken(pt).getIBTRate(); // Ray
        uint256 ptRate = IPrincipalToken(pt).getPTRate(); // Ray

        // Outputs
        uint256 swapPTForIBT = IStableSwapNG(_curvePool).get_dy(1, 0, _outputYTAmount);

        // y PT:YT = (x IBT * ((UNIT - tokenizationFee) / UNIT) * ibtRate) / ptRate
        // <=> x IBT = (y PT:YT * ptRate * UNIT) / (ibtRate * (UNIT - tokenizationFee))
        borrowedIBTAmount = (_outputYTAmount * ptRate * Constants.UNIT).ceilDiv(
            ibtRate * (Constants.UNIT - IPrincipalToken(pt).getTokenizationFee())
        );
        if (swapPTForIBT > borrowedIBTAmount) {
            revert PoolLiquidityError();
        }
        inputIBTAmount =
            borrowedIBTAmount +
            _getFlashFee(pt, ibt, borrowedIBTAmount) -
            swapPTForIBT;
    }

    /**
     * @dev Approximates the expected output amount of YT corresponding to a given input amount of IBT.
     * @dev To be used with Curve Cryptoswap pools
     * @dev May return an output YT amount that corresponds to an input IBT amount lower than the given _inputIBTAmount.
     * @dev This function can be expensive to execute and should only be called off-chain. Avoid using it within a transaction.
     * @param _curvePool PT/IBT curve pool
     * @param _inputIBTAmount amount of IBT exchanged for YT
     * @return ytAmount The guess of YT obtained for the given amount of IBT
     * @return borrowedIBTAmount The quantity of IBT borrowed to execute that swap.
     */
    function previewFlashSwapExactIBTToYT(
        address _curvePool,
        uint256 _inputIBTAmount
    ) public view returns (uint256 ytAmount, uint256 borrowedIBTAmount) {
        // initial guesses
        address pt = ICurvePool(_curvePool).coins(1);
        uint256 x0 = IPrincipalToken(pt).previewDepositIBT(_inputIBTAmount);
        uint256 x1 = convertIBTToYTSpot(_inputIBTAmount, _curvePool);
        uint256 ibtUnit = getUnit(ICurvePool(_curvePool).coins(0));

        // Use secant method to approximate ytAmount
        for (uint256 i = 0; i < Constants.MAX_ITERATIONS_SECANT; ++i) {
            if (
                _delta(x0, x1).mulDiv(ibtUnit, Math.max(x0, x1)) <
                ibtUnit / Constants.PRECISION_DIVISOR
            ) {
                break;
            }

            (uint256 inputIBTAmount0, ) = previewFlashSwapIBTToExactYT(_curvePool, x0);
            (uint256 inputIBTAmount1, ) = previewFlashSwapIBTToExactYT(_curvePool, x1);
            int256 answer0 = inputIBTAmount0.toInt256() - _inputIBTAmount.toInt256();
            int256 answer1 = inputIBTAmount1.toInt256() - _inputIBTAmount.toInt256();

            if (answer0 == answer1) {
                break;
            }

            // x2 = x1 - (f(x1) * (x1 - x0) / (f(x1) - f(x0)))
            // x0, x1 = x1, x2
            uint256 x2 = (x1.toInt256() -
                ((answer1 * (x1.toInt256() - x0.toInt256())) / (answer1 - answer0))).toUint256();
            x0 = x1;
            x1 = x2;
        }
        ytAmount = Math.min(x0, x1);

        uint256 resInputIBTAmount;
        (resInputIBTAmount, borrowedIBTAmount) = previewFlashSwapIBTToExactYT(_curvePool, ytAmount);

        // Run linear search if inputIBTAmount corresponding to ytAmount is higher than requested
        if (resInputIBTAmount > _inputIBTAmount) {
            // linear search
            uint256 sf = Constants.SCALING_FACTOR_LINEAR_SEARCH;
            for (uint256 i = 0; i < Constants.MAX_ITERATIONS_LINEAR_SEARCH; ++i) {
                ytAmount = ytAmount.mulDiv(sf - 1, sf);
                (resInputIBTAmount, borrowedIBTAmount) = previewFlashSwapIBTToExactYT(
                    _curvePool,
                    ytAmount
                );
                if (resInputIBTAmount <= _inputIBTAmount) {
                    break;
                }
            }
        }

        // if result is still higher or too far from requested value
        if (
            resInputIBTAmount > _inputIBTAmount ||
            _delta(_inputIBTAmount, resInputIBTAmount).mulDiv(ibtUnit, _inputIBTAmount) >
            ibtUnit / Constants.PRECISION_DIVISOR
        ) {
            revert ResultNotFound();
        }
    }

    /**
     * @dev Approximates the expected output amount of YT corresponding to a given input amount of IBT.
     * @dev To be used with Curve Stableswap NG pools
     * @dev May return an output YT amount that corresponds to an input IBT amount lower than the given _inputIBTAmount.
     * @dev This function can be expensive to execute and should only be called off-chain. Avoid using it within a transaction.
     * @param _curvePool PT/IBT curve pool
     * @param _inputIBTAmount amount of IBT exchanged for YT
     * @return ytAmount The guess of YT obtained for the given amount of IBT
     * @return borrowedIBTAmount The quantity of IBT borrowed to execute that swap.
     */
    function previewFlashSwapExactIBTToYTSNG(
        address _curvePool,
        uint256 _inputIBTAmount
    ) public view returns (uint256 ytAmount, uint256 borrowedIBTAmount) {
        // initial guesses
        address pt = IStableSwapNG(_curvePool).coins(1);
        uint256 x0 = IPrincipalToken(pt).previewDepositIBT(_inputIBTAmount);
        uint256 x1 = convertIBTToYTSpotSNG(_inputIBTAmount, _curvePool);
        uint256 ibtUnit = getUnit(ICurvePool(_curvePool).coins(0));

        // Use secant method to approximate ytAmount
        for (uint256 i = 0; i < Constants.MAX_ITERATIONS_SECANT; ++i) {
            if (
                _delta(x0, x1).mulDiv(ibtUnit, Math.max(x0, x1)) <
                ibtUnit / Constants.PRECISION_DIVISOR
            ) {
                break;
            }

            (uint256 inputIBTAmount0, ) = previewFlashSwapIBTToExactYTSNG(_curvePool, x0);
            (uint256 inputIBTAmount1, ) = previewFlashSwapIBTToExactYTSNG(_curvePool, x1);
            int256 answer0 = inputIBTAmount0.toInt256() - _inputIBTAmount.toInt256();
            int256 answer1 = inputIBTAmount1.toInt256() - _inputIBTAmount.toInt256();

            if (answer0 == answer1) {
                break;
            }

            // x2 = x1 - (f(x1) * (x1 - x0) / (f(x1) - f(x0)))
            // x0, x1 = x1, x2
            uint256 x2 = (x1.toInt256() -
                ((answer1 * (x1.toInt256() - x0.toInt256())) / (answer1 - answer0))).toUint256();
            x0 = x1;
            x1 = x2;
        }
        ytAmount = Math.min(x0, x1);

        uint256 resInputIBTAmount;
        (resInputIBTAmount, borrowedIBTAmount) = previewFlashSwapIBTToExactYTSNG(
            _curvePool,
            ytAmount
        );

        // Run linear search if inputIBTAmount corresponding to ytAmount is higher than requested
        if (resInputIBTAmount > _inputIBTAmount) {
            // linear search
            uint256 sf = Constants.SCALING_FACTOR_LINEAR_SEARCH;
            for (uint256 i = 0; i < Constants.MAX_ITERATIONS_LINEAR_SEARCH; ++i) {
                ytAmount = ytAmount.mulDiv(sf - 1, sf);
                (resInputIBTAmount, borrowedIBTAmount) = previewFlashSwapIBTToExactYTSNG(
                    _curvePool,
                    ytAmount
                );
                if (resInputIBTAmount <= _inputIBTAmount) {
                    break;
                }
            }
        }

        // if result is still higher or too far from requested value
        if (
            resInputIBTAmount > _inputIBTAmount ||
            _delta(_inputIBTAmount, resInputIBTAmount).mulDiv(ibtUnit, _inputIBTAmount) >
            ibtUnit / Constants.PRECISION_DIVISOR
        ) {
            revert ResultNotFound();
        }
    }

    /**
     * @dev Given an amount of YT, previews the amount of IBT received after exchange
     * @dev To be used with Curve Cryptoswap pools
     * @param _curvePool PT/IBT curve pool
     * @param inputYTAmount amount of YT exchanged for IBT
     * @return The amount of IBT obtained for the given amount of YT
     * @return The amount of IBT borrowed to execute that swap.
     */
    function previewFlashSwapExactYTToIBT(
        address _curvePool,
        uint256 inputYTAmount
    ) public view returns (uint256, uint256) {
        // Tokens
        address pt = ICurvePool(_curvePool).coins(1);
        address ibt = IPrincipalToken(pt).getIBT();
        // Units and Rates
        uint256 ibtRate = IPrincipalToken(pt).getIBTRate();
        uint256 ptRate = IPrincipalToken(pt).getPTRate();
        // Outputs
        uint256 borrowedIBTAmount = CurvePoolUtil.getDx(_curvePool, 0, 1, inputYTAmount);
        uint256 inputYTAmountInIBT = inputYTAmount.mulDiv(ptRate, ibtRate);
        uint256 flashFee = _getFlashFee(pt, ibt, borrowedIBTAmount);
        if (borrowedIBTAmount > inputYTAmountInIBT) {
            revert PoolLiquidityError();
        } else if (borrowedIBTAmount + flashFee > inputYTAmountInIBT) {
            revert UnsufficientAmountForFlashFee();
        }
        uint256 outputIBTAmount = inputYTAmountInIBT - borrowedIBTAmount - flashFee;

        return (outputIBTAmount, borrowedIBTAmount);
    }

    /**
     * @dev Given an amount of YT, previews the amount of IBT received after exchange
     * @dev To be used with Curve StableSwap NG pools
     * @param _curvePool PT/IBT curve pool
     * @param inputYTAmount amount of YT exchanged for IBT
     * @return The amount of IBT obtained for the given amount of YT
     * @return The amount of IBT borrowed to execute that swap.
     */
    function previewFlashSwapExactYTToIBTSNG(
        address _curvePool,
        uint256 inputYTAmount
    ) public view returns (uint256, uint256) {
        // Tokens
        address pt = ICurvePool(_curvePool).coins(1);
        address ibt = IPrincipalToken(pt).getIBT();
        // Units and Rates
        uint256 ibtRate = IPrincipalToken(pt).getIBTRate();
        uint256 ptRate = IPrincipalToken(pt).getPTRate();
        // Outputs
        uint256 borrowedIBTAmount = IStableSwapNG(_curvePool).get_dx(0, 1, inputYTAmount);
        uint256 inputYTAmountInIBT = inputYTAmount.mulDiv(ptRate, ibtRate);
        uint256 flashFee = _getFlashFee(pt, ibt, borrowedIBTAmount);
        if (borrowedIBTAmount > inputYTAmountInIBT) {
            revert PoolLiquidityError();
        } else if (borrowedIBTAmount + flashFee > inputYTAmountInIBT) {
            revert UnsufficientAmountForFlashFee();
        }
        uint256 outputIBTAmount = inputYTAmountInIBT - borrowedIBTAmount - flashFee;

        return (outputIBTAmount, borrowedIBTAmount);
    }

    /**
     * @notice Given an amount of asset, previews the amount of lp tokens received after depositing in the curve pool
     * @notice To be used with Curve Cryptoswap pools
     * @param _curvePool address of the curve pool
     * @param _assets amount of assets to deposit into the curve pool
     * @return minMintAmount amount of lp tokens received
     */
    function previewAddLiquidityWithAsset(
        address _curvePool,
        uint256 _assets
    ) public view returns (uint256 minMintAmount) {
        address ibt = ICurvePool(_curvePool).coins(0);
        uint256 ibts = IERC4626(ibt).previewDeposit(_assets);
        minMintAmount = previewAddLiquidityWithIBT(_curvePool, ibts);
    }

    /**
     * @notice Given an amount of asset, previews the amount of lp tokens received after depositing in the curve pool
     * @notice To be used with Curve Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _assets amount of assets to deposit into the curve pool
     * @return minMintAmount amount of lp tokens received
     */
    function previewAddLiquidityWithAssetSNG(
        address _curvePool,
        uint256 _assets
    ) public view returns (uint256 minMintAmount) {
        address ibt = ICurvePool(_curvePool).coins(0);
        uint256 ibts = IERC4626(ibt).previewDeposit(_assets);
        minMintAmount = previewAddLiquidityWithIBTSNG(_curvePool, ibts);
    }

    /**
     * @notice Given an amount of ibt, previews the amount of lp tokens received after depositing in the curve pool
     * @notice To be used with Curve Cryptoswap pools
     * @param _curvePool address of the curve pool
     * @param _ibts amount of ibt to deposit into the curve pool
     * @return minMintAmount amount of lp tokens received
     */
    function previewAddLiquidityWithIBT(
        address _curvePool,
        uint256 _ibts
    ) public view returns (uint256 minMintAmount) {
        address pt = ICurvePool(_curvePool).coins(1);
        uint256 ibtToDepositInPT = CurvePoolUtil.calcIBTsToTokenizeForCurvePool(
            _ibts,
            _curvePool,
            pt
        );
        uint256 amount0 = _ibts - ibtToDepositInPT;
        uint256 amount1 = IPrincipalToken(pt).previewDepositIBT(ibtToDepositInPT);
        minMintAmount = previewAddLiquidity(_curvePool, [amount0, amount1]);
    }

    /**
     * @notice Given an amount of ibt, previews the amount of lp tokens received after depositing in the curve pool
     * @notice To be used with Curve Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _ibts amount of ibt to deposit into the curve pool
     * @return minMintAmount amount of lp tokens received
     */
    function previewAddLiquidityWithIBTSNG(
        address _curvePool,
        uint256 _ibts
    ) public view returns (uint256 minMintAmount) {
        address pt = IStableSwapNG(_curvePool).coins(1);
        uint256 ibtToDepositInPT = CurvePoolUtil.calcIBTsToTokenizeForCurvePool(
            _ibts,
            _curvePool,
            pt
        );
        uint256 amount0 = _ibts - ibtToDepositInPT;
        uint256 amount1 = IPrincipalToken(pt).previewDepositIBT(ibtToDepositInPT);
        uint256[] memory amounts = new uint256[](2);
        amounts[0] = amount0;
        amounts[1] = amount1;
        minMintAmount = previewAddLiquiditySNG(_curvePool, amounts);
    }

    /**
     * @notice Given an amount of ibts and pts, previews the amount of lp tokens received after depositing in the curve pool
     * @notice To be used with Curve Cryptoswap pools
     * @param _curvePool address of the curve pool
     * @param _amounts array of length two containing the amount of ibt and pt to deposit into the pool respectively
     * @return minMintAmount amount of lp tokens received
     */
    function previewAddLiquidity(
        address _curvePool,
        uint256[2] memory _amounts
    ) public view returns (uint256 minMintAmount) {
        minMintAmount = CurvePoolUtil.previewAddLiquidity(_curvePool, _amounts);
    }

    /**
     * @notice Given an amount of ibts and pts, previews the amount of lp tokens received after depositing in the curve pool
     * @notice To be used with Curve Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _amounts array of length two containing the amount of ibt and pt to deposit into the pool respectively
     * @return minMintAmount amount of lp tokens received
     */
    function previewAddLiquiditySNG(
        address _curvePool,
        uint256[] memory _amounts
    ) public view returns (uint256 minMintAmount) {
        minMintAmount = CurvePoolUtil.previewAddLiquiditySNG(_curvePool, _amounts);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of asset received after withdrawing from the curve pool
     * @notice To be used with Curve Cryptoswap and Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @return assets amount of asset received
     */
    function previewRemoveLiquidityForAsset(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256 assets) {
        uint256[2] memory minAmounts = CurvePoolUtil.previewRemoveLiquidity(_curvePool, _lpAmount);
        assets =
            IERC4626(ICurvePool(_curvePool).coins(0)).previewRedeem(minAmounts[0]) +
            IPrincipalToken(ICurvePool(_curvePool).coins(1)).previewRedeem(minAmounts[1]);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of asset received after withdrawing from the curve pool
     * @notice To be used with Curve Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @return assets amount of asset received
     */
    function previewRemoveLiquidityForAssetSNG(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256 assets) {
        uint256[] memory minAmounts = CurvePoolUtil.previewRemoveLiquiditySNG(
            _curvePool,
            _lpAmount
        );
        assets =
            IERC4626(ICurvePool(_curvePool).coins(0)).previewRedeem(minAmounts[0]) +
            IPrincipalToken(ICurvePool(_curvePool).coins(1)).previewRedeem(minAmounts[1]);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of ibt received after withdrawing from the curve pool
     * @notice To be used with Curve Cryptoswap
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @return ibts amount of ibt received
     */
    function previewRemoveLiquidityForIBT(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256 ibts) {
        uint256[2] memory minAmounts = CurvePoolUtil.previewRemoveLiquidity(_curvePool, _lpAmount);
        ibts =
            minAmounts[0] +
            IPrincipalToken(ICurvePool(_curvePool).coins(1)).previewRedeemForIBT(minAmounts[1]);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of ibt received after withdrawing from the curve pool
     * @notice To be used with Curve Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @return ibts amount of ibt received
     */
    function previewRemoveLiquidityForIBTSNG(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256 ibts) {
        uint256[] memory minAmounts = CurvePoolUtil.previewRemoveLiquiditySNG(
            _curvePool,
            _lpAmount
        );
        ibts =
            minAmounts[0] +
            IPrincipalToken(ICurvePool(_curvePool).coins(1)).previewRedeemForIBT(minAmounts[1]);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of ibt and pt received after withdrawing from the curve pool
     * @notice To be used with Curve Cryptoswap and Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @return minAmounts array of length two cointaining the amount of ibt and pt received after withdrawing from the curve pool
     */
    function previewRemoveLiquidity(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256[2] memory minAmounts) {
        minAmounts = CurvePoolUtil.previewRemoveLiquidity(_curvePool, _lpAmount);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of ibt and pt received after withdrawing from the curve pool
     * @notice To be used with Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @return minAmounts array of length two cointaining the amount of ibt and pt received after withdrawing from the curve pool
     */
    function previewRemoveLiquiditySNG(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256[] memory minAmounts) {
        minAmounts = CurvePoolUtil.previewRemoveLiquiditySNG(_curvePool, _lpAmount);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of token at index _i received after withdrawing from the curve pool
     * @notice To be used with Curve Cryptoswap and  pools
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @param _i Index of the token to withdraw in
     * @return minAmount amount of token at index _i after withdrawing from the curve pool
     */
    function previewRemoveLiquidityOneCoin(
        address _curvePool,
        uint256 _lpAmount,
        uint256 _i
    ) public view returns (uint256 minAmount) {
        minAmount = CurvePoolUtil.previewRemoveLiquidityOneCoin(_curvePool, _lpAmount, _i);
    }

    /**
     * @notice Given an amount of lp tokens, previews the amount of token at index _i received after withdrawing from the curve pool
     * @notice To be used with Curve  Stableswap NG pools
     * @param _curvePool address of the curve pool
     * @param _lpAmount amount of lp tokens to withdraw from the curve pool
     * @param _i Index of the token to withdraw in
     * @return minAmount amount of token at index _i after withdrawing from the curve pool
     */
    function previewRemoveLiquidityOneCoinSNG(
        address _curvePool,
        uint256 _lpAmount,
        int128 _i
    ) public view returns (uint256 minAmount) {
        minAmount = CurvePoolUtil.previewRemoveLiquidityOneCoinSNG(_curvePool, _lpAmount, _i);
    }

    /* PREVIEW FUNCTIONS FOR CURVE TWOCRYPTO-NG POOLS
     *****************************************************************************************************************/

    /**
     * @dev Computes the amount of IBT required to buy a given output amount of YT.
     * @param _curvePool PT/IBT curve pool
     * @param _outputYTAmount desired output YT token amount
     * @return inputIBTAmount The amount of IBT needed for obtaining the defined amount of YT
     * @return borrowedIBTAmount the quantity of IBT borrowed to execute that swap
     */
    function previewNGFlashSwapIBTToExactYT(
        address _curvePool,
        uint256 _outputYTAmount
    ) public view returns (uint256 inputIBTAmount, uint256 borrowedIBTAmount) {
        return previewFlashSwapIBTToExactYT(_curvePool, _outputYTAmount);
    }

    /**
     * @dev Approximates the expected output amount of YT corresponding to a given input amount of IBT.
     * @dev May return an output YT amount that corresponds to an input IBT amount lower than the given _inputIBTAmount.
     * @dev This function can be expensive to execute and should only be called off-chain. Avoid using it within a transaction.
     * @param _curvePool PT/IBT curve pool
     * @param _inputIBTAmount amount of IBT exchanged for YT
     * @return ytAmount The guess of YT obtained for the given amount of IBT
     * @return borrowedIBTAmount The quantity of IBT borrowed to execute that swap.
     */
    function previewNGFlashSwapExactIBTToYT(
        address _curvePool,
        uint256 _inputIBTAmount
    ) public view returns (uint256 ytAmount, uint256 borrowedIBTAmount) {
        return previewFlashSwapExactIBTToYT(_curvePool, _inputIBTAmount);
    }

    /**
     * @dev Given an amount of YT, previews the amount of IBT received after exchange
     * @param _curvePool PT/IBT curve pool
     * @param inputYTAmount amount of YT exchanged for IBT
     * @return The amount of IBT obtained for the given amount of YT
     * @return The amount of IBT borrowed to execute that swap.
     */
    function previewNGFlashSwapExactYTToIBT(
        address _curvePool,
        uint256 inputYTAmount
    ) public view returns (uint256, uint256) {
        // Tokens
        address pt = ICurvePool(_curvePool).coins(1);
        address ibt = IPrincipalToken(pt).getIBT();
        // Units and Rates
        uint256 ibtRate = IPrincipalToken(pt).getIBTRate();
        uint256 ptRate = IPrincipalToken(pt).getPTRate();
        // Outputs
        uint256 borrowedIBTAmount = ICurveNGPool(_curvePool).get_dx(0, 1, inputYTAmount);
        uint256 inputYTAmountInIBT = inputYTAmount.mulDiv(ptRate, ibtRate);
        uint256 flashFee = _getFlashFee(pt, ibt, borrowedIBTAmount);
        if (borrowedIBTAmount > inputYTAmountInIBT) {
            revert PoolLiquidityError();
        } else if (borrowedIBTAmount + flashFee > inputYTAmountInIBT) {
            revert UnsufficientAmountForFlashFee();
        }
        uint256 outputIBTAmount = inputYTAmountInIBT - borrowedIBTAmount - flashFee;

        return (outputIBTAmount, borrowedIBTAmount);
    }

    function previewNGAddLiquidityWithAsset(
        address _curvePool,
        uint256 _assets
    ) public view returns (uint256 minMintAmount) {
        address ibt = ICurveNGPool(_curvePool).coins(0);
        uint256 ibts = IERC4626(ibt).previewDeposit(_assets);
        minMintAmount = previewNGAddLiquidityWithIBT(_curvePool, ibts);
    }

    function previewNGAddLiquidityWithIBT(
        address _curvePool,
        uint256 _ibts
    ) public view returns (uint256 minMintAmount) {
        address pt = ICurveNGPool(_curvePool).coins(1);
        uint256 ibtToDepositInPT = CurvePoolUtil.calcIBTsToTokenizeForCurvePool(
            _ibts,
            _curvePool,
            pt
        );
        uint256 amount0 = _ibts - ibtToDepositInPT;
        uint256 amount1 = IPrincipalToken(pt).previewDepositIBT(ibtToDepositInPT);
        minMintAmount = CurvePoolUtil.previewAddLiquidityNG(_curvePool, [amount0, amount1]);
    }

    function previewNGAddLiquidity(
        address _curvePool,
        uint256[2] memory _amounts
    ) public view returns (uint256 minMintAmount) {
        minMintAmount = CurvePoolUtil.previewAddLiquidityNG(_curvePool, _amounts);
    }

    function previewNGRemoveLiquidityForAsset(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256 assets) {
        uint256[2] memory minAmounts = CurvePoolUtil.previewRemoveLiquidityNG(
            _curvePool,
            _lpAmount
        );
        assets =
            IERC4626(ICurveNGPool(_curvePool).coins(0)).previewRedeem(minAmounts[0]) +
            IPrincipalToken(ICurveNGPool(_curvePool).coins(1)).previewRedeem(minAmounts[1]);
    }

    function previewNGRemoveLiquidityForIBT(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256 ibts) {
        uint256[2] memory minAmounts = CurvePoolUtil.previewRemoveLiquidityNG(
            _curvePool,
            _lpAmount
        );
        ibts =
            minAmounts[0] +
            IPrincipalToken(ICurvePool(_curvePool).coins(1)).previewRedeemForIBT(minAmounts[1]);
    }

    function previewNGRemoveLiquidity(
        address _curvePool,
        uint256 _lpAmount
    ) public view returns (uint256[2] memory minAmounts) {
        minAmounts = CurvePoolUtil.previewRemoveLiquidityNG(_curvePool, _lpAmount);
    }

    function previewNGRemoveLiquidityOneCoin(
        address _curvePool,
        uint256 _lpAmount,
        uint256 _i
    ) public view returns (uint256 minAmount) {
        minAmount = CurvePoolUtil.previewRemoveLiquidityOneCoinNG(_curvePool, _lpAmount, _i);
    }

    /* PUBLIC UTILS
     *****************************************************************************************************************/

    /**
     * @dev Returns the unit element of the underlying asset of a PT
     * @param _pt address of Principal Token
     * @return The unit of underlying asset
     */
    function getPTUnderlyingUnit(address _pt) external view returns (uint256) {
        return getUnit(IPrincipalToken(_pt).underlying());
    }

    /**
     * @dev Returns the unit element of the token
     * @param _token address of token
     * @return The unit of asset
     */
    function getUnit(address _token) public view returns (uint256) {
        return 10 ** IERC20Metadata(_token).decimals();
    }

    /* INTERNAL FUNCTIONS
     *****************************************************************************************************************/

    /**
     * @dev Calculates the flash loan fee for borrowing a given quantity of IBT
     * @param _pt address of Principal Token
     * @param _ibt address of Interest Bearing Token
     * @param _borrowedIBTAmount amount of Interest Bearing Tokens that have been borrowed in the flash loan
     * @return The amount of fees charged for flash loan
     */
    function _getFlashFee(
        address _pt,
        address _ibt,
        uint256 _borrowedIBTAmount
    ) internal view returns (uint256) {
        return IERC3156FlashLender(_pt).flashFee(_ibt, _borrowedIBTAmount);
    }

    /**
     * @dev abs(a, b)
     * @param a some integer
     * @param b some integer
     * @return The absolute value of a - b
     */
    function _delta(uint256 a, uint256 b) internal pure returns (uint256) {
        return a > b ? a - b : b - a;
    }
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (access/manager/AccessManaged.sol)

pragma solidity ^0.8.20;

import {IAuthority} from "@openzeppelin/contracts/access/manager/IAuthority.sol";
import {AuthorityUtils} from "@openzeppelin/contracts/access/manager/AuthorityUtils.sol";
import {IAccessManager} from "@openzeppelin/contracts/access/manager/IAccessManager.sol";
import {IAccessManaged} from "@openzeppelin/contracts/access/manager/IAccessManaged.sol";
import {ContextUpgradeable} from "../../utils/ContextUpgradeable.sol";
import {Initializable} from "../../proxy/utils/Initializable.sol";

/**
 * @dev This contract module makes available a {restricted} modifier. Functions decorated with this modifier will be
 * permissioned according to an "authority": a contract like {AccessManager} that follows the {IAuthority} interface,
 * implementing a policy that allows certain callers to access certain functions.
 *
 * IMPORTANT: The `restricted` modifier should never be used on `internal` functions, judiciously used in `public`
 * functions, and ideally only used in `external` functions. See {restricted}.
 */
abstract contract AccessManagedUpgradeable is Initializable, ContextUpgradeable, IAccessManaged {
    /// @custom:storage-location erc7201:openzeppelin.storage.AccessManaged
    struct AccessManagedStorage {
        address _authority;

        bool _consumingSchedule;
    }

    // keccak256(abi.encode(uint256(keccak256("openzeppelin.storage.AccessManaged")) - 1)) & ~bytes32(uint256(0xff))
    bytes32 private constant AccessManagedStorageLocation = 0xf3177357ab46d8af007ab3fdb9af81da189e1068fefdc0073dca88a2cab40a00;

    function _getAccessManagedStorage() private pure returns (AccessManagedStorage storage $) {
        assembly {
            $.slot := AccessManagedStorageLocation
        }
    }

    /**
     * @dev Initializes the contract connected to an initial authority.
     */
    function __AccessManaged_init(address initialAuthority) internal onlyInitializing {
        __AccessManaged_init_unchained(initialAuthority);
    }

    function __AccessManaged_init_unchained(address initialAuthority) internal onlyInitializing {
        _setAuthority(initialAuthority);
    }

    /**
     * @dev Restricts access to a function as defined by the connected Authority for this contract and the
     * caller and selector of the function that entered the contract.
     *
     * [IMPORTANT]
     * ====
     * In general, this modifier should only be used on `external` functions. It is okay to use it on `public`
     * functions that are used as external entry points and are not called internally. Unless you know what you're
     * doing, it should never be used on `internal` functions. Failure to follow these rules can have critical security
     * implications! This is because the permissions are determined by the function that entered the contract, i.e. the
     * function at the bottom of the call stack, and not the function where the modifier is visible in the source code.
     * ====
     *
     * [WARNING]
     * ====
     * Avoid adding this modifier to the https://docs.soliditylang.org/en/v0.8.20/contracts.html#receive-ether-function[`receive()`]
     * function or the https://docs.soliditylang.org/en/v0.8.20/contracts.html#fallback-function[`fallback()`]. These
     * functions are the only execution paths where a function selector cannot be unambiguosly determined from the calldata
     * since the selector defaults to `0x00000000` in the `receive()` function and similarly in the `fallback()` function
     * if no calldata is provided. (See {_checkCanCall}).
     *
     * The `receive()` function will always panic whereas the `fallback()` may panic depending on the calldata length.
     * ====
     */
    modifier restricted() {
        _checkCanCall(_msgSender(), _msgData());
        _;
    }

    /// @inheritdoc IAccessManaged
    function authority() public view virtual returns (address) {
        AccessManagedStorage storage $ = _getAccessManagedStorage();
        return $._authority;
    }

    /// @inheritdoc IAccessManaged
    function setAuthority(address newAuthority) public virtual {
        address caller = _msgSender();
        if (caller != authority()) {
            revert AccessManagedUnauthorized(caller);
        }
        if (newAuthority.code.length == 0) {
            revert AccessManagedInvalidAuthority(newAuthority);
        }
        _setAuthority(newAuthority);
    }

    /// @inheritdoc IAccessManaged
    function isConsumingScheduledOp() public view returns (bytes4) {
        AccessManagedStorage storage $ = _getAccessManagedStorage();
        return $._consumingSchedule ? this.isConsumingScheduledOp.selector : bytes4(0);
    }

    /**
     * @dev Transfers control to a new authority. Internal function with no access restriction. Allows bypassing the
     * permissions set by the current authority.
     */
    function _setAuthority(address newAuthority) internal virtual {
        AccessManagedStorage storage $ = _getAccessManagedStorage();
        $._authority = newAuthority;
        emit AuthorityUpdated(newAuthority);
    }

    /**
     * @dev Reverts if the caller is not allowed to call the function identified by a selector. Panics if the calldata
     * is less than 4 bytes long.
     */
    function _checkCanCall(address caller, bytes calldata data) internal virtual {
        AccessManagedStorage storage $ = _getAccessManagedStorage();
        (bool immediate, uint32 delay) = AuthorityUtils.canCallWithDelay(
            authority(),
            caller,
            address(this),
            bytes4(data[0:4])
        );
        if (!immediate) {
            if (delay > 0) {
                $._consumingSchedule = true;
                IAccessManager(authority()).consumeScheduledOp(caller, data);
                $._consumingSchedule = false;
            } else {
                revert AccessManagedUnauthorized(caller);
            }
        }
    }
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (interfaces/IERC4626.sol)

pragma solidity ^0.8.20;

import {IERC20} from "../token/ERC20/IERC20.sol";
import {IERC20Metadata} from "../token/ERC20/extensions/IERC20Metadata.sol";

/**
 * @dev Interface of the ERC4626 "Tokenized Vault Standard", as defined in
 * https://eips.ethereum.org/EIPS/eip-4626[ERC-4626].
 */
interface IERC4626 is IERC20, IERC20Metadata {
    event Deposit(address indexed sender, address indexed owner, uint256 assets, uint256 shares);

    event Withdraw(
        address indexed sender,
        address indexed receiver,
        address indexed owner,
        uint256 assets,
        uint256 shares
    );

    /**
     * @dev Returns the address of the underlying token used for the Vault for accounting, depositing, and withdrawing.
     *
     * - MUST be an ERC-20 token contract.
     * - MUST NOT revert.
     */
    function asset() external view returns (address assetTokenAddress);

    /**
     * @dev Returns the total amount of the underlying asset that is “managed” by Vault.
     *
     * - SHOULD include any compounding that occurs from yield.
     * - MUST be inclusive of any fees that are charged against assets in the Vault.
     * - MUST NOT revert.
     */
    function totalAssets() external view returns (uint256 totalManagedAssets);

    /**
     * @dev Returns the amount of shares that the Vault would exchange for the amount of assets provided, in an ideal
     * scenario where all the conditions are met.
     *
     * - MUST NOT be inclusive of any fees that are charged against assets in the Vault.
     * - MUST NOT show any variations depending on the caller.
     * - MUST NOT reflect slippage or other on-chain conditions, when performing the actual exchange.
     * - MUST NOT revert.
     *
     * NOTE: This calculation MAY NOT reflect the “per-user” price-per-share, and instead should reflect the
     * “average-user’s” price-per-share, meaning what the average user should expect to see when exchanging to and
     * from.
     */
    function convertToShares(uint256 assets) external view returns (uint256 shares);

    /**
     * @dev Returns the amount of assets that the Vault would exchange for the amount of shares provided, in an ideal
     * scenario where all the conditions are met.
     *
     * - MUST NOT be inclusive of any fees that are charged against assets in the Vault.
     * - MUST NOT show any variations depending on the caller.
     * - MUST NOT reflect slippage or other on-chain conditions, when performing the actual exchange.
     * - MUST NOT revert.
     *
     * NOTE: This calculation MAY NOT reflect the “per-user” price-per-share, and instead should reflect the
     * “average-user’s” price-per-share, meaning what the average user should expect to see when exchanging to and
     * from.
     */
    function convertToAssets(uint256 shares) external view returns (uint256 assets);

    /**
     * @dev Returns the maximum amount of the underlying asset that can be deposited into the Vault for the receiver,
     * through a deposit call.
     *
     * - MUST return a limited value if receiver is subject to some deposit limit.
     * - MUST return 2 ** 256 - 1 if there is no limit on the maximum amount of assets that may be deposited.
     * - MUST NOT revert.
     */
    function maxDeposit(address receiver) external view returns (uint256 maxAssets);

    /**
     * @dev Allows an on-chain or off-chain user to simulate the effects of their deposit at the current block, given
     * current on-chain conditions.
     *
     * - MUST return as close to and no more than the exact amount of Vault shares that would be minted in a deposit
     *   call in the same transaction. I.e. deposit should return the same or more shares as previewDeposit if called
     *   in the same transaction.
     * - MUST NOT account for deposit limits like those returned from maxDeposit and should always act as though the
     *   deposit would be accepted, regardless if the user has enough tokens approved, etc.
     * - MUST be inclusive of deposit fees. Integrators should be aware of the existence of deposit fees.
     * - MUST NOT revert.
     *
     * NOTE: any unfavorable discrepancy between convertToShares and previewDeposit SHOULD be considered slippage in
     * share price or some other type of condition, meaning the depositor will lose assets by depositing.
     */
    function previewDeposit(uint256 assets) external view returns (uint256 shares);

    /**
     * @dev Mints shares Vault shares to receiver by depositing exactly amount of underlying tokens.
     *
     * - MUST emit the Deposit event.
     * - MAY support an additional flow in which the underlying tokens are owned by the Vault contract before the
     *   deposit execution, and are accounted for during deposit.
     * - MUST revert if all of assets cannot be deposited (due to deposit limit being reached, slippage, the user not
     *   approving enough underlying tokens to the Vault contract, etc).
     *
     * NOTE: most implementations will require pre-approval of the Vault with the Vault’s underlying asset token.
     */
    function deposit(uint256 assets, address receiver) external returns (uint256 shares);

    /**
     * @dev Returns the maximum amount of the Vault shares that can be minted for the receiver, through a mint call.
     * - MUST return a limited value if receiver is subject to some mint limit.
     * - MUST return 2 ** 256 - 1 if there is no limit on the maximum amount of shares that may be minted.
     * - MUST NOT revert.
     */
    function maxMint(address receiver) external view returns (uint256 maxShares);

    /**
     * @dev Allows an on-chain or off-chain user to simulate the effects of their mint at the current block, given
     * current on-chain conditions.
     *
     * - MUST return as close to and no fewer than the exact amount of assets that would be deposited in a mint call
     *   in the same transaction. I.e. mint should return the same or fewer assets as previewMint if called in the
     *   same transaction.
     * - MUST NOT account for mint limits like those returned from maxMint and should always act as though the mint
     *   would be accepted, regardless if the user has enough tokens approved, etc.
     * - MUST be inclusive of deposit fees. Integrators should be aware of the existence of deposit fees.
     * - MUST NOT revert.
     *
     * NOTE: any unfavorable discrepancy between convertToAssets and previewMint SHOULD be considered slippage in
     * share price or some other type of condition, meaning the depositor will lose assets by minting.
     */
    function previewMint(uint256 shares) external view returns (uint256 assets);

    /**
     * @dev Mints exactly shares Vault shares to receiver by depositing amount of underlying tokens.
     *
     * - MUST emit the Deposit event.
     * - MAY support an additional flow in which the underlying tokens are owned by the Vault contract before the mint
     *   execution, and are accounted for during mint.
     * - MUST revert if all of shares cannot be minted (due to deposit limit being reached, slippage, the user not
     *   approving enough underlying tokens to the Vault contract, etc).
     *
     * NOTE: most implementations will require pre-approval of the Vault with the Vault’s underlying asset token.
     */
    function mint(uint256 shares, address receiver) external returns (uint256 assets);

    /**
     * @dev Returns the maximum amount of the underlying asset that can be withdrawn from the owner balance in the
     * Vault, through a withdraw call.
     *
     * - MUST return a limited value if owner is subject to some withdrawal limit or timelock.
     * - MUST NOT revert.
     */
    function maxWithdraw(address owner) external view returns (uint256 maxAssets);

    /**
     * @dev Allows an on-chain or off-chain user to simulate the effects of their withdrawal at the current block,
     * given current on-chain conditions.
     *
     * - MUST return as close to and no fewer than the exact amount of Vault shares that would be burned in a withdraw
     *   call in the same transaction. I.e. withdraw should return the same or fewer shares as previewWithdraw if
     *   called
     *   in the same transaction.
     * - MUST NOT account for withdrawal limits like those returned from maxWithdraw and should always act as though
     *   the withdrawal would be accepted, regardless if the user has enough shares, etc.
     * - MUST be inclusive of withdrawal fees. Integrators should be aware of the existence of withdrawal fees.
     * - MUST NOT revert.
     *
     * NOTE: any unfavorable discrepancy between convertToShares and previewWithdraw SHOULD be considered slippage in
     * share price or some other type of condition, meaning the depositor will lose assets by depositing.
     */
    function previewWithdraw(uint256 assets) external view returns (uint256 shares);

    /**
     * @dev Burns shares from owner and sends exactly assets of underlying tokens to receiver.
     *
     * - MUST emit the Withdraw event.
     * - MAY support an additional flow in which the underlying tokens are owned by the Vault contract before the
     *   withdraw execution, and are accounted for during withdraw.
     * - MUST revert if all of assets cannot be withdrawn (due to withdrawal limit being reached, slippage, the owner
     *   not having enough shares, etc).
     *
     * Note that some implementations will require pre-requesting to the Vault before a withdrawal may be performed.
     * Those methods should be performed separately.
     */
    function withdraw(uint256 assets, address receiver, address owner) external returns (uint256 shares);

    /**
     * @dev Returns the maximum amount of Vault shares that can be redeemed from the owner balance in the Vault,
     * through a redeem call.
     *
     * - MUST return a limited value if owner is subject to some withdrawal limit or timelock.
     * - MUST return balanceOf(owner) if owner is not subject to any withdrawal limit or timelock.
     * - MUST NOT revert.
     */
    function maxRedeem(address owner) external view returns (uint256 maxShares);

    /**
     * @dev Allows an on-chain or off-chain user to simulate the effects of their redeemption at the current block,
     * given current on-chain conditions.
     *
     * - MUST return as close to and no more than the exact amount of assets that would be withdrawn in a redeem call
     *   in the same transaction. I.e. redeem should return the same or more assets as previewRedeem if called in the
     *   same transaction.
     * - MUST NOT account for redemption limits like those returned from maxRedeem and should always act as though the
     *   redemption would be accepted, regardless if the user has enough shares, etc.
     * - MUST be inclusive of withdrawal fees. Integrators should be aware of the existence of withdrawal fees.
     * - MUST NOT revert.
     *
     * NOTE: any unfavorable discrepancy between convertToAssets and previewRedeem SHOULD be considered slippage in
     * share price or some other type of condition, meaning the depositor will lose assets by redeeming.
     */
    function previewRedeem(uint256 shares) external view returns (uint256 assets);

    /**
     * @dev Burns exactly shares from owner and sends assets of underlying tokens to receiver.
     *
     * - MUST emit the Withdraw event.
     * - MAY support an additional flow in which the underlying tokens are owned by the Vault contract before the
     *   redeem execution, and are accounted for during redeem.
     * - MUST revert if all of shares cannot be redeemed (due to withdrawal limit being reached, slippage, the owner
     *   not having enough shares, etc).
     *
     * NOTE: some implementations will require pre-requesting to the Vault before a withdrawal may be performed.
     * Those methods should be performed separately.
     */
    function redeem(uint256 shares, address receiver, address owner) external returns (uint256 assets);
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (utils/math/Math.sol)

pragma solidity ^0.8.20;

/**
 * @dev Standard math utilities missing in the Solidity language.
 */
library Math {
    /**
     * @dev Muldiv operation overflow.
     */
    error MathOverflowedMulDiv();

    enum Rounding {
        Floor, // Toward negative infinity
        Ceil, // Toward positive infinity
        Trunc, // Toward zero
        Expand // Away from zero
    }

    /**
     * @dev Returns the addition of two unsigned integers, with an overflow flag.
     */
    function tryAdd(uint256 a, uint256 b) internal pure returns (bool, uint256) {
        unchecked {
            uint256 c = a + b;
            if (c < a) return (false, 0);
            return (true, c);
        }
    }

    /**
     * @dev Returns the subtraction of two unsigned integers, with an overflow flag.
     */
    function trySub(uint256 a, uint256 b) internal pure returns (bool, uint256) {
        unchecked {
            if (b > a) return (false, 0);
            return (true, a - b);
        }
    }

    /**
     * @dev Returns the multiplication of two unsigned integers, with an overflow flag.
     */
    function tryMul(uint256 a, uint256 b) internal pure returns (bool, uint256) {
        unchecked {
            // Gas optimization: this is cheaper than requiring 'a' not being zero, but the
            // benefit is lost if 'b' is also tested.
            // See: https://github.com/OpenZeppelin/openzeppelin-contracts/pull/522
            if (a == 0) return (true, 0);
            uint256 c = a * b;
            if (c / a != b) return (false, 0);
            return (true, c);
        }
    }

    /**
     * @dev Returns the division of two unsigned integers, with a division by zero flag.
     */
    function tryDiv(uint256 a, uint256 b) internal pure returns (bool, uint256) {
        unchecked {
            if (b == 0) return (false, 0);
            return (true, a / b);
        }
    }

    /**
     * @dev Returns the remainder of dividing two unsigned integers, with a division by zero flag.
     */
    function tryMod(uint256 a, uint256 b) internal pure returns (bool, uint256) {
        unchecked {
            if (b == 0) return (false, 0);
            return (true, a % b);
        }
    }

    /**
     * @dev Returns the largest of two numbers.
     */
    function max(uint256 a, uint256 b) internal pure returns (uint256) {
        return a > b ? a : b;
    }

    /**
     * @dev Returns the smallest of two numbers.
     */
    function min(uint256 a, uint256 b) internal pure returns (uint256) {
        return a < b ? a : b;
    }

    /**
     * @dev Returns the average of two numbers. The result is rounded towards
     * zero.
     */
    function average(uint256 a, uint256 b) internal pure returns (uint256) {
        // (a + b) / 2 can overflow.
        return (a & b) + (a ^ b) / 2;
    }

    /**
     * @dev Returns the ceiling of the division of two numbers.
     *
     * This differs from standard division with `/` in that it rounds towards infinity instead
     * of rounding towards zero.
     */
    function ceilDiv(uint256 a, uint256 b) internal pure returns (uint256) {
        if (b == 0) {
            // Guarantee the same behavior as in a regular Solidity division.
            return a / b;
        }

        // (a + b - 1) / b can overflow on addition, so we distribute.
        return a == 0 ? 0 : (a - 1) / b + 1;
    }

    /**
     * @notice Calculates floor(x * y / denominator) with full precision. Throws if result overflows a uint256 or
     * denominator == 0.
     * @dev Original credit to Remco Bloemen under MIT license (https://xn--2-umb.com/21/muldiv) with further edits by
     * Uniswap Labs also under MIT license.
     */
    function mulDiv(uint256 x, uint256 y, uint256 denominator) internal pure returns (uint256 result) {
        unchecked {
            // 512-bit multiply [prod1 prod0] = x * y. Compute the product mod 2^256 and mod 2^256 - 1, then use
            // use the Chinese Remainder Theorem to reconstruct the 512 bit result. The result is stored in two 256
            // variables such that product = prod1 * 2^256 + prod0.
            uint256 prod0 = x * y; // Least significant 256 bits of the product
            uint256 prod1; // Most significant 256 bits of the product
            assembly {
                let mm := mulmod(x, y, not(0))
                prod1 := sub(sub(mm, prod0), lt(mm, prod0))
            }

            // Handle non-overflow cases, 256 by 256 division.
            if (prod1 == 0) {
                // Solidity will revert if denominator == 0, unlike the div opcode on its own.
                // The surrounding unchecked block does not change this fact.
                // See https://docs.soliditylang.org/en/latest/control-structures.html#checked-or-unchecked-arithmetic.
                return prod0 / denominator;
            }

            // Make sure the result is less than 2^256. Also prevents denominator == 0.
            if (denominator <= prod1) {
                revert MathOverflowedMulDiv();
            }

            ///////////////////////////////////////////////
            // 512 by 256 division.
            ///////////////////////////////////////////////

            // Make division exact by subtracting the remainder from [prod1 prod0].
            uint256 remainder;
            assembly {
                // Compute remainder using mulmod.
                remainder := mulmod(x, y, denominator)

                // Subtract 256 bit number from 512 bit number.
                prod1 := sub(prod1, gt(remainder, prod0))
                prod0 := sub(prod0, remainder)
            }

            // Factor powers of two out of denominator and compute largest power of two divisor of denominator.
            // Always >= 1. See https://cs.stackexchange.com/q/138556/92363.

            uint256 twos = denominator & (0 - denominator);
            assembly {
                // Divide denominator by twos.
                denominator := div(denominator, twos)

                // Divide [prod1 prod0] by twos.
                prod0 := div(prod0, twos)

                // Flip twos such that it is 2^256 / twos. If twos is zero, then it becomes one.
                twos := add(div(sub(0, twos), twos), 1)
            }

            // Shift in bits from prod1 into prod0.
            prod0 |= prod1 * twos;

            // Invert denominator mod 2^256. Now that denominator is an odd number, it has an inverse modulo 2^256 such
            // that denominator * inv = 1 mod 2^256. Compute the inverse by starting with a seed that is correct for
            // four bits. That is, denominator * inv = 1 mod 2^4.
            uint256 inverse = (3 * denominator) ^ 2;

            // Use the Newton-Raphson iteration to improve the precision. Thanks to Hensel's lifting lemma, this also
            // works in modular arithmetic, doubling the correct bits in each step.
            inverse *= 2 - denominator * inverse; // inverse mod 2^8
            inverse *= 2 - denominator * inverse; // inverse mod 2^16
            inverse *= 2 - denominator * inverse; // inverse mod 2^32
            inverse *= 2 - denominator * inverse; // inverse mod 2^64
            inverse *= 2 - denominator * inverse; // inverse mod 2^128
            inverse *= 2 - denominator * inverse; // inverse mod 2^256

            // Because the division is now exact we can divide by multiplying with the modular inverse of denominator.
            // This will give us the correct result modulo 2^256. Since the preconditions guarantee that the outcome is
            // less than 2^256, this is the final result. We don't need to compute the high bits of the result and prod1
            // is no longer required.
            result = prod0 * inverse;
            return result;
        }
    }

    /**
     * @notice Calculates x * y / denominator with full precision, following the selected rounding direction.
     */
    function mulDiv(uint256 x, uint256 y, uint256 denominator, Rounding rounding) internal pure returns (uint256) {
        uint256 result = mulDiv(x, y, denominator);
        if (unsignedRoundsUp(rounding) && mulmod(x, y, denominator) > 0) {
            result += 1;
        }
        return result;
    }

    /**
     * @dev Returns the square root of a number. If the number is not a perfect square, the value is rounded
     * towards zero.
     *
     * Inspired by Henry S. Warren, Jr.'s "Hacker's Delight" (Chapter 11).
     */
    function sqrt(uint256 a) internal pure returns (uint256) {
        if (a == 0) {
            return 0;
        }

        // For our first guess, we get the biggest power of 2 which is smaller than the square root of the target.
        //
        // We know that the "msb" (most significant bit) of our target number `a` is a power of 2 such that we have
        // `msb(a) <= a < 2*msb(a)`. This value can be written `msb(a)=2**k` with `k=log2(a)`.
        //
        // This can be rewritten `2**log2(a) <= a < 2**(log2(a) + 1)`
        // ? `sqrt(2**k) <= sqrt(a) < sqrt(2**(k+1))`
        // ? `2**(k/2) <= sqrt(a) < 2**((k+1)/2) <= 2**(k/2 + 1)`
        //
        // Consequently, `2**(log2(a) / 2)` is a good first approximation of `sqrt(a)` with at least 1 correct bit.
        uint256 result = 1 << (log2(a) >> 1);

        // At this point `result` is an estimation with one bit of precision. We know the true value is a uint128,
        // since it is the square root of a uint256. Newton's method converges quadratically (precision doubles at
        // every iteration). We thus need at most 7 iteration to turn our partial result with one bit of precision
        // into the expected uint128 result.
        unchecked {
            result = (result + a / result) >> 1;
            result = (result + a / result) >> 1;
            result = (result + a / result) >> 1;
            result = (result + a / result) >> 1;
            result = (result + a / result) >> 1;
            result = (result + a / result) >> 1;
            result = (result + a / result) >> 1;
            return min(result, a / result);
        }
    }

    /**
     * @notice Calculates sqrt(a), following the selected rounding direction.
     */
    function sqrt(uint256 a, Rounding rounding) internal pure returns (uint256) {
        unchecked {
            uint256 result = sqrt(a);
            return result + (unsignedRoundsUp(rounding) && result * result < a ? 1 : 0);
        }
    }

    /**
     * @dev Return the log in base 2 of a positive value rounded towards zero.
     * Returns 0 if given 0.
     */
    function log2(uint256 value) internal pure returns (uint256) {
        uint256 result = 0;
        unchecked {
            if (value >> 128 > 0) {
                value >>= 128;
                result += 128;
            }
            if (value >> 64 > 0) {
                value >>= 64;
                result += 64;
            }
            if (value >> 32 > 0) {
                value >>= 32;
                result += 32;
            }
            if (value >> 16 > 0) {
                value >>= 16;
                result += 16;
            }
            if (value >> 8 > 0) {
                value >>= 8;
                result += 8;
            }
            if (value >> 4 > 0) {
                value >>= 4;
                result += 4;
            }
            if (value >> 2 > 0) {
                value >>= 2;
                result += 2;
            }
            if (value >> 1 > 0) {
                result += 1;
            }
        }
        return result;
    }

    /**
     * @dev Return the log in base 2, following the selected rounding direction, of a positive value.
     * Returns 0 if given 0.
     */
    function log2(uint256 value, Rounding rounding) internal pure returns (uint256) {
        unchecked {
            uint256 result = log2(value);
            return result + (unsignedRoundsUp(rounding) && 1 << result < value ? 1 : 0);
        }
    }

    /**
     * @dev Return the log in base 10 of a positive value rounded towards zero.
     * Returns 0 if given 0.
     */
    function log10(uint256 value) internal pure returns (uint256) {
        uint256 result = 0;
        unchecked {
            if (value >= 10 ** 64) {
                value /= 10 ** 64;
                result += 64;
            }
            if (value >= 10 ** 32) {
                value /= 10 ** 32;
                result += 32;
            }
            if (value >= 10 ** 16) {
                value /= 10 ** 16;
                result += 16;
            }
            if (value >= 10 ** 8) {
                value /= 10 ** 8;
                result += 8;
            }
            if (value >= 10 ** 4) {
                value /= 10 ** 4;
                result += 4;
            }
            if (value >= 10 ** 2) {
                value /= 10 ** 2;
                result += 2;
            }
            if (value >= 10 ** 1) {
                result += 1;
            }
        }
        return result;
    }

    /**
     * @dev Return the log in base 10, following the selected rounding direction, of a positive value.
     * Returns 0 if given 0.
     */
    function log10(uint256 value, Rounding rounding) internal pure returns (uint256) {
        unchecked {
            uint256 result = log10(value);
            return result + (unsignedRoundsUp(rounding) && 10 ** result < value ? 1 : 0);
        }
    }

    /**
     * @dev Return the log in base 256 of a positive value rounded towards zero.
     * Returns 0 if given 0.
     *
     * Adding one to the result gives the number of pairs of hex symbols needed to represent `value` as a hex string.
     */
    function log256(uint256 value) internal pure returns (uint256) {
        uint256 result = 0;
        unchecked {
            if (value >> 128 > 0) {
                value >>= 128;
                result += 16;
            }
            if (value >> 64 > 0) {
                value >>= 64;
                result += 8;
            }
            if (value >> 32 > 0) {
                value >>= 32;
                result += 4;
            }
            if (value >> 16 > 0) {
                value >>= 16;
                result += 2;
            }
            if (value >> 8 > 0) {
                result += 1;
            }
        }
        return result;
    }

    /**
     * @dev Return the log in base 256, following the selected rounding direction, of a positive value.
     * Returns 0 if given 0.
     */
    function log256(uint256 value, Rounding rounding) internal pure returns (uint256) {
        unchecked {
            uint256 result = log256(value);
            return result + (unsignedRoundsUp(rounding) && 1 << (result << 3) < value ? 1 : 0);
        }
    }

    /**
     * @dev Returns whether a provided rounding mode is considered rounding up for unsigned integers.
     */
    function unsignedRoundsUp(Rounding rounding) internal pure returns (bool) {
        return uint8(rounding) % 2 == 1;
    }
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (token/ERC20/utils/SafeERC20.sol)

pragma solidity ^0.8.20;

import {IERC20} from "../IERC20.sol";
import {IERC20Permit} from "../extensions/IERC20Permit.sol";
import {Address} from "../../../utils/Address.sol";

/**
 * @title SafeERC20
 * @dev Wrappers around ERC20 operations that throw on failure (when the token
 * contract returns false). Tokens that return no value (and instead revert or
 * throw on failure) are also supported, non-reverting calls are assumed to be
 * successful.
 * To use this library you can add a `using SafeERC20 for IERC20;` statement to your contract,
 * which allows you to call the safe operations as `token.safeTransfer(...)`, etc.
 */
library SafeERC20 {
    using Address for address;

    /**
     * @dev An operation with an ERC20 token failed.
     */
    error SafeERC20FailedOperation(address token);

    /**
     * @dev Indicates a failed `decreaseAllowance` request.
     */
    error SafeERC20FailedDecreaseAllowance(address spender, uint256 currentAllowance, uint256 requestedDecrease);

    /**
     * @dev Transfer `value` amount of `token` from the calling contract to `to`. If `token` returns no value,
     * non-reverting calls are assumed to be successful.
     */
    function safeTransfer(IERC20 token, address to, uint256 value) internal {
        _callOptionalReturn(token, abi.encodeCall(token.transfer, (to, value)));
    }

    /**
     * @dev Transfer `value` amount of `token` from `from` to `to`, spending the approval given by `from` to the
     * calling contract. If `token` returns no value, non-reverting calls are assumed to be successful.
     */
    function safeTransferFrom(IERC20 token, address from, address to, uint256 value) internal {
        _callOptionalReturn(token, abi.encodeCall(token.transferFrom, (from, to, value)));
    }

    /**
     * @dev Increase the calling contract's allowance toward `spender` by `value`. If `token` returns no value,
     * non-reverting calls are assumed to be successful.
     */
    function safeIncreaseAllowance(IERC20 token, address spender, uint256 value) internal {
        uint256 oldAllowance = token.allowance(address(this), spender);
        forceApprove(token, spender, oldAllowance + value);
    }

    /**
     * @dev Decrease the calling contract's allowance toward `spender` by `requestedDecrease`. If `token` returns no
     * value, non-reverting calls are assumed to be successful.
     */
    function safeDecreaseAllowance(IERC20 token, address spender, uint256 requestedDecrease) internal {
        unchecked {
            uint256 currentAllowance = token.allowance(address(this), spender);
            if (currentAllowance < requestedDecrease) {
                revert SafeERC20FailedDecreaseAllowance(spender, currentAllowance, requestedDecrease);
            }
            forceApprove(token, spender, currentAllowance - requestedDecrease);
        }
    }

    /**
     * @dev Set the calling contract's allowance toward `spender` to `value`. If `token` returns no value,
     * non-reverting calls are assumed to be successful. Meant to be used with tokens that require the approval
     * to be set to zero before setting it to a non-zero value, such as USDT.
     */
    function forceApprove(IERC20 token, address spender, uint256 value) internal {
        bytes memory approvalCall = abi.encodeCall(token.approve, (spender, value));

        if (!_callOptionalReturnBool(token, approvalCall)) {
            _callOptionalReturn(token, abi.encodeCall(token.approve, (spender, 0)));
            _callOptionalReturn(token, approvalCall);
        }
    }

    /**
     * @dev Imitates a Solidity high-level call (i.e. a regular function call to a contract), relaxing the requirement
     * on the return value: the return value is optional (but if data is returned, it must not be false).
     * @param token The token targeted by the call.
     * @param data The call data (encoded using abi.encode or one of its variants).
     */
    function _callOptionalReturn(IERC20 token, bytes memory data) private {
        // We need to perform a low level call here, to bypass Solidity's return data size checking mechanism, since
        // we're implementing it ourselves. We use {Address-functionCall} to perform this call, which verifies that
        // the target address contains contract code and also asserts for success in the low-level call.

        bytes memory returndata = address(token).functionCall(data);
        if (returndata.length != 0 && !abi.decode(returndata, (bool))) {
            revert SafeERC20FailedOperation(address(token));
        }
    }

    /**
     * @dev Imitates a Solidity high-level call (i.e. a regular function call to a contract), relaxing the requirement
     * on the return value: the return value is optional (but if data is returned, it must not be false).
     * @param token The token targeted by the call.
     * @param data The call data (encoded using abi.encode or one of its variants).
     *
     * This is a variant of {_callOptionalReturn} that silents catches all reverts and returns a bool instead.
     */
    function _callOptionalReturnBool(IERC20 token, bytes memory data) private returns (bool) {
        // We need to perform a low level call here, to bypass Solidity's return data size checking mechanism, since
        // we're implementing it ourselves. We cannot use {Address-functionCall} here since this should return false
        // and not revert is the subcall reverts.

        (bool success, bytes memory returndata) = address(token).call(data);
        return success && (returndata.length == 0 || abi.decode(returndata, (bool))) && address(token).code.length > 0;
    }
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (utils/types/Time.sol)

pragma solidity ^0.8.20;

import {Math} from "../math/Math.sol";
import {SafeCast} from "../math/SafeCast.sol";

/**
 * @dev This library provides helpers for manipulating time-related objects.
 *
 * It uses the following types:
 * - `uint48` for timepoints
 * - `uint32` for durations
 *
 * While the library doesn't provide specific types for timepoints and duration, it does provide:
 * - a `Delay` type to represent duration that can be programmed to change value automatically at a given point
 * - additional helper functions
 */
library Time {
    using Time for *;

    /**
     * @dev Get the block timestamp as a Timepoint.
     */
    function timestamp() internal view returns (uint48) {
        return SafeCast.toUint48(block.timestamp);
    }

    /**
     * @dev Get the block number as a Timepoint.
     */
    function blockNumber() internal view returns (uint48) {
        return SafeCast.toUint48(block.number);
    }

    // ==================================================== Delay =====================================================
    /**
     * @dev A `Delay` is a uint32 duration that can be programmed to change value automatically at a given point in the
     * future. The "effect" timepoint describes when the transitions happens from the "old" value to the "new" value.
     * This allows updating the delay applied to some operation while keeping some guarantees.
     *
     * In particular, the {update} function guarantees that if the delay is reduced, the old delay still applies for
     * some time. For example if the delay is currently 7 days to do an upgrade, the admin should not be able to set
     * the delay to 0 and upgrade immediately. If the admin wants to reduce the delay, the old delay (7 days) should
     * still apply for some time.
     *
     *
     * The `Delay` type is 112 bits long, and packs the following:
     *
     * ```
     *   | [uint48]: effect date (timepoint)
     *   |           | [uint32]: value before (duration)
     *   ?           ?       ? [uint32]: value after (duration)
     * 0xAAAAAAAAAAAABBBBBBBBCCCCCCCC
     * ```
     *
     * NOTE: The {get} and {withUpdate} functions operate using timestamps. Block number based delays are not currently
     * supported.
     */
    type Delay is uint112;

    /**
     * @dev Wrap a duration into a Delay to add the one-step "update in the future" feature
     */
    function toDelay(uint32 duration) internal pure returns (Delay) {
        return Delay.wrap(duration);
    }

    /**
     * @dev Get the value at a given timepoint plus the pending value and effect timepoint if there is a scheduled
     * change after this timepoint. If the effect timepoint is 0, then the pending value should not be considered.
     */
    function _getFullAt(Delay self, uint48 timepoint) private pure returns (uint32, uint32, uint48) {
        (uint32 valueBefore, uint32 valueAfter, uint48 effect) = self.unpack();
        return effect <= timepoint ? (valueAfter, 0, 0) : (valueBefore, valueAfter, effect);
    }

    /**
     * @dev Get the current value plus the pending value and effect timepoint if there is a scheduled change. If the
     * effect timepoint is 0, then the pending value should not be considered.
     */
    function getFull(Delay self) internal view returns (uint32, uint32, uint48) {
        return _getFullAt(self, timestamp());
    }

    /**
     * @dev Get the current value.
     */
    function get(Delay self) internal view returns (uint32) {
        (uint32 delay, , ) = self.getFull();
        return delay;
    }

    /**
     * @dev Update a Delay object so that it takes a new duration after a timepoint that is automatically computed to
     * enforce the old delay at the moment of the update. Returns the updated Delay object and the timestamp when the
     * new delay becomes effective.
     */
    function withUpdate(
        Delay self,
        uint32 newValue,
        uint32 minSetback
    ) internal view returns (Delay updatedDelay, uint48 effect) {
        uint32 value = self.get();
        uint32 setback = uint32(Math.max(minSetback, value > newValue ? value - newValue : 0));
        effect = timestamp() + setback;
        return (pack(value, newValue, effect), effect);
    }

    /**
     * @dev Split a delay into its components: valueBefore, valueAfter and effect (transition timepoint).
     */
    function unpack(Delay self) internal pure returns (uint32 valueBefore, uint32 valueAfter, uint48 effect) {
        uint112 raw = Delay.unwrap(self);

        valueAfter = uint32(raw);
        valueBefore = uint32(raw >> 32);
        effect = uint48(raw >> 64);

        return (valueBefore, valueAfter, effect);
    }

    /**
     * @dev pack the components into a Delay object.
     */
    function pack(uint32 valueBefore, uint32 valueAfter, uint48 effect) internal pure returns (Delay) {
        return Delay.wrap((uint112(effect) << 64) | (uint112(valueBefore) << 32) | uint112(valueAfter));
    }
}

File 9 of 36 : Commands.sol
// SPDX-License-Identifier: BUSL-1.1

pragma solidity 0.8.20;

// Based on https://github.com/Uniswap/universal-router/blob/main/contracts/libraries/Commands.sol

library Commands {
    bytes1 internal constant COMMAND_TYPE_MASK = 0x3f;

    /**
     * Transfers tokens from msg.sender to the Router.
     * (address token, uint256 value)
     */
    uint256 constant TRANSFER_FROM = 0x00;

    /**
     * Transfers tokens from msg.sender to the Router with a permit.
     * (address token, uint256 value, uint256 deadline, uint8 v, bytes32 r, bytes32 s)
     */
    uint256 constant TRANSFER_FROM_WITH_PERMIT = 0x01;

    /**
     * Transfers tokens from the Router to a recipient.
     * (address token, address recipient, uint256 value)
     */
    uint256 constant TRANSFER = 0x02;

    /**
     * Performs a swap on Curve CryptoSwap pool.
     * (address pool, uint256 i, uint256 j, uint256 amountIn, uint256 minAmountOut, address recipient)
     */
    uint256 constant CURVE_SWAP = 0x03;

    /**
     * Deposits an ERC20 underlying into an ERC4626 IBT
     * ibt represents the target IBT and assets represents the amount of underlying to deposit
     * (address ibt, uint256 assets, address recipient)
     */
    uint256 constant DEPOSIT_ASSET_IN_IBT = 0x04;

    /**
     * Deposits an ERC20 underlying into a PT
     * assets represents the amount of underlying to deposit
     * (address pt, uint256 assets, address ptRecipient, address ytRecipient, uint256 minShares)
     */
    uint256 constant DEPOSIT_ASSET_IN_PT = 0x05;

    /**
     * Deposits an ERC4626 IBT into a PT
     * ibts represents the amount of IBT to deposit
     * (address pt, uint256 ibts, address ptRecipient, address ytRecipient, uint256 minShares)
     */
    uint256 constant DEPOSIT_IBT_IN_PT = 0x06;

    /**
     * Redeems an ERC4626 IBT for the corresponding ERC20 underlying
     * ibt represents the target IBT and shares represents the amount of IBT to redeem
     * (address ibt, uint256 shares, address recipient)
     */
    uint256 constant REDEEM_IBT_FOR_ASSET = 0x07;

    /**
     * Redeems a PT:YT pair for the corresponding ERC20 underlying
     * shares represents the amount of PT to redeem
     * (address pt, uint256 shares, address recipient, uint256 minAssets)
     */
    uint256 constant REDEEM_PT_FOR_ASSET = 0x08;

    /**
     * Redeems a PT:YT pair for the corresponding ERC4626 IBT
     * shares represents the amount of PT to redeem
     * (address pt, uint256 shares, address recipient, uint256 minIbts)
     */
    uint256 constant REDEEM_PT_FOR_IBT = 0x09;

    /**
     * Performs a flash loan
     * data represents the sequence of commands and inputs to be executed during the loan
     * (address lender, address token, uint256 amount, bytes calldata data)
     */
    uint256 constant FLASH_LOAN = 0x0a;

    /**
     * Splits liquidity between IBT and PT before depositing in a Curve CryptoSwap pool
     * ibts represents the amount of IBT to split between IBT and PT before depositing in the pool
     * recipient represents the address that will receive the IBT/PT
     * ytRecipient represents the address that will receive the YTs generated by the split
     * (address pool, uint256 ibts, address recipient, address ytRecipient, uint256 minPTShares)
     */
    uint256 constant CURVE_SPLIT_IBT_LIQUIDITY = 0x0b;

    /**
     * Deposits coins into a Curve CryptoSwap pool
     * amounts includes the amounts of IBT and PT to deposit in the pool
     * min_mint_amount represents the minimum amount of LP tokens to mint
     * (address pool, uint256[2] amounts, uint256 min_mint_amount, address recipient)
     */
    uint256 constant CURVE_ADD_LIQUIDITY = 0x0c;

    /**
     * Withdraws coins from a Curve CryptoSwap pool
     * lps represents the amount of LP tokens to burn
     * min_amounts represents the minimum amount of coins to receive
     * (address pool, uint256 lps, uint256[2] min_amounts, address recipient)
     */
    uint256 constant CURVE_REMOVE_LIQUIDITY = 0x0d;

    /**
     * Withdraws a single coin from a Curve CryptoSwap pool
     * lps represents the amount of LP tokens to burn
     * i represents the index of the coin to withdraw
     * min_amount represents the minimum amount of coin to receive
     * (address pool, uint256 lps, uint256 i, uint256 min_amount, address recipient)
     */
    uint256 constant CURVE_REMOVE_LIQUIDITY_ONE_COIN = 0x0e;

    /**
     * Performs a minimum balance check.
     * (address token, address owner, uint256 minValue)
     */
    uint256 constant ASSERT_MIN_BALANCE = 0x0f;

    /**
     * Wraps shares of an interest-bearing vault into an ERC-4626 Wrapper
     * vaultShares represents the amount of vault shares to unwrap
     * (address wrapper, uint256 vaultShares, address recipient)
     */
    uint256 constant WRAP_VAULT_IN_4626_ADAPTER = 0x10;

    /**
     * Unwraps shares of an interest-bearing vault from an ERC-4626 Wrapper
     * wrapperShares represents the amount of wrapper shares to redeem
     * (address wrapper, uint256 wrapperShares, address recipient)
     */
    uint256 constant UNWRAP_VAULT_FROM_4626_ADAPTER = 0x11;

    /**
     * Performs a swap on Kyberswap.
     * (address tokenIn, uint256 amountIn, address tokenOut, uint256 expectedAmountOut, bytes targetData)
     */
    uint256 constant KYBER_SWAP = 0x12;

    /**
     * Removes liquidity from Pendle.
     * (address receiver, address market, uint256 netLpToRemove, TokenOutput calldata output, LimitOrderData calldata limit)
     */
    uint256 constant PENDLE_REMOVE_LIQUIDITY_SINGLE_TOKEN = 0x13;

    /**
     * Performs a swap on a Curve TwoCrypto NG pool.
     * (address pool, uint256 i, uint256 j, uint256 amountIn, uint256 minAmountOut, address recipient)
     */
    uint256 constant CURVE_NG_SWAP = 0x15;

    /**
     * Splits liquidity between IBT and PT before depositing in a Curve TwoCrypto NG pool.
     * ibts represents the amount of IBT to split between IBT and PT before depositing in the pool
     * recipient represents the address that will receive the IBT/PT
     * ytRecipient represents the address that will receive the YTs generated by the split
     * (address pool, uint256 ibts, address recipient, address ytRecipient, uint256 minPTShares)
     */
    uint256 constant CURVE_NG_SPLIT_IBT_LIQUIDITY = 0x16;

    /**
     * Deposits coins into a Curve TwoCrypto NG pool.
     * amounts includes the amounts of IBT and PT to deposit in the pool
     * min_mint_amount represents the minimum amount of LP tokens to mint
     * (address pool, uint256[2] amounts, uint256 min_mint_amount, address recipient)
     */
    uint256 constant CURVE_NG_ADD_LIQUIDITY = 0x17;

    /**
     * Withdraws coins from a Curve TwoCrypto NG pool.
     * lps represents the amount of LP token shares to burn
     * min_amounts represents the minimum amount of coins to receive
     * (address pool, uint256 lps, uint256[2] min_amounts, address recipient)
     */
    uint256 constant CURVE_NG_REMOVE_LIQUIDITY = 0x18;

    /**
     * Withdraws a single coin from a Curve TwoCrypto NG pool.
     * lps represents the amount of LP token shares to burn
     * i represents the index of the coin to withdraw
     * min_amount represents the minimum amount of coin to receive
     * (address pool, uint256 lps, uint256 i, uint256 min_amount, address recipient)
     */
    uint256 constant CURVE_NG_REMOVE_LIQUIDITY_ONE_COIN = 0x19;

    /**
     * Splits liquidity between IBT and PT before depositing in a Curve Stableswap NG pool
     * ibts represents the amount of IBT to split between IBT and PT before depositing in the pool
     * recipient represents the address that will receive the IBT/PT
     * ytRecipient represents the address that will receive the YTs generated by the split
     * (address pool, uint256 ibts, address recipient, address ytRecipient, uint256 minPTShares)
     */
    uint256 constant CURVE_SPLIT_IBT_LIQUIDITY_SNG = 0x1A;

    /**
     * Deposits coins into a Curve Stableswap NG pool
     * amounts includes the amounts of IBT and PT to deposit in the pool
     * min_mint_amount represents the minimum amount of LP tokens to mint
     * (address pool, uint256[2] amounts, uint256 min_mint_amount, address recipient)
     */
    uint256 constant CURVE_ADD_LIQUIDITY_SNG = 0x1B;

    /**
     * Withdraws coins from a Curve Stableswap NG pool
     * lps represents the amount of LP tokens to burn
     * min_amounts represents the minimum amount of coins to receive
     * (address pool, uint256 lps, uint256[2] min_amounts, address recipient)
     */
    uint256 constant CURVE_REMOVE_LIQUIDITY_SNG = 0x1C;

    /**
     * Withdraws a single coin from a Curve Stableswap NG pool
     * lps represents the amount of LP tokens to burn
     * i represents the index of the coin to withdraw
     * min_amount represents the minimum amount of coin to receive
     * (address pool, uint256 lps, uint256 i, uint256 min_amount, address recipient)
     */
    uint256 constant CURVE_REMOVE_LIQUIDITY_ONE_COIN_SNG = 0x1D;

    /**
     * Performs a swap on Curve Stableswap NG pool.
     * (address pool, uint256 i, uint256 j, uint256 amountIn, uint256 minAmountOut, address recipient)
     */
    uint256 constant CURVE_SWAP_SNG = 0x1E;

    /**
     * Given a ratio in which we want to add liquidity to Curve legacy Cryptoswap pools, calculates the amount of IBTs to tokenize in PTs and YTs
     * so that the ratio of the IBTs left after tokenization with the PTs obtained via tokenization mathes the
     * proportion given in function call arguments.
     * (address pool, uint256 ibts, uint256 prop, address recipient, address ytRecipient, uint256 minPTShares)
     */
    uint256 constant CURVE_SPLIT_IBT_LIQUIDITY_CUSTOM_PROP = 0x1F;

    /**
     * Given a ratio in which we want to add liquidity to Curve NG Cryptoswap pools, calculates the amount of IBTs to tokenize in PTs and YTs
     * so that the ratio of the IBTs left after tokenization with the PTs obtained via tokenization mathes the
     * proportion given in function call arguments.
     * (address pool, uint256 ibts, uint256 prop, address recipient, address ytRecipient, uint256 minPTShares)
     */
    uint256 constant CURVE_SPLIT_IBT_LIQUIDITY_CUSTOM_PROP_NG = 0x20;

    /**
     * Given a ratio in which we want to add liquidity to Curve StableSwap pools, calculates the amount of IBTs to tokenize in PTs and YTs
     * so that the ratio of the IBTs left after tokenization with the PTs obtained via tokenization mathes the
     * proportion given in function call arguments.
     * (address pool, uint256 ibts, uint256 prop, address recipient, address ytRecipient, uint256 minPTShares)
     */
    uint256 constant CURVE_SPLIT_IBT_LIQUIDITY_CUSTOM_PROP_SNG = 0x21;

    /**
     * Deposits native token into a wrapper.
     * (address wrapper, uint256 amount)
     */
    uint256 constant DEPOSIT_NATIVE_IN_WRAPPER = 0x22;

    /**
     * Withdraws native token from a wrapper.
     * (address wrapper, uint256 amount)
     */
    uint256 constant WITHDRAW_NATIVE_FROM_WRAPPER = 0x23;

    /**
     * Transfers native token to a recipient.
     * (address recipient, uint256 amount)
     */
    uint256 constant TRANSFER_NATIVE = 0x24;
}

File 10 of 36 : IERC20.sol
// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (interfaces/IERC20.sol)

pragma solidity ^0.8.20;

import {IERC20} from "../token/ERC20/IERC20.sol";

// SPDX-License-Identifier: BUSL-1.1

pragma solidity 0.8.20;

import {Math} from "openzeppelin-math/Math.sol";
import {IERC20Permit} from "openzeppelin-contracts/token/ERC20/extensions/IERC20Permit.sol";
import {IERC3156FlashBorrower} from "openzeppelin-contracts/interfaces/IERC3156FlashBorrower.sol";
import {IERC3156FlashLender} from "openzeppelin-contracts/interfaces/IERC3156FlashLender.sol";
import {IERC4626} from "openzeppelin-contracts/interfaces/IERC4626.sol";
import {SafeERC20, IERC20} from "openzeppelin-contracts/token/ERC20/utils/SafeERC20.sol";
import {Initializable} from "openzeppelin-contracts-upgradeable/proxy/utils/Initializable.sol";
import {Commands} from "./Commands.sol";
import {Constants} from "./Constants.sol";
import {RayMath} from "../libraries/RayMath.sol";
import {CurvePoolUtil} from "../libraries/CurvePoolUtil.sol";
import {ICurvePool} from "../interfaces/ICurvePool.sol";
import {IStableSwapNG} from "../interfaces/IStableSwapNG.sol";
import {ICurveNGPool} from "../interfaces/ICurveNGPool.sol";
import {IPrincipalToken} from "src/interfaces/IPrincipalToken.sol";
import {IRegistry} from "../interfaces/IRegistry.sol";
import {ISpectra4626Wrapper} from "../interfaces/ISpectra4626Wrapper.sol";
import {RouterUtil} from "./util/RouterUtil.sol";
import {INATIVE} from "../interfaces/INATIVE.sol";

abstract contract Dispatcher is Initializable {
    using SafeERC20 for IERC20;
    using Math for uint256;
    using RayMath for uint256;

    error InvalidCommandType(uint256 commandType);
    error MinimumBalanceNotReached(
        address token,
        address owner,
        uint256 minimumBalance,
        uint256 actualBalance
    );

    error InvalidFlashloanLender(address lender);
    error AddressError();
    error AmountError();
    error CallFailed();
    error PermitFailed();
    error MaxInvolvedTokensExceeded();
    error BalanceUnderflow();
    error KyberRouterNotSet();

    // used for tracking balance changes in _previewRate
    struct TokenBalance {
        address token;
        uint256 balance;
    }

    /** @dev registry of the protocol */
    address internal immutable registry;
    /** @dev used during a router execution to track the initiator of the execution */
    address internal msgSender;
    /** @dev used during a flashloan execution to track the lender address */
    address internal flashloanLender;
    /** @notice Router Util contract */
    address internal routerUtil;
    /** @notice Kyberswap Router */
    address internal kyberRouter;
    /** @dev used during a router execution to track the msg.value */
    uint256 internal msgValue;

    constructor(address _registry) {
        if (_registry == address(0)) {
            revert AddressError();
        }
        registry = _registry;
    }

    function __Dispatcher_init(
        address _routerUtil,
        address _kyberRouter
    ) internal onlyInitializing {
        if (_routerUtil == address(0)) {
            revert AddressError();
        }
        routerUtil = _routerUtil;
        kyberRouter = _kyberRouter;
    }

    receive() external payable {}

    /**
     * @dev Executes a single command along with its encoded input data
     * @param _commandType The encoded representation of the command
     * @param _inputs The encoded arguments for the specified command
     */
    function _dispatch(bytes1 _commandType, bytes calldata _inputs) internal {
        uint256 command = uint8(_commandType & Commands.COMMAND_TYPE_MASK);

        if (command == Commands.TRANSFER_FROM) {
            (address token, uint256 value) = abi.decode(_inputs, (address, uint256));
            IERC20(token).safeTransferFrom(msgSender, address(this), value);
        } else if (command == Commands.TRANSFER_FROM_WITH_PERMIT) {
            (address token, uint256 value, uint256 deadline, uint8 v, bytes32 r, bytes32 s) = abi
                .decode(_inputs, (address, uint256, uint256, uint8, bytes32, bytes32));
            try IERC20Permit(token).permit(msgSender, address(this), value, deadline, v, r, s) {
                // Permit executed successfully, proceed
            } catch {
                // Check allowance to see if permit was already executed
                uint256 allowance = IERC20(token).allowance(msgSender, address(this));
                if (allowance < value) {
                    revert PermitFailed();
                }
            }
            IERC20(token).safeTransferFrom(msgSender, address(this), value);
        } else if (command == Commands.TRANSFER) {
            (address token, address recipient, uint256 value) = abi.decode(
                _inputs,
                (address, address, uint256)
            );
            recipient = _resolveAddress(recipient);
            value = _resolveTokenValue(token, value);
            if (value != 0) {
                IERC20(token).safeTransfer(recipient, value);
            }
        } else if (
            command == Commands.CURVE_SWAP ||
            command == Commands.CURVE_NG_SWAP ||
            command == Commands.CURVE_SWAP_SNG
        ) {
            (
                address pool,
                uint256 i,
                uint256 j,
                uint256 amountIn,
                uint256 minAmountOut,
                address recipient
            ) = abi.decode(_inputs, (address, uint256, uint256, uint256, uint256, address));
            // pool.coins(i) is the token to be swapped
            address token = ICurvePool(pool).coins(i);
            amountIn = _resolveTokenValue(token, amountIn);
            recipient = _resolveAddress(recipient);
            IERC20(token).forceApprove(pool, amountIn);
            if (command == Commands.CURVE_SWAP) {
                ICurvePool(pool).exchange(
                    i,
                    j,
                    amountIn,
                    minAmountOut,
                    false, // Do not use ETH
                    recipient
                );
            } else if (command == Commands.CURVE_NG_SWAP) {
                ICurveNGPool(pool).exchange(i, j, amountIn, minAmountOut, recipient);
            } else {
                IStableSwapNG(pool).exchange(
                    int128(int256(i)),
                    int128(int256(j)),
                    amountIn,
                    minAmountOut,
                    recipient
                );
            }
            IERC20(token).forceApprove(pool, 0);
        } else if (command == Commands.WRAP_VAULT_IN_4626_ADAPTER) {
            (
                address wrapper,
                uint256 vaultShares,
                address recipient,
                uint256 minWrapperShares
            ) = abi.decode(_inputs, (address, uint256, address, uint256));
            address vault = ISpectra4626Wrapper(wrapper).vaultShare();
            recipient = _resolveAddress(recipient);
            vaultShares = _resolveTokenValue(vault, vaultShares);
            IERC20(vault).forceApprove(wrapper, vaultShares);
            ISpectra4626Wrapper(wrapper).wrap(vaultShares, recipient, minWrapperShares);
            IERC20(vault).forceApprove(wrapper, 0);
        } else if (command == Commands.UNWRAP_VAULT_FROM_4626_ADAPTER) {
            (
                address wrapper,
                uint256 wrapperShares,
                address recipient,
                uint256 minVaultShares
            ) = abi.decode(_inputs, (address, uint256, address, uint256));
            recipient = _resolveAddress(recipient);
            wrapperShares = _resolveTokenValue(wrapper, wrapperShares);
            ISpectra4626Wrapper(wrapper).unwrap(
                wrapperShares,
                recipient,
                address(this),
                minVaultShares
            );
        } else if (command == Commands.DEPOSIT_ASSET_IN_IBT) {
            (address ibt, uint256 assets, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            address asset = IERC4626(ibt).asset();
            assets = _resolveTokenValue(asset, assets);
            recipient = _resolveAddress(recipient);
            IERC20(asset).forceApprove(ibt, assets);
            IERC4626(ibt).deposit(assets, recipient);
            IERC20(asset).forceApprove(ibt, 0);
        } else if (command == Commands.DEPOSIT_ASSET_IN_PT) {
            (
                address pt,
                uint256 assets,
                address ptRecipient,
                address ytRecipient,
                uint256 minShares
            ) = abi.decode(_inputs, (address, uint256, address, address, uint256));
            address asset = IPrincipalToken(pt).underlying();
            assets = _resolveTokenValue(asset, assets);
            ptRecipient = _resolveAddress(ptRecipient);
            ytRecipient = _resolveAddress(ytRecipient);
            bool isRegisteredPT = IRegistry(registry).isRegisteredPT(pt);
            if (isRegisteredPT) {
                _ensureApproved(asset, pt, assets);
            } else {
                IERC20(asset).forceApprove(pt, assets);
            }
            IPrincipalToken(pt).deposit(assets, ptRecipient, ytRecipient, minShares);
            if (!isRegisteredPT) {
                IERC20(asset).forceApprove(pt, 0);
            }
        } else if (command == Commands.DEPOSIT_IBT_IN_PT) {
            (
                address pt,
                uint256 ibts,
                address ptRecipient,
                address ytRecipient,
                uint256 minShares
            ) = abi.decode(_inputs, (address, uint256, address, address, uint256));
            address ibt = IPrincipalToken(pt).getIBT();
            ibts = _resolveTokenValue(ibt, ibts);
            ptRecipient = _resolveAddress(ptRecipient);
            ytRecipient = _resolveAddress(ytRecipient);
            bool isRegisteredPT = IRegistry(registry).isRegisteredPT(pt);
            if (isRegisteredPT) {
                _ensureApproved(ibt, pt, ibts);
            } else {
                IERC20(ibt).forceApprove(pt, ibts);
            }
            IPrincipalToken(pt).depositIBT(ibts, ptRecipient, ytRecipient, minShares);
            if (!isRegisteredPT) {
                IERC20(ibt).forceApprove(pt, 0);
            }
        } else if (command == Commands.REDEEM_IBT_FOR_ASSET) {
            (address ibt, uint256 shares, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            shares = _resolveTokenValue(ibt, shares);
            recipient = _resolveAddress(recipient);
            IERC4626(ibt).redeem(shares, recipient, address(this));
        } else if (
            command == Commands.REDEEM_PT_FOR_ASSET || command == Commands.REDEEM_PT_FOR_IBT
        ) {
            (address pt, uint256 shares, address recipient, uint256 minOut) = abi.decode(
                _inputs,
                (address, uint256, address, uint256)
            );
            recipient = _resolveAddress(recipient);
            shares = _resolveTokenValue(pt, shares);
            uint256 redeemShares = block.timestamp < IPrincipalToken(pt).maturity()
                ? Math.min(shares, IERC20(IPrincipalToken(pt).getYT()).balanceOf(address(this)))
                : shares;
            if (command == Commands.REDEEM_PT_FOR_ASSET) {
                IPrincipalToken(pt).redeem(redeemShares, recipient, address(this), minOut);
            } else {
                IPrincipalToken(pt).redeemForIBT(redeemShares, recipient, address(this), minOut);
            }
        } else if (command == Commands.FLASH_LOAN) {
            (address lender, address token, uint256 amount, bytes memory data) = abi.decode(
                _inputs,
                (address, address, uint256, bytes)
            );
            if (!IRegistry(registry).isRegisteredPT(lender)) {
                revert InvalidFlashloanLender(lender);
            }
            flashloanLender = lender;
            IERC3156FlashLender(lender).flashLoan(
                IERC3156FlashBorrower(address(this)),
                token,
                amount,
                data
            );
            flashloanLender = address(0);
        } else if (
            command == Commands.CURVE_SPLIT_IBT_LIQUIDITY ||
            command == Commands.CURVE_NG_SPLIT_IBT_LIQUIDITY ||
            command == Commands.CURVE_SPLIT_IBT_LIQUIDITY_SNG
        ) {
            (
                address pool,
                uint256 ibts,
                address recipient,
                address ytRecipient,
                uint256 minPTShares
            ) = abi.decode(_inputs, (address, uint256, address, address, uint256));
            recipient = _resolveAddress(recipient);
            ytRecipient = _resolveAddress(ytRecipient);
            address ibt = ICurvePool(pool).coins(0);
            address pt = ICurvePool(pool).coins(1);
            ibts = _resolveTokenValue(ibt, ibts);
            uint256 ibtToDepositInPT = CurvePoolUtil.calcIBTsToTokenizeForCurvePool(ibts, pool, pt);
            if (ibtToDepositInPT != 0) {
                bool isRegisteredPT = IRegistry(registry).isRegisteredPT(pt);
                if (isRegisteredPT) {
                    _ensureApproved(ibt, pt, ibtToDepositInPT);
                } else {
                    IERC20(ibt).forceApprove(pt, ibtToDepositInPT);
                }
                IPrincipalToken(pt).depositIBT(
                    ibtToDepositInPT,
                    recipient,
                    ytRecipient,
                    minPTShares
                );
                if (!isRegisteredPT) {
                    IERC20(ibt).forceApprove(pt, 0);
                }
            }
            if (recipient != address(this) && (ibts - ibtToDepositInPT) != 0) {
                IERC20(ibt).safeTransfer(recipient, ibts - ibtToDepositInPT);
            }
        } else if (
            command == Commands.CURVE_SPLIT_IBT_LIQUIDITY_CUSTOM_PROP ||
            command == Commands.CURVE_SPLIT_IBT_LIQUIDITY_CUSTOM_PROP_NG ||
            command == Commands.CURVE_SPLIT_IBT_LIQUIDITY_CUSTOM_PROP_SNG
        ) {
            (
                address pool,
                uint256 ibts,
                uint256 prop,
                address recipient,
                address ytRecipient,
                uint256 minPTShares
            ) = abi.decode(_inputs, (address, uint256, uint256, address, address, uint256));
            recipient = _resolveAddress(recipient);
            ytRecipient = _resolveAddress(ytRecipient);
            address ibt = ICurvePool(pool).coins(0);
            address pt = ICurvePool(pool).coins(1);
            ibts = _resolveTokenValue(ibt, ibts);
            uint256 ibtToDepositInPT = CurvePoolUtil.calcIBTsToTokenizeForCurvePoolCustomProp(
                ibts,
                prop,
                pt
            );
            if (ibtToDepositInPT != 0) {
                bool isRegisteredPT = IRegistry(registry).isRegisteredPT(pt);
                if (isRegisteredPT) {
                    _ensureApproved(ibt, pt, ibtToDepositInPT);
                } else {
                    IERC20(ibt).forceApprove(pt, ibtToDepositInPT);
                }
                IPrincipalToken(pt).depositIBT(
                    ibtToDepositInPT,
                    recipient,
                    ytRecipient,
                    minPTShares
                );
                if (!isRegisteredPT) {
                    IERC20(ibt).forceApprove(pt, 0);
                }
            }
            if (recipient != address(this) && (ibts - ibtToDepositInPT) != 0) {
                IERC20(ibt).safeTransfer(recipient, ibts - ibtToDepositInPT);
            }
        } else if (
            command == Commands.CURVE_ADD_LIQUIDITY || command == Commands.CURVE_NG_ADD_LIQUIDITY
        ) {
            (
                address pool,
                uint256[2] memory amounts,
                uint256 min_mint_amount,
                address recipient
            ) = abi.decode(_inputs, (address, uint256[2], uint256, address));
            recipient = _resolveAddress(recipient);
            address ibt = ICurvePool(pool).coins(0);
            address pt = ICurvePool(pool).coins(1);
            amounts[0] = _resolveTokenValue(ibt, amounts[0]);
            amounts[1] = _resolveTokenValue(pt, amounts[1]);
            IERC20(ibt).forceApprove(pool, amounts[0]);
            IERC20(pt).forceApprove(pool, amounts[1]);
            (command == Commands.CURVE_ADD_LIQUIDITY)
                ? ICurvePool(pool).add_liquidity(amounts, min_mint_amount, false, recipient)
                : ICurveNGPool(pool).add_liquidity(amounts, min_mint_amount, recipient);
            IERC20(ibt).forceApprove(pool, 0);
            IERC20(pt).forceApprove(pool, 0);
        } else if (
            command == Commands.CURVE_REMOVE_LIQUIDITY ||
            command == Commands.CURVE_NG_REMOVE_LIQUIDITY
        ) {
            (address pool, uint256 lps, uint256[2] memory min_amounts, address recipient) = abi
                .decode(_inputs, (address, uint256, uint256[2], address));
            recipient = _resolveAddress(recipient);
            address lpToken = (command == Commands.CURVE_REMOVE_LIQUIDITY)
                ? ICurvePool(pool).token()
                : pool;
            lps = _resolveTokenValue(lpToken, lps);
            (command == Commands.CURVE_REMOVE_LIQUIDITY)
                ? ICurvePool(pool).remove_liquidity(lps, min_amounts, false, recipient)
                : ICurveNGPool(pool).remove_liquidity(lps, min_amounts, recipient);
        } else if (
            command == Commands.CURVE_NG_REMOVE_LIQUIDITY_ONE_COIN ||
            command == Commands.CURVE_REMOVE_LIQUIDITY_ONE_COIN
        ) {
            (address pool, uint256 lps, uint256 i, uint256 min_amount, address recipient) = abi
                .decode(_inputs, (address, uint256, uint256, uint256, address));
            recipient = _resolveAddress(recipient);
            address lpToken = (command == Commands.CURVE_REMOVE_LIQUIDITY_ONE_COIN)
                ? ICurvePool(pool).token()
                : pool;
            lps = _resolveTokenValue(lpToken, lps);
            (command == Commands.CURVE_REMOVE_LIQUIDITY_ONE_COIN)
                ? ICurvePool(pool).remove_liquidity_one_coin(lps, i, min_amount, false, recipient)
                : ICurveNGPool(pool).remove_liquidity_one_coin(lps, i, min_amount, recipient);
        } else if (command == Commands.KYBER_SWAP) {
            if (kyberRouter == address(0)) {
                revert KyberRouterNotSet();
            }
            (address tokenIn, uint256 amountIn, address tokenOut, , bytes memory targetData) = abi
                .decode(_inputs, (address, uint256, address, uint256, bytes));
            if (tokenOut == Constants.ETH) {
                revert AddressError();
            }
            if (tokenIn == Constants.ETH) {
                if (msgValue != amountIn) {
                    revert AmountError();
                }
                (bool success, ) = kyberRouter.call{value: msgValue}(targetData);
                if (!success) {
                    revert CallFailed();
                }
            } else {
                amountIn = _resolveTokenValue(tokenIn, amountIn);
                IERC20(tokenIn).forceApprove(kyberRouter, amountIn);
                (bool success, ) = kyberRouter.call(targetData);
                if (!success) {
                    revert CallFailed();
                }
                IERC20(tokenIn).forceApprove(kyberRouter, 0);
            }
        } else if (command == Commands.ASSERT_MIN_BALANCE) {
            (address token, address owner, uint256 minValue) = abi.decode(
                _inputs,
                (address, address, uint256)
            );
            owner = _resolveAddress(owner);
            uint256 balance = IERC20(token).balanceOf(owner);
            if (balance < minValue) {
                revert MinimumBalanceNotReached(token, owner, minValue, balance);
            }
        } else if (command == Commands.CURVE_ADD_LIQUIDITY_SNG) {
            (
                address pool,
                uint256[] memory amounts,
                uint256 min_mint_amount,
                address recipient
            ) = abi.decode(_inputs, (address, uint256[], uint256, address));

            recipient = _resolveAddress(recipient);
            address ibt = IStableSwapNG(pool).coins(0);
            address pt = IStableSwapNG(pool).coins(1);
            amounts[0] = _resolveTokenValue(ibt, amounts[0]);
            amounts[1] = _resolveTokenValue(pt, amounts[1]);
            IERC20(ibt).forceApprove(pool, amounts[0]);
            IERC20(pt).forceApprove(pool, amounts[1]);
            IStableSwapNG(pool).add_liquidity(amounts, min_mint_amount, recipient);
            IERC20(ibt).forceApprove(pool, 0);
            IERC20(pt).forceApprove(pool, 0);
        } else if (command == Commands.CURVE_REMOVE_LIQUIDITY_SNG) {
            (address pool, uint256 lps, uint256[] memory min_amounts, address recipient) = abi
                .decode(_inputs, (address, uint256, uint256[], address));
            recipient = _resolveAddress(recipient);
            lps = _resolveTokenValue(pool, lps);
            IStableSwapNG(pool).remove_liquidity(lps, min_amounts, recipient);
        } else if (command == Commands.CURVE_REMOVE_LIQUIDITY_ONE_COIN_SNG) {
            (address pool, uint256 lps, int128 i, uint256 min_amount, address recipient) = abi
                .decode(_inputs, (address, uint256, int128, uint256, address));
            recipient = _resolveAddress(recipient);
            lps = _resolveTokenValue(pool, lps);
            IStableSwapNG(pool).remove_liquidity_one_coin(lps, i, min_amount, recipient);
        } else if (command == Commands.DEPOSIT_NATIVE_IN_WRAPPER) {
            (address wrapper, uint256 amount) = abi.decode(_inputs, (address, uint256));
            INATIVE(wrapper).deposit{value: amount}();
        } else if (command == Commands.WITHDRAW_NATIVE_FROM_WRAPPER) {
            (address wrapper, uint256 amount) = abi.decode(_inputs, (address, uint256));
            INATIVE(wrapper).withdraw(amount);
        } else if (command == Commands.TRANSFER_NATIVE) {
            (address recipient, uint256 amount) = abi.decode(_inputs, (address, uint256));
            (bool success, ) = payable(recipient).call{value: amount}("");
            if (!success) {
                revert CallFailed();
            }
        } else {
            revert InvalidCommandType(command);
        }
    }

    /**
     * @dev Returns either the input token value as is, or replaced with its corresponding behaviour in Constants.sol
     * @param _token The address of the token
     * @param _value The token amount
     * @return The amount stored previously if current amount used for detecting contract balance, else current value
     */
    function _resolveTokenValue(address _token, uint256 _value) internal view returns (uint256) {
        return
            (_value == Constants.CONTRACT_BALANCE)
                ? IERC20(_token).balanceOf(address(this))
                : _value;
    }

    /**
     * @dev Returns either the input address as is, or replaced with its corresponding behaviour in Constants.sol
     * @param _input The input address
     * @return The address corresponding to input
     */
    function _resolveAddress(address _input) internal view returns (address) {
        if (_input == Constants.ADDRESS_THIS) {
            return address(this);
        } else if (_input == Constants.MSG_SENDER) {
            return msgSender;
        } else {
            return _input;
        }
    }

    /**
     * @dev Checks the allowance of a token and approves the spender if necessary
     * @param _token address of the token to be approved
     * @param _spender address of the spender
     * @param _value token amount
     */
    function _ensureApproved(address _token, address _spender, uint256 _value) internal {
        uint256 allowance = IERC20(_token).allowance(address(this), _spender);
        if (allowance < _value) {
            // This approval will only be executed the first time to save gas for subsequent operations
            IERC20(_token).forceApprove(_spender, type(uint256).max);
        }
    }

    /**
     * @dev Simulates the execution of a command and returns the expected resulting rate
     * @param _commandType The encoded representation of the command
     * @param _inputs The encoded arguments for the specified command
     * @param _spot If set to true, spot exchange rate is used for swaps. Additionally for all commands,
     *              input amounts are disregarded, and one unit of the token of interest is used instead.
     *              If set to false, the function includes price impact and curve pool fees for swaps.
     * @param _balances Array of balances to track balances changes during this preview
     * @return The preview rate value, which represents the amount of output token obtained for each wei
     * of input token, multiplied by 1 ray unit.
     */
    function _dispatchPreviewRate(
        bytes1 _commandType,
        bytes calldata _inputs,
        bool _spot,
        TokenBalance[] memory _balances
    ) internal view returns (uint256) {
        uint256 command = uint8(_commandType & Commands.COMMAND_TYPE_MASK);
        if (command == Commands.TRANSFER_FROM || command == Commands.TRANSFER_FROM_WITH_PERMIT) {
            if (!_spot) {
                (address token, uint256 value) = abi.decode(_inputs, (address, uint256));
                _increasePreviewTokenValue(value, token, _balances);
            }
            return RayMath.RAY_UNIT;
        } else if (command == Commands.TRANSFER) {
            if (!_spot) {
                (address token, address recipient, uint256 value) = abi.decode(
                    _inputs,
                    (address, address, uint256)
                );
                recipient = _resolveAddress(recipient);
                if (recipient != address(this)) {
                    _decreasePreviewTokenValue(value, token, _balances);
                }
            }
            return RayMath.RAY_UNIT;
        } else if (
            command == Commands.CURVE_SWAP ||
            command == Commands.CURVE_NG_SWAP ||
            command == Commands.CURVE_SWAP_SNG
        ) {
            (address pool, uint256 i, uint256 j, uint256 amountIn, , address recipient) = abi
                .decode(_inputs, (address, uint256, uint256, uint256, uint256, address));
            uint256 exchangeRate;
            if (_spot) {
                // rate : spotExchangeRate * (ibtUnit / curveUnit) * rayUnit / ibtUnit
                uint256 rate = (command == Commands.CURVE_SWAP || command == Commands.CURVE_NG_SWAP)
                    ? RouterUtil(routerUtil).spotExchangeRate(pool, i, j)
                    : RouterUtil(routerUtil).spotExchangeRateSNG(
                        pool,
                        int128(int256(i)),
                        int128(int256(j))
                    );
                exchangeRate = rate.toRay(CurvePoolUtil.CURVE_DECIMALS);
            } else {
                amountIn = _decreasePreviewTokenValue(
                    amountIn,
                    ICurvePool(pool).coins(i),
                    _balances
                );
                uint256 dy;
                if (command == Commands.CURVE_SWAP_SNG) {
                    dy = IStableSwapNG(pool).get_dy(int128(int256(i)), int128(int256(j)), amountIn);
                } else {
                    dy = ICurvePool(pool).get_dy(i, j, amountIn);
                }
                recipient = _resolveAddress(recipient);
                if (recipient == address(this)) {
                    _increasePreviewTokenValue(dy, ICurvePool(pool).coins(j), _balances);
                }
                // rate : dy * rayUnit / amountIn
                exchangeRate = dy.mulDiv(RayMath.RAY_UNIT, amountIn);
            }
            return exchangeRate;
        } else if (command == Commands.WRAP_VAULT_IN_4626_ADAPTER) {
            (address wrapper, uint256 vaultShares, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            address vault = ISpectra4626Wrapper(wrapper).vaultShare();
            if (_spot) {
                vaultShares = RouterUtil(routerUtil).getUnit(vault);
            } else {
                vaultShares = _decreasePreviewTokenValue(vaultShares, vault, _balances);
            }
            uint256 _expectedWrapperShares = ISpectra4626Wrapper(wrapper).previewWrap(vaultShares);
            recipient = _resolveAddress(recipient);
            if (recipient == address(this)) {
                _increasePreviewTokenValue(_expectedWrapperShares, wrapper, _balances);
            }
            // rate : expectedWrapperShares * rayUnit / vaultShares
            return _expectedWrapperShares.mulDiv(RayMath.RAY_UNIT, vaultShares);
        } else if (command == Commands.UNWRAP_VAULT_FROM_4626_ADAPTER) {
            (address wrapper, uint256 wrapperShares, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            if (_spot) {
                wrapperShares = RouterUtil(routerUtil).getUnit(wrapper);
            } else {
                wrapperShares = _decreasePreviewTokenValue(wrapperShares, wrapper, _balances);
            }
            uint256 _expectedVaultShares = ISpectra4626Wrapper(wrapper).previewUnwrap(
                wrapperShares
            );
            recipient = _resolveAddress(recipient);
            if (recipient == address(this)) {
                _increasePreviewTokenValue(
                    _expectedVaultShares,
                    ISpectra4626Wrapper(wrapper).vaultShare(),
                    _balances
                );
            }
            // rate : expectedVaultShares * rayUnit / wrapperShares
            return _expectedVaultShares.mulDiv(RayMath.RAY_UNIT, wrapperShares);
        } else if (command == Commands.DEPOSIT_ASSET_IN_IBT) {
            (address ibt, uint256 assets, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            address asset = IERC4626(ibt).asset();
            if (_spot) {
                assets = RouterUtil(routerUtil).getUnit(asset);
            } else {
                assets = _decreasePreviewTokenValue(assets, asset, _balances);
            }
            uint256 _expectedShares = IERC4626(ibt).previewDeposit(assets);
            recipient = _resolveAddress(recipient);
            if (recipient == address(this)) {
                _increasePreviewTokenValue(_expectedShares, ibt, _balances);
            }
            // rate : shares * rayUnit / assets
            return _expectedShares.mulDiv(RayMath.RAY_UNIT, assets);
        } else if (command == Commands.DEPOSIT_ASSET_IN_PT) {
            (address pt, uint256 assets, address ptRecipient, address ytRecipient) = abi.decode(
                _inputs,
                (address, uint256, address, address)
            );
            if (_spot) {
                assets = RouterUtil(routerUtil).getPTUnderlyingUnit(pt);
            } else {
                assets = _decreasePreviewTokenValue(
                    assets,
                    IPrincipalToken(pt).underlying(),
                    _balances
                );
            }
            uint256 _expectedShares = IPrincipalToken(pt).previewDeposit(assets);
            ptRecipient = _resolveAddress(ptRecipient);
            if (ptRecipient == address(this)) {
                _increasePreviewTokenValue(_expectedShares, pt, _balances);
            }
            ytRecipient = _resolveAddress(ytRecipient);
            if (ytRecipient == address(this)) {
                _increasePreviewTokenValue(_expectedShares, IPrincipalToken(pt).getYT(), _balances);
            }
            // rate : shares * rayUnit / assets
            return _expectedShares.mulDiv(RayMath.RAY_UNIT, assets);
        } else if (command == Commands.DEPOSIT_IBT_IN_PT) {
            (address pt, uint256 ibts, address ptRecipient, address ytRecipient) = abi.decode(
                _inputs,
                (address, uint256, address, address)
            );
            if (_spot) {
                ibts = RouterUtil(routerUtil).getUnit(pt);
            } else {
                ibts = _decreasePreviewTokenValue(ibts, IPrincipalToken(pt).getIBT(), _balances);
            }
            uint256 _expectedShares = IPrincipalToken(pt).previewDepositIBT(ibts);
            ptRecipient = _resolveAddress(ptRecipient);
            if (ptRecipient == address(this)) {
                _increasePreviewTokenValue(_expectedShares, pt, _balances);
            }
            ytRecipient = _resolveAddress(ytRecipient);
            if (ytRecipient == address(this)) {
                _increasePreviewTokenValue(_expectedShares, IPrincipalToken(pt).getYT(), _balances);
            }
            // rate : shares * rayUnit / ibts
            return _expectedShares.mulDiv(RayMath.RAY_UNIT, ibts);
        } else if (command == Commands.REDEEM_IBT_FOR_ASSET) {
            (address ibt, uint256 shares, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            if (_spot) {
                shares = RouterUtil(routerUtil).getUnit(ibt);
            } else {
                shares = _decreasePreviewTokenValue(shares, ibt, _balances);
            }
            uint256 _expectedAssets = IERC4626(ibt).previewRedeem(shares);
            recipient = _resolveAddress(recipient);
            if (recipient == address(this)) {
                _increasePreviewTokenValue(_expectedAssets, IERC4626(ibt).asset(), _balances);
            }
            // rate : assets * rayUnit / shares
            return _expectedAssets.mulDiv(RayMath.RAY_UNIT, shares);
        } else if (command == Commands.REDEEM_PT_FOR_ASSET) {
            (address pt, uint256 shares, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            if (_spot) {
                shares = RouterUtil(routerUtil).getUnit(pt);
            } else {
                shares = _decreasePreviewTokenValue(shares, pt, _balances);
                if (block.timestamp < IPrincipalToken(pt).maturity()) {
                    _decreasePreviewTokenValue(shares, IPrincipalToken(pt).getYT(), _balances);
                }
            }
            uint256 _expectedAssets = IPrincipalToken(pt).previewRedeem(shares);
            recipient = _resolveAddress(recipient);
            if (recipient == address(this)) {
                _increasePreviewTokenValue(
                    _expectedAssets,
                    IPrincipalToken(pt).underlying(),
                    _balances
                );
            }
            // rate : assets * rayUnit / shares
            return _expectedAssets.mulDiv(RayMath.RAY_UNIT, shares);
        } else if (command == Commands.REDEEM_PT_FOR_IBT) {
            (address pt, uint256 shares, address recipient) = abi.decode(
                _inputs,
                (address, uint256, address)
            );
            if (_spot) {
                shares = RouterUtil(routerUtil).getUnit(pt);
            } else {
                shares = _decreasePreviewTokenValue(shares, pt, _balances);
                if (block.timestamp < IPrincipalToken(pt).maturity()) {
                    _decreasePreviewTokenValue(shares, IPrincipalToken(pt).getYT(), _balances);
                }
            }
            uint256 _expectedIBTs = IPrincipalToken(pt).previewRedeemForIBT(shares);
            recipient = _resolveAddress(recipient);
            if (recipient == address(this)) {
                _increasePreviewTokenValue(_expectedIBTs, IPrincipalToken(pt).getIBT(), _balances);
            }
            // rate : ibts * rayUnit / shares
            return _expectedIBTs.mulDiv(RayMath.RAY_UNIT, shares);
        } else if (command == Commands.KYBER_SWAP) {
            if (kyberRouter == address(0)) {
                revert KyberRouterNotSet();
            }
            (address tokenIn, uint256 amountIn, address tokenOut, uint256 expectedAmountOut) = abi
                .decode(_inputs, (address, uint256, address, uint256));
            if (tokenOut == Constants.ETH) {
                revert AddressError();
            }
            if (tokenIn != Constants.ETH) {
                amountIn = _decreasePreviewTokenValue(amountIn, tokenIn, _balances);
            }
            _increasePreviewTokenValue(expectedAmountOut, tokenOut, _balances);

            // rate : expectedAmountOut * rayUnit / amountIn
            return expectedAmountOut.mulDiv(RayMath.RAY_UNIT, amountIn);
        } else if (command == Commands.ASSERT_MIN_BALANCE) {
            return (RayMath.RAY_UNIT);
        } else {
            revert InvalidCommandType(command);
        }
    }

    /**
     * @dev Decrease balance for given token by given value in provided balances array
     * @param _value The value to subtract from token balance
     * @param _token The token address
     * @param _balances The TokenBalance array
     * @return The actual value to subtract from token balance
     */
    function _decreasePreviewTokenValue(
        uint256 _value,
        address _token,
        TokenBalance[] memory _balances
    ) internal pure returns (uint256) {
        if (_token == address(0)) {
            revert AddressError();
        }
        uint256 _length = _balances.length;
        for (uint256 i = 0; i < _length; ++i) {
            if (_balances[i].token == address(0)) {
                break;
            } else if (_balances[i].token == _token) {
                if (_value == Constants.CONTRACT_BALANCE) {
                    uint256 _res = _balances[i].balance;
                    _balances[i].balance = 0;
                    return _res;
                } else {
                    if (_balances[i].balance < _value) {
                        break;
                    }
                    _balances[i].balance -= _value;
                    return _value;
                }
            }
        }
        revert BalanceUnderflow();
    }

    /**
     * @dev Increase balance for given token by given value in provided balances array
     * @param _value The value to subtract from token balance
     * @param _token The token address
     * @param _balances The TokenBalance array
     * @return The token balance AFTER increase
     */
    function _increasePreviewTokenValue(
        uint256 _value,
        address _token,
        TokenBalance[] memory _balances
    ) internal pure returns (uint256) {
        if (_token == address(0)) {
            revert AddressError();
        }
        uint256 _length = _balances.length;
        for (uint256 i = 0; i < _length; ++i) {
            if (_balances[i].token == address(0)) {
                _balances[i] = TokenBalance(_token, _value);
                return _value;
            } else if (_balances[i].token == _token) {
                _balances[i].balance += _value;
                return _balances[i].balance;
            }
        }
        revert MaxInvolvedTokensExceeded();
    }
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (access/manager/IAccessManaged.sol)

pragma solidity ^0.8.20;

interface IAccessManaged {
    /**
     * @dev Authority that manages this contract was updated.
     */
    event AuthorityUpdated(address authority);

    error AccessManagedUnauthorized(address caller);
    error AccessManagedRequiredDelay(address caller, uint32 delay);
    error AccessManagedInvalidAuthority(address authority);

    /**
     * @dev Returns the current authority.
     */
    function authority() external view returns (address);

    /**
     * @dev Transfers control to a new authority. The caller must be the current authority.
     */
    function setAuthority(address) external;

    /**
     * @dev Returns true only in the context of a delayed restricted call, at the moment that the scheduled operation is
     * being consumed. Prevents denial of service for delayed restricted calls in the case that the contract performs
     * attacker controlled calls.
     */
    function isConsumingScheduledOp() external view returns (bytes4);
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (token/ERC20/IERC20.sol)

pragma solidity ^0.8.20;

/**
 * @dev Interface of the ERC20 standard as defined in the EIP.
 */
interface IERC20 {
    /**
     * @dev Emitted when `value` tokens are moved from one account (`from`) to
     * another (`to`).
     *
     * Note that `value` may be zero.
     */
    event Transfer(address indexed from, address indexed to, uint256 value);

    /**
     * @dev Emitted when the allowance of a `spender` for an `owner` is set by
     * a call to {approve}. `value` is the new allowance.
     */
    event Approval(address indexed owner, address indexed spender, uint256 value);

    /**
     * @dev Returns the value of tokens in existence.
     */
    function totalSupply() external view returns (uint256);

    /**
     * @dev Returns the value of tokens owned by `account`.
     */
    function balanceOf(address account) external view returns (uint256);

    /**
     * @dev Moves a `value` amount of tokens from the caller's account to `to`.
     *
     * Returns a boolean value indicating whether the operation succeeded.
     *
     * Emits a {Transfer} event.
     */
    function transfer(address to, uint256 value) external returns (bool);

    /**
     * @dev Returns the remaining number of tokens that `spender` will be
     * allowed to spend on behalf of `owner` through {transferFrom}. This is
     * zero by default.
     *
     * This value changes when {approve} or {transferFrom} are called.
     */
    function allowance(address owner, address spender) external view returns (uint256);

    /**
     * @dev Sets a `value` amount of tokens as the allowance of `spender` over the
     * caller's tokens.
     *
     * Returns a boolean value indicating whether the operation succeeded.
     *
     * IMPORTANT: Beware that changing an allowance with this method brings the risk
     * that someone may use both the old and the new allowance by unfortunate
     * transaction ordering. One possible solution to mitigate this race
     * condition is to first reduce the spender's allowance to 0 and set the
     * desired value afterwards:
     * https://github.com/ethereum/EIPs/issues/20#issuecomment-263524729
     *
     * Emits an {Approval} event.
     */
    function approve(address spender, uint256 value) external returns (bool);

    /**
     * @dev Moves a `value` amount of tokens from `from` to `to` using the
     * allowance mechanism. `value` is then deducted from the caller's
     * allowance.
     *
     * Returns a boolean value indicating whether the operation succeeded.
     *
     * Emits a {Transfer} event.
     */
    function transferFrom(address from, address to, uint256 value) external returns (bool);
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (access/manager/IAccessManager.sol)

pragma solidity ^0.8.20;

import {IAccessManaged} from "./IAccessManaged.sol";
import {Time} from "../../utils/types/Time.sol";

interface IAccessManager {
    /**
     * @dev A delayed operation was scheduled.
     */
    event OperationScheduled(
        bytes32 indexed operationId,
        uint32 indexed nonce,
        uint48 schedule,
        address caller,
        address target,
        bytes data
    );

    /**
     * @dev A scheduled operation was executed.
     */
    event OperationExecuted(bytes32 indexed operationId, uint32 indexed nonce);

    /**
     * @dev A scheduled operation was canceled.
     */
    event OperationCanceled(bytes32 indexed operationId, uint32 indexed nonce);

    /**
     * @dev Informational labelling for a roleId.
     */
    event RoleLabel(uint64 indexed roleId, string label);

    /**
     * @dev Emitted when `account` is granted `roleId`.
     *
     * NOTE: The meaning of the `since` argument depends on the `newMember` argument.
     * If the role is granted to a new member, the `since` argument indicates when the account becomes a member of the role,
     * otherwise it indicates the execution delay for this account and roleId is updated.
     */
    event RoleGranted(uint64 indexed roleId, address indexed account, uint32 delay, uint48 since, bool newMember);

    /**
     * @dev Emitted when `account` membership or `roleId` is revoked. Unlike granting, revoking is instantaneous.
     */
    event RoleRevoked(uint64 indexed roleId, address indexed account);

    /**
     * @dev Role acting as admin over a given `roleId` is updated.
     */
    event RoleAdminChanged(uint64 indexed roleId, uint64 indexed admin);

    /**
     * @dev Role acting as guardian over a given `roleId` is updated.
     */
    event RoleGuardianChanged(uint64 indexed roleId, uint64 indexed guardian);

    /**
     * @dev Grant delay for a given `roleId` will be updated to `delay` when `since` is reached.
     */
    event RoleGrantDelayChanged(uint64 indexed roleId, uint32 delay, uint48 since);

    /**
     * @dev Target mode is updated (true = closed, false = open).
     */
    event TargetClosed(address indexed target, bool closed);

    /**
     * @dev Role required to invoke `selector` on `target` is updated to `roleId`.
     */
    event TargetFunctionRoleUpdated(address indexed target, bytes4 selector, uint64 indexed roleId);

    /**
     * @dev Admin delay for a given `target` will be updated to `delay` when `since` is reached.
     */
    event TargetAdminDelayUpdated(address indexed target, uint32 delay, uint48 since);

    error AccessManagerAlreadyScheduled(bytes32 operationId);
    error AccessManagerNotScheduled(bytes32 operationId);
    error AccessManagerNotReady(bytes32 operationId);
    error AccessManagerExpired(bytes32 operationId);
    error AccessManagerLockedAccount(address account);
    error AccessManagerLockedRole(uint64 roleId);
    error AccessManagerBadConfirmation();
    error AccessManagerUnauthorizedAccount(address msgsender, uint64 roleId);
    error AccessManagerUnauthorizedCall(address caller, address target, bytes4 selector);
    error AccessManagerUnauthorizedConsume(address target);
    error AccessManagerUnauthorizedCancel(address msgsender, address caller, address target, bytes4 selector);
    error AccessManagerInvalidInitialAdmin(address initialAdmin);

    /**
     * @dev Check if an address (`caller`) is authorised to call a given function on a given contract directly (with
     * no restriction). Additionally, it returns the delay needed to perform the call indirectly through the {schedule}
     * & {execute} workflow.
     *
     * This function is usually called by the targeted contract to control immediate execution of restricted functions.
     * Therefore we only return true if the call can be performed without any delay. If the call is subject to a
     * previously set delay (not zero), then the function should return false and the caller should schedule the operation
     * for future execution.
     *
     * If `immediate` is true, the delay can be disregarded and the operation can be immediately executed, otherwise
     * the operation can be executed if and only if delay is greater than 0.
     *
     * NOTE: The IAuthority interface does not include the `uint32` delay. This is an extension of that interface that
     * is backward compatible. Some contracts may thus ignore the second return argument. In that case they will fail
     * to identify the indirect workflow, and will consider calls that require a delay to be forbidden.
     *
     * NOTE: This function does not report the permissions of this manager itself. These are defined by the
     * {_canCallSelf} function instead.
     */
    function canCall(
        address caller,
        address target,
        bytes4 selector
    ) external view returns (bool allowed, uint32 delay);

    /**
     * @dev Expiration delay for scheduled proposals. Defaults to 1 week.
     *
     * IMPORTANT: Avoid overriding the expiration with 0. Otherwise every contract proposal will be expired immediately,
     * disabling any scheduling usage.
     */
    function expiration() external view returns (uint32);

    /**
     * @dev Minimum setback for all delay updates, with the exception of execution delays. It
     * can be increased without setback (and reset via {revokeRole} in the case event of an
     * accidental increase). Defaults to 5 days.
     */
    function minSetback() external view returns (uint32);

    /**
     * @dev Get whether the contract is closed disabling any access. Otherwise role permissions are applied.
     */
    function isTargetClosed(address target) external view returns (bool);

    /**
     * @dev Get the role required to call a function.
     */
    function getTargetFunctionRole(address target, bytes4 selector) external view returns (uint64);

    /**
     * @dev Get the admin delay for a target contract. Changes to contract configuration are subject to this delay.
     */
    function getTargetAdminDelay(address target) external view returns (uint32);

    /**
     * @dev Get the id of the role that acts as an admin for the given role.
     *
     * The admin permission is required to grant the role, revoke the role and update the execution delay to execute
     * an operation that is restricted to this role.
     */
    function getRoleAdmin(uint64 roleId) external view returns (uint64);

    /**
     * @dev Get the role that acts as a guardian for a given role.
     *
     * The guardian permission allows canceling operations that have been scheduled under the role.
     */
    function getRoleGuardian(uint64 roleId) external view returns (uint64);

    /**
     * @dev Get the role current grant delay.
     *
     * Its value may change at any point without an event emitted following a call to {setGrantDelay}.
     * Changes to this value, including effect timepoint are notified in advance by the {RoleGrantDelayChanged} event.
     */
    function getRoleGrantDelay(uint64 roleId) external view returns (uint32);

    /**
     * @dev Get the access details for a given account for a given role. These details include the timepoint at which
     * membership becomes active, and the delay applied to all operation by this user that requires this permission
     * level.
     *
     * Returns:
     * [0] Timestamp at which the account membership becomes valid. 0 means role is not granted.
     * [1] Current execution delay for the account.
     * [2] Pending execution delay for the account.
     * [3] Timestamp at which the pending execution delay will become active. 0 means no delay update is scheduled.
     */
    function getAccess(uint64 roleId, address account) external view returns (uint48, uint32, uint32, uint48);

    /**
     * @dev Check if a given account currently has the permission level corresponding to a given role. Note that this
     * permission might be associated with an execution delay. {getAccess} can provide more details.
     */
    function hasRole(uint64 roleId, address account) external view returns (bool, uint32);

    /**
     * @dev Give a label to a role, for improved role discoverability by UIs.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     *
     * Emits a {RoleLabel} event.
     */
    function labelRole(uint64 roleId, string calldata label) external;

    /**
     * @dev Add `account` to `roleId`, or change its execution delay.
     *
     * This gives the account the authorization to call any function that is restricted to this role. An optional
     * execution delay (in seconds) can be set. If that delay is non 0, the user is required to schedule any operation
     * that is restricted to members of this role. The user will only be able to execute the operation after the delay has
     * passed, before it has expired. During this period, admin and guardians can cancel the operation (see {cancel}).
     *
     * If the account has already been granted this role, the execution delay will be updated. This update is not
     * immediate and follows the delay rules. For example, if a user currently has a delay of 3 hours, and this is
     * called to reduce that delay to 1 hour, the new delay will take some time to take effect, enforcing that any
     * operation executed in the 3 hours that follows this update was indeed scheduled before this update.
     *
     * Requirements:
     *
     * - the caller must be an admin for the role (see {getRoleAdmin})
     * - granted role must not be the `PUBLIC_ROLE`
     *
     * Emits a {RoleGranted} event.
     */
    function grantRole(uint64 roleId, address account, uint32 executionDelay) external;

    /**
     * @dev Remove an account from a role, with immediate effect. If the account does not have the role, this call has
     * no effect.
     *
     * Requirements:
     *
     * - the caller must be an admin for the role (see {getRoleAdmin})
     * - revoked role must not be the `PUBLIC_ROLE`
     *
     * Emits a {RoleRevoked} event if the account had the role.
     */
    function revokeRole(uint64 roleId, address account) external;

    /**
     * @dev Renounce role permissions for the calling account with immediate effect. If the sender is not in
     * the role this call has no effect.
     *
     * Requirements:
     *
     * - the caller must be `callerConfirmation`.
     *
     * Emits a {RoleRevoked} event if the account had the role.
     */
    function renounceRole(uint64 roleId, address callerConfirmation) external;

    /**
     * @dev Change admin role for a given role.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     *
     * Emits a {RoleAdminChanged} event
     */
    function setRoleAdmin(uint64 roleId, uint64 admin) external;

    /**
     * @dev Change guardian role for a given role.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     *
     * Emits a {RoleGuardianChanged} event
     */
    function setRoleGuardian(uint64 roleId, uint64 guardian) external;

    /**
     * @dev Update the delay for granting a `roleId`.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     *
     * Emits a {RoleGrantDelayChanged} event.
     */
    function setGrantDelay(uint64 roleId, uint32 newDelay) external;

    /**
     * @dev Set the role required to call functions identified by the `selectors` in the `target` contract.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     *
     * Emits a {TargetFunctionRoleUpdated} event per selector.
     */
    function setTargetFunctionRole(address target, bytes4[] calldata selectors, uint64 roleId) external;

    /**
     * @dev Set the delay for changing the configuration of a given target contract.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     *
     * Emits a {TargetAdminDelayUpdated} event.
     */
    function setTargetAdminDelay(address target, uint32 newDelay) external;

    /**
     * @dev Set the closed flag for a contract.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     *
     * Emits a {TargetClosed} event.
     */
    function setTargetClosed(address target, bool closed) external;

    /**
     * @dev Return the timepoint at which a scheduled operation will be ready for execution. This returns 0 if the
     * operation is not yet scheduled, has expired, was executed, or was canceled.
     */
    function getSchedule(bytes32 id) external view returns (uint48);

    /**
     * @dev Return the nonce for the latest scheduled operation with a given id. Returns 0 if the operation has never
     * been scheduled.
     */
    function getNonce(bytes32 id) external view returns (uint32);

    /**
     * @dev Schedule a delayed operation for future execution, and return the operation identifier. It is possible to
     * choose the timestamp at which the operation becomes executable as long as it satisfies the execution delays
     * required for the caller. The special value zero will automatically set the earliest possible time.
     *
     * Returns the `operationId` that was scheduled. Since this value is a hash of the parameters, it can reoccur when
     * the same parameters are used; if this is relevant, the returned `nonce` can be used to uniquely identify this
     * scheduled operation from other occurrences of the same `operationId` in invocations of {execute} and {cancel}.
     *
     * Emits a {OperationScheduled} event.
     *
     * NOTE: It is not possible to concurrently schedule more than one operation with the same `target` and `data`. If
     * this is necessary, a random byte can be appended to `data` to act as a salt that will be ignored by the target
     * contract if it is using standard Solidity ABI encoding.
     */
    function schedule(address target, bytes calldata data, uint48 when) external returns (bytes32, uint32);

    /**
     * @dev Execute a function that is delay restricted, provided it was properly scheduled beforehand, or the
     * execution delay is 0.
     *
     * Returns the nonce that identifies the previously scheduled operation that is executed, or 0 if the
     * operation wasn't previously scheduled (if the caller doesn't have an execution delay).
     *
     * Emits an {OperationExecuted} event only if the call was scheduled and delayed.
     */
    function execute(address target, bytes calldata data) external payable returns (uint32);

    /**
     * @dev Cancel a scheduled (delayed) operation. Returns the nonce that identifies the previously scheduled
     * operation that is cancelled.
     *
     * Requirements:
     *
     * - the caller must be the proposer, a guardian of the targeted function, or a global admin
     *
     * Emits a {OperationCanceled} event.
     */
    function cancel(address caller, address target, bytes calldata data) external returns (uint32);

    /**
     * @dev Consume a scheduled operation targeting the caller. If such an operation exists, mark it as consumed
     * (emit an {OperationExecuted} event and clean the state). Otherwise, throw an error.
     *
     * This is useful for contract that want to enforce that calls targeting them were scheduled on the manager,
     * with all the verifications that it implies.
     *
     * Emit a {OperationExecuted} event.
     */
    function consumeScheduledOp(address caller, bytes calldata data) external;

    /**
     * @dev Hashing function for delayed operations.
     */
    function hashOperation(address caller, address target, bytes calldata data) external view returns (bytes32);

    /**
     * @dev Changes the authority of a target managed by this manager instance.
     *
     * Requirements:
     *
     * - the caller must be a global admin
     */
    function updateAuthority(address target, address newAuthority) external;
}

// SPDX-License-Identifier: BUSL-1.1
pragma solidity ^0.8.20;

import {IERC4626} from "@openzeppelin/contracts/interfaces/IERC4626.sol";

/// @dev Interface of Spectra4626Wrapper.
interface ISpectra4626Wrapper is IERC4626 {
    /// @dev Emitted when vault shares are deposited in the wrapper.
    event Wrap(
        address indexed caller,
        address indexed receiver,
        uint256 vaultShares,
        uint256 shares
    );

    /// @dev Emitted when vault shares are withdrawn from the wrapper.
    event Unwrap(
        address indexed caller,
        address indexed receiver,
        address indexed owner,
        uint256 shares,
        uint256 vaultShares
    );

    /// @dev Emitted when rewards proxy is updated.
    event RewardsProxyUpdated(address oldRewardsProxy, address newRewardsProxy);

    error ERC5143SlippageProtectionFailed();
    error NoRewardsProxy();
    error ClaimRewardsFailed();

    /// @dev Returns the address of the wrapped vault share.
    function vaultShare() external view returns (address);

    /// @dev Returns the vault share balance of the wrapper.
    function totalVaultShares() external view returns (uint256);

    /// @dev Returns the rewards proxy of the wrapper.
    function rewardsProxy() external view returns (address);

    /// @dev Allows to preview the amount of minted wrapper shares for a given amount of deposited vault shares.
    /// @param vaultShares The amount of vault shares to deposit.
    /// @return The amount of minted vault shares.
    function previewWrap(uint256 vaultShares) external view returns (uint256);

    /// @dev Allows to preview the amount of withdrawn vault shares for a given amount of redeemed wrapper shares.
    /// @param shares The amount of wrapper shares to redeem.
    /// @return The amount of withdrawn vault shares.
    function previewUnwrap(uint256 shares) external view returns (uint256);

    /// @dev Allows the owner to deposit vault shares into the wrapper.
    /// @param vaultShares The amount of vault shares to deposit.
    /// @param receiver The address to receive the wrapper shares.
    /// @return The amount of minted wrapper shares.
    function wrap(uint256 vaultShares, address receiver) external returns (uint256);

    /// @dev Allows the owner to deposit vault shares into the wrapper, with support for slippage protection.
    /// @param vaultShares The amount of vault shares to deposit.
    /// @param receiver The address to receive the wrapper shares.
    /// @param minShares The minimum allowed wrapper shares from this deposit.
    /// @return The amount of minted wrapper shares.
    function wrap(
        uint256 vaultShares,
        address receiver,
        uint256 minShares
    ) external returns (uint256);

    /// @dev Allows the owner to withdraw vault shares from the wrapper.
    /// @param shares The amount of wrapper shares to redeem.
    /// @param receiver The address to receive the vault shares.
    /// @param owner The address of the owner of the wrapper shares.
    /// @return The amount of withdrawn vault shares.
    function unwrap(uint256 shares, address receiver, address owner) external returns (uint256);

    /// @dev Allows the owner to withdraw vault shares from the wrapper, with support for slippage protection.
    /// @param shares The amount of wrapper shares to redeem.
    /// @param receiver The address to receive the vault shares.
    /// @param owner The address of the owner of the wrapper shares.
    /// @param minVaultShares The minimum vault shares that should be returned.
    /// @return The amount of withdrawn vault shares.
    function unwrap(
        uint256 shares,
        address receiver,
        address owner,
        uint256 minVaultShares
    ) external returns (uint256);

    /// @dev Setter for the rewards proxy.
    /// @param newRewardsProxy The address of the new rewards proxy.
    function setRewardsProxy(address newRewardsProxy) external;

    /// @dev Claims rewards for the wrapped vault.
    /// @param data The optional data used for claiming rewards.
    function claimRewards(bytes calldata data) external;
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (token/ERC20/extensions/IERC20Metadata.sol)

pragma solidity ^0.8.20;

import {IERC20} from "../IERC20.sol";

/**
 * @dev Interface for the optional metadata functions from the ERC20 standard.
 */
interface IERC20Metadata is IERC20 {
    /**
     * @dev Returns the name of the token.
     */
    function name() external view returns (string memory);

    /**
     * @dev Returns the symbol of the token.
     */
    function symbol() external view returns (string memory);

    /**
     * @dev Returns the decimals places of the token.
     */
    function decimals() external view returns (uint8);
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (access/manager/IAuthority.sol)

pragma solidity ^0.8.20;

/**
 * @dev Standard interface for permissioning originally defined in Dappsys.
 */
interface IAuthority {
    /**
     * @dev Returns true if the caller can invoke on a target the function identified by a function selector.
     */
    function canCall(address caller, address target, bytes4 selector) external view returns (bool allowed);
}

File 18 of 36 : IPrincipalToken.sol
// SPDX-License-Identifier: BUSL-1.1

pragma solidity ^0.8.20;

import "openzeppelin-contracts/interfaces/IERC20.sol";
import "openzeppelin-contracts/interfaces/IERC20Metadata.sol";
import "openzeppelin-contracts/interfaces/IERC3156FlashLender.sol";

interface IPrincipalToken is IERC20, IERC20Metadata, IERC3156FlashLender {
    /* ERRORS
     *****************************************************************************************************************/

    error InvalidDecimals();
    error BeaconNotSet();
    error PTExpired();
    error PTNotExpired();
    error RateError();
    error AddressError();
    error UnauthorizedCaller();
    error RatesAtExpiryAlreadyStored();
    error ERC5143SlippageProtectionFailed();
    error InsufficientBalance();
    error FlashLoanExceedsMaxAmount();
    error FlashLoanCallbackFailed();
    error NoRewardsProxy();
    error ClaimRewardsFailed();

    /* Functions
     *****************************************************************************************************************/

    function initialize(address _ibt, uint256 _duration, address initialAuthority) external;

    /**
     * @notice Toggle Pause
     * @dev Should only be called in extraordinary situations by the admin of the contract
     */
    function pause() external;

    /**
     * @notice Toggle UnPause
     * @dev Should only be called in extraordinary situations by the admin of the contract
     */
    function unPause() external;

    /**
     * @notice Deposits amount of assets in the PT vault
     * @param assets The amount of assets being deposited
     * @param receiver The receiver address of the shares
     * @return shares The amount of shares minted (same amount for PT & yt)
     */
    function deposit(uint256 assets, address receiver) external returns (uint256 shares);

    /**
     * @notice Deposits amount of assets in the PT vault
     * @param assets The amount of assets being deposited
     * @param ptReceiver The receiver address of the PTs
     * @param ytReceiver the receiver address of the YTs
     * @return shares The amount of shares minted (same amount for PT & yt)
     */
    function deposit(
        uint256 assets,
        address ptReceiver,
        address ytReceiver
    ) external returns (uint256 shares);

    /**
     * @notice Deposits amount of assets with a lower bound on shares received
     * @param assets The amount of assets being deposited
     * @param ptReceiver The receiver address of the PTs
     * @param ytReceiver The receiver address of the YTs
     * @param minShares The minimum allowed shares from this deposit
     * @return shares The amount of shares actually minted to the receiver
     */
    function deposit(
        uint256 assets,
        address ptReceiver,
        address ytReceiver,
        uint256 minShares
    ) external returns (uint256 shares);

    /**
     * @notice Same as normal deposit but with IBTs
     * @param ibts The amount of IBT being deposited
     * @param receiver The receiver address of the shares
     * @return shares The amount of shares minted to the receiver
     */
    function depositIBT(uint256 ibts, address receiver) external returns (uint256 shares);

    /**
     * @notice Same as normal deposit but with IBTs
     * @param ibts The amount of IBT being deposited
     * @param ptReceiver The receiver address of the PTs
     * @param ytReceiver the receiver address of the YTs
     * @return shares The amount of shares minted to the receiver
     */
    function depositIBT(
        uint256 ibts,
        address ptReceiver,
        address ytReceiver
    ) external returns (uint256 shares);

    /**
     * @notice Same as normal deposit but with IBTs
     * @param ibts The amount of IBT being deposited
     * @param ptReceiver The receiver address of the PTs
     * @param ytReceiver The receiver address of the YTs
     * @param minShares The minimum allowed shares from this deposit
     * @return shares The amount of shares minted to the receiver
     */
    function depositIBT(
        uint256 ibts,
        address ptReceiver,
        address ytReceiver,
        uint256 minShares
    ) external returns (uint256 shares);

    /**
     * @notice Burns owner's shares (PTs and YTs before expiry, PTs after expiry)
     * and sends assets to receiver
     * @param shares The amount of shares to burn
     * @param receiver The address that will receive the assets
     * @param owner The owner of the shares
     * @return assets The actual amount of assets received for burning the shares
     */
    function redeem(
        uint256 shares,
        address receiver,
        address owner
    ) external returns (uint256 assets);

    /**
     * @notice Burns owner's shares (PTs and YTs before expiry, PTs after expiry)
     * and sends assets to receiver
     * @param shares The amount of shares to burn
     * @param receiver The address that will receive the assets
     * @param owner The owner of the shares
     * @param minAssets The minimum assets that should be returned to user
     * @return assets The actual amount of assets received for burning the shares
     */
    function redeem(
        uint256 shares,
        address receiver,
        address owner,
        uint256 minAssets
    ) external returns (uint256 assets);

    /**
     * @notice Burns owner's shares (PTs and YTs before expiry, PTs after expiry)
     * and sends IBTs to receiver
     * @param shares The amount of shares to burn
     * @param receiver The address that will receive the IBTs
     * @param owner The owner of the shares
     * @return ibts The actual amount of IBT received for burning the shares
     */
    function redeemForIBT(
        uint256 shares,
        address receiver,
        address owner
    ) external returns (uint256 ibts);

    /**
     * @notice Burns owner's shares (PTs and YTs before expiry, PTs after expiry)
     * and sends IBTs to receiver
     * @param shares The amount of shares to burn
     * @param receiver The address that will receive the IBTs
     * @param owner The owner of the shares
     * @param minIbts The minimum IBTs that should be returned to user
     * @return ibts The actual amount of IBT received for burning the shares
     */
    function redeemForIBT(
        uint256 shares,
        address receiver,
        address owner,
        uint256 minIbts
    ) external returns (uint256 ibts);

    /**
     * @notice Burns owner's shares (before expiry : PTs and YTs) and sends assets to receiver
     * @param assets The amount of assets to be received
     * @param receiver The address that will receive the assets
     * @param owner The owner of the shares (PTs and YTs)
     * @return shares The actual amount of shares burnt for receiving the assets
     */
    function withdraw(
        uint256 assets,
        address receiver,
        address owner
    ) external returns (uint256 shares);

    /**
     * @notice Burns owner's shares (before expiry : PTs and YTs) and sends assets to receiver
     * @param assets The amount of assets to be received
     * @param receiver The address that will receive the assets
     * @param owner The owner of the shares (PTs and YTs)
     * @param maxShares The maximum shares allowed to be burnt
     * @return shares The actual amount of shares burnt for receiving the assets
     */
    function withdraw(
        uint256 assets,
        address receiver,
        address owner,
        uint256 maxShares
    ) external returns (uint256 shares);

    /**
     * @notice Burns owner's shares (before expiry : PTs and YTs) and sends IBTs to receiver
     * @param ibts The amount of IBT to be received
     * @param receiver The address that will receive the IBTs
     * @param owner The owner of the shares (PTs and YTs)
     * @return shares The actual amount of shares burnt for receiving the IBTs
     */
    function withdrawIBT(
        uint256 ibts,
        address receiver,
        address owner
    ) external returns (uint256 shares);

    /**
     * @notice Burns owner's shares (before expiry : PTs and YTs) and sends IBTs to receiver
     * @param ibts The amount of IBT to be received
     * @param receiver The address that will receive the IBTs
     * @param owner The owner of the shares (PTs and YTs)
     * @param maxShares The maximum shares allowed to be burnt
     * @return shares The actual amount of shares burnt for receiving the IBTs
     */
    function withdrawIBT(
        uint256 ibts,
        address receiver,
        address owner,
        uint256 maxShares
    ) external returns (uint256 shares);

    /**
     * @notice Updates _user's yield since last update
     * @param _user The user whose yield will be updated
     * @return updatedUserYieldInIBT The unclaimed yield of the user in IBT (not just the updated yield)
     */
    function updateYield(address _user) external returns (uint256 updatedUserYieldInIBT);

    /**
     * @notice Claims caller's unclaimed yield in asset
     * @param _receiver The receiver of yield
     * @param _minAssets The minimum amount of assets that should be received
     * @return yieldInAsset The amount of yield claimed in asset
     */
    function claimYield(
        address _receiver,
        uint256 _minAssets
    ) external returns (uint256 yieldInAsset);

    /**
     * @notice Claims caller's unclaimed yield in IBT
     * @param _receiver The receiver of yield
     * @param _minIBT The minimum amount of IBT that should be received
     * @return yieldInIBT The amount of yield claimed in IBT
     */
    function claimYieldInIBT(
        address _receiver,
        uint256 _minIBT
    ) external returns (uint256 yieldInIBT);

    /**
     * @notice Claims the collected ibt fees and redeems them to the fee collector
     * @param _minAssets The minimum amount of assets that should be received
     * @return assets The amount of assets sent to the fee collector
     */
    function claimFees(uint256 _minAssets) external returns (uint256 assets);

    /**
     * @notice Updates yield of both sender and receiver of YTs
     * @param _from the sender of YTs
     * @param _to the receiver of YTs
     */
    function beforeYtTransfer(address _from, address _to) external;

    /**
     * Call the claimRewards function of the rewards contract
     * @param data The optional data to be passed to the rewards contract
     */
    function claimRewards(bytes memory data) external;

    /* SETTERS
     *****************************************************************************************************************/

    /**
     * @notice Stores PT and IBT rates at expiry. Ideally, it should be called the day of expiry
     */
    function storeRatesAtExpiry() external;

    /** Set a new Rewards Proxy
     * @param _rewardsProxy The address of the new reward proxy
     */
    function setRewardsProxy(address _rewardsProxy) external;

    /* GETTERS
     *****************************************************************************************************************/

    /**
     * @notice Returns the amount of shares minted for the theorical deposited amount of assets
     * @param assets The amount of assets deposited
     * @return The amount of shares minted
     */
    function previewDeposit(uint256 assets) external view returns (uint256);

    /**
     * @notice Returns the amount of shares minted for the theorical deposited amount of IBT
     * @param ibts The amount of IBT deposited
     * @return The amount of shares minted
     */
    function previewDepositIBT(uint256 ibts) external view returns (uint256);

    /**
     * @notice Returns the maximum amount of the underlying asset that can be deposited into the Vault for the receiver,
     * through a deposit call.
     * @param receiver The receiver of the shares
     * @return The maximum amount of assets that can be deposited
     */
    function maxDeposit(address receiver) external view returns (uint256);

    /**
     * @notice Returns the theorical amount of shares that need to be burnt to receive assets of underlying
     * @param assets The amount of assets to receive
     * @return The amount of shares burnt
     */
    function previewWithdraw(uint256 assets) external view returns (uint256);

    /**
     * @notice Returns the theorical amount of shares that need to be burnt to receive amount of IBT
     * @param ibts The amount of IBT to receive
     * @return The amount of shares burnt
     */
    function previewWithdrawIBT(uint256 ibts) external view returns (uint256);

    /**
     * @notice Returns the maximum amount of the underlying asset that can be withdrawn from the owner balance in the
     * Vault, through a withdraw call.
     * @param owner The owner of the Vault shares
     * @return The maximum amount of assets that can be withdrawn
     */
    function maxWithdraw(address owner) external view returns (uint256);

    /**
     * @notice Returns the maximum amount of the IBT that can be withdrawn from the owner balance in the
     * Vault, through a withdraw call.
     * @param owner The owner of the Vault shares
     * @return The maximum amount of IBT that can be withdrawn
     */
    function maxWithdrawIBT(address owner) external view returns (uint256);

    /**
     * @notice Returns the amount of assets received for the theorical amount of burnt shares
     * @param shares The amount of shares to burn
     * @return The amount of assets received
     */
    function previewRedeem(uint256 shares) external view returns (uint256);

    /**
     * @notice Returns the amount of IBT received for the theorical amount of burnt shares
     * @param shares The amount of shares to burn
     * @return The amount of IBT received
     */
    function previewRedeemForIBT(uint256 shares) external view returns (uint256);

    /**
     * @notice Returns the maximum amount of Vault shares that can be redeemed by the owner
     * @notice This function behaves differently before and after expiry. Before expiry an equal amount of PT and YT
     * needs to be burnt, while after expiry only PTs are burnt.
     * @param owner The owner of the shares
     * @return The maximum amount of shares that can be redeemed
     */
    function maxRedeem(address owner) external view returns (uint256);

    /**
     * Returns the total amount of the underlying asset that is owned by the Vault in the form of IBT.
     */
    function totalAssets() external view returns (uint256);

    /**
     * @notice Converts an underlying amount in principal. Equivalent to ERC-4626's convertToShares method.
     * @param underlyingAmount The amount of underlying (or assets) to convert
     * @return The resulting amount of principal (or shares)
     */
    function convertToPrincipal(uint256 underlyingAmount) external view returns (uint256);

    /**
     * @notice Converts a principal amount in underlying. Equivalent to ERC-4626's convertToAssets method.
     * @param principalAmount The amount of principal (or shares) to convert
     * @return The resulting amount of underlying (or assets)
     */
    function convertToUnderlying(uint256 principalAmount) external view returns (uint256);

    /**
     * @notice Returns whether or not the contract is paused.
     * @return true if the contract is paused, and false otherwise
     */
    function paused() external view returns (bool);

    /**
     * @notice Returns the unix timestamp (uint256) at which the PT contract expires
     * @return The unix timestamp (uint256) when PTs become redeemable
     */
    function maturity() external view returns (uint256);

    /**
     * @notice Returns the duration of the PT contract
     * @return The duration (in s) to expiry/maturity of the PT contract
     */
    function getDuration() external view returns (uint256);

    /**
     * @notice Returns the address of the underlying token (or asset). Equivalent to ERC-4626's asset method.
     * @return The address of the underlying token (or asset)
     */
    function underlying() external view returns (address);

    /**
     * @notice Returns the IBT address of the PT contract
     * @return ibt The address of the IBT
     */
    function getIBT() external view returns (address ibt);

    /**
     * @notice Returns the yt address of the PT contract
     * @return yt The address of the yt
     */
    function getYT() external view returns (address yt);

    /**
     * @notice Returns the current ibtRate
     * @return The current ibtRate
     */
    function getIBTRate() external view returns (uint256);

    /**
     * @notice Returns the current ptRate
     * @return The current ptRate
     */
    function getPTRate() external view returns (uint256);

    /**
     * @notice Returns 1 unit of IBT
     * @return The IBT unit
     */
    function getIBTUnit() external view returns (uint256);

    /**
     * @notice Get the unclaimed fees in IBT
     * @return The unclaimed fees in IBT
     */
    function getUnclaimedFeesInIBT() external view returns (uint256);

    /**
     * @notice Get the total collected fees in IBT (claimed and unclaimed)
     * @return The total fees in IBT
     */
    function getTotalFeesInIBT() external view returns (uint256);

    /**
     * @notice Get the tokenization fee of the PT
     * @return The tokenization fee
     */
    function getTokenizationFee() external view returns (uint256);

    /**
     * @notice Get the current IBT yield of the user
     * @param _user The address of the user to get the current yield from
     * @return The yield of the user in IBT
     */
    function getCurrentYieldOfUserInIBT(address _user) external view returns (uint256);
}

File 19 of 36 : IERC3156FlashBorrower.sol
// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (interfaces/IERC3156FlashBorrower.sol)

pragma solidity ^0.8.20;

/**
 * @dev Interface of the ERC3156 FlashBorrower, as defined in
 * https://eips.ethereum.org/EIPS/eip-3156[ERC-3156].
 */
interface IERC3156FlashBorrower {
    /**
     * @dev Receive a flash loan.
     * @param initiator The initiator of the loan.
     * @param token The loan currency.
     * @param amount The amount of tokens lent.
     * @param fee The additional amount of tokens to repay.
     * @param data Arbitrary data structure, intended to contain user-defined parameters.
     * @return The keccak256 hash of "ERC3156FlashBorrower.onFlashLoan"
     */
    function onFlashLoan(
        address initiator,
        address token,
        uint256 amount,
        uint256 fee,
        bytes calldata data
    ) external returns (bytes32);
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (utils/Context.sol)

pragma solidity ^0.8.20;
import {Initializable} from "../proxy/utils/Initializable.sol";

/**
 * @dev Provides information about the current execution context, including the
 * sender of the transaction and its data. While these are generally available
 * via msg.sender and msg.data, they should not be accessed in such a direct
 * manner, since when dealing with meta-transactions the account sending and
 * paying for execution may not be the actual sender (as far as an application
 * is concerned).
 *
 * This contract is only required for intermediate, library-like contracts.
 */
abstract contract ContextUpgradeable is Initializable {
    function __Context_init() internal onlyInitializing {
    }

    function __Context_init_unchained() internal onlyInitializing {
    }
    function _msgSender() internal view virtual returns (address) {
        return msg.sender;
    }

    function _msgData() internal view virtual returns (bytes calldata) {
        return msg.data;
    }
}

// SPDX-License-Identifier: BUSL-1.1

pragma solidity 0.8.20;

interface INATIVE {
    function deposit() external payable;

    function withdraw(uint wad) external;
}

// SPDX-License-Identifier: BUSL-1.1

pragma solidity 0.8.20;

import "../interfaces/ICurvePool.sol";
import "../interfaces/ICurveNGPool.sol";
import "../interfaces/IStableSwapNG.sol";
import "../interfaces/IPrincipalToken.sol";
import "./RayMath.sol";
import "openzeppelin-math/Math.sol";

/**
 * @title CurvePoolUtil library
 * @author Spectra Finance
 * @notice Provides miscellaneous utils for computations related to Curve CryptoSwap pools.
 */
library CurvePoolUtil {
    using Math for uint256;
    using RayMath for uint256;

    error SolutionNotFound();
    error FailedToFetchExpectedLPTokenAmount();
    error FailedToFetchExpectedCoinAmount();

    /// @notice Decimal precision used internally in the Curve AMM
    uint256 public constant CURVE_DECIMALS = 18;
    /// @notice Base unit for Curve AMM calculations
    uint256 public constant CURVE_UNIT = 1e18;
    /// @notice Make rounding errors favoring other LPs a tiny bit
    uint256 private constant APPROXIMATION_DECREMENT = 1;
    /// @notice Maximal number of iterations in the binary search algorithm
    uint256 private constant MAX_ITERATIONS_BINSEARCH = 255;

    /**
     * @notice Returns the expected LP token amount received for depositing given amounts of IBT and PT
     * @notice Method to be used with legacy Curve Cryptoswap pools
     * @param _curvePool The address of the Curve Pool in which liquidity will be deposited
     * @param _amounts Array containing the amounts of IBT and PT to deposit in the Curve Pool
     * @return minMintAmount The amount of expected LP tokens received for depositing the liquidity in the pool
     */
    function previewAddLiquidity(
        address _curvePool,
        uint256[2] memory _amounts
    ) external view returns (uint256 minMintAmount) {
        (bool success, bytes memory responseData) = _curvePool.staticcall(
            abi.encodeCall(ICurvePool(address(0)).calc_token_amount, (_amounts))
        );
        if (!success) {
            revert FailedToFetchExpectedLPTokenAmount();
        }
        minMintAmount = abi.decode(responseData, (uint256));
    }

    /**
     * @notice Returns the expected LP token amount received for depositing given amounts of IBT and PT
     * @notice Method to be used with legacy Curve Cryptoswap NG pools
     * @param _curvePool The address of the Curve Pool in which liquidity will be deposited
     * @param _amounts Array containing the amounts of IBT and PT to deposit in the Curve Pool
     * @return minMintAmount The amount of expected LP tokens received for depositing the liquidity in the pool
     */
    function previewAddLiquidityNG(
        address _curvePool,
        uint256[2] memory _amounts
    ) external view returns (uint256 minMintAmount) {
        (bool success, bytes memory responseData) = _curvePool.staticcall(
            abi.encodeCall(ICurveNGPool(address(0)).calc_token_amount, (_amounts, true))
        );
        if (!success) {
            revert FailedToFetchExpectedLPTokenAmount();
        }
        minMintAmount = abi.decode(responseData, (uint256));
    }

    /**
     * @notice Returns the expected LP token amount received for depositing given amounts of IBT and PT
     * @notice Method to be used with StableSwap NG pools
     * @param _curvePool The address of the Curve Pool in which liquidity will be deposited
     * @param _amounts Array containing the amounts of IBT and PT to deposit in the Curve Pool
     * @return minMintAmount The amount of expected LP tokens received for depositing the liquidity in the pool
     */
    function previewAddLiquiditySNG(
        address _curvePool,
        uint256[] memory _amounts
    ) external view returns (uint256 minMintAmount) {
        // @dev set the is_deposit to true
        (bool success, bytes memory responseData) = _curvePool.staticcall(
            abi.encodeCall(IStableSwapNG(address(0)).calc_token_amount, (_amounts, true))
        );
        if (!success) {
            revert FailedToFetchExpectedLPTokenAmount();
        }
        minMintAmount = abi.decode(responseData, (uint256));
    }

    /**
     * @notice Returns the IBT and PT amounts received for burning a given amount of LP tokens
     * @notice Method to be used with legacy Curve Cryptoswap pools
     * @param _curvePool The address of the curve pool
     * @param _lpTokenAmount The amount of the lp token to burn
     * @return minAmounts The expected respective amounts of IBT and PT withdrawn from the curve pool
     */
    function previewRemoveLiquidity(
        address _curvePool,
        uint256 _lpTokenAmount
    ) external view returns (uint256[2] memory minAmounts) {
        address lpToken = ICurvePool(_curvePool).token();
        uint256 totalSupply = IERC20(lpToken).totalSupply();
        (uint256 ibtBalance, uint256 ptBalance) = _getCurvePoolBalances(_curvePool);
        // decrement following what Curve is doing
        if (_lpTokenAmount > APPROXIMATION_DECREMENT && totalSupply != 0) {
            _lpTokenAmount -= APPROXIMATION_DECREMENT;
            minAmounts = [
                (ibtBalance * _lpTokenAmount) / totalSupply,
                (ptBalance * _lpTokenAmount) / totalSupply
            ];
        } else {
            minAmounts = [uint256(0), uint256(0)];
        }
    }

    /**
     * @notice Returns the IBT and PT amounts received for burning a given amount of LP tokens
     * @notice Method to be used with Curve Cryptoswap NG pools
     * @param _curvePool The address of the curve pool
     * @param _lpTokenAmount The amount of the lp token to burn
     * @return minAmounts The expected respective amounts of IBT and PT withdrawn from the curve pool
     */
    function previewRemoveLiquidityNG(
        address _curvePool,
        uint256 _lpTokenAmount
    ) external view returns (uint256[2] memory minAmounts) {
        uint256 totalSupply = ICurveNGPool(_curvePool).totalSupply();
        (uint256 ibtBalance, uint256 ptBalance) = _getCurvePoolBalances(_curvePool);
        // reproduces Curve implementation
        if (_lpTokenAmount == totalSupply) {
            minAmounts = [ibtBalance, ptBalance];
        } else if (_lpTokenAmount > APPROXIMATION_DECREMENT && totalSupply != 0) {
            _lpTokenAmount -= APPROXIMATION_DECREMENT;
            minAmounts = [
                ibtBalance.mulDiv(_lpTokenAmount, totalSupply),
                ptBalance.mulDiv(_lpTokenAmount, totalSupply)
            ];
        } else {
            minAmounts = [uint256(0), uint256(0)];
        }
    }

    /**
     * @notice Returns the IBT and PT amounts received for burning a given amount of LP tokens
     * @notice Method to be used with StableSwap NG pools
     * @param _curvePool The address of the curve pool
     * @param _lpTokenAmount The amount of the lp token to burn
     * @return minAmounts The expected respective amounts of IBT and PT withdrawn from the curve pool
     */
    function previewRemoveLiquiditySNG(
        address _curvePool,
        uint256 _lpTokenAmount
    ) external view returns (uint256[] memory) {
        uint256 totalSupply = IERC20(_curvePool).totalSupply();
        (uint256 ibtBalance, uint256 ptBalance) = _getCurvePoolBalances(_curvePool);
        // decrement following what Curve is doing
        uint256[] memory minAmounts = new uint256[](2);
        if (_lpTokenAmount > APPROXIMATION_DECREMENT && totalSupply != 0) {
            _lpTokenAmount -= APPROXIMATION_DECREMENT;
            minAmounts[0] = (ibtBalance * _lpTokenAmount) / totalSupply;
            minAmounts[1] = (ptBalance * _lpTokenAmount) / totalSupply;
        } else {
            minAmounts[0] = 0;
            minAmounts[1] = 0;
        }
        return minAmounts;
    }

    /**
     * @notice Returns the amount of coin i received for burning a given amount of LP tokens
     * @notice Method to be used with legacy Curve CryptoSwap pools
     * @param _curvePool The address of the curve pool
     * @param _lpTokenAmount The amount of the LP tokens to burn
     * @param _i The index of the unique coin to withdraw
     * @return minAmount The expected amount of coin i withdrawn from the curve pool
     */
    function previewRemoveLiquidityOneCoin(
        address _curvePool,
        uint256 _lpTokenAmount,
        uint256 _i
    ) external view returns (uint256 minAmount) {
        (bool success, bytes memory responseData) = _curvePool.staticcall(
            abi.encodeCall(ICurvePool(address(0)).calc_withdraw_one_coin, (_lpTokenAmount, _i))
        );
        if (!success) {
            revert FailedToFetchExpectedCoinAmount();
        }
        minAmount = abi.decode(responseData, (uint256));
    }

    /**
     * @notice Returns the amount of coin i received for burning a given amount of LP tokens
     * @notice Method to be used with Curve NG pools
     * @param _curvePool The address of the curve pool
     * @param _lpTokenAmount The amount of the LP tokens to burn
     * @param _i The index of the unique coin to withdraw
     * @return minAmount The expected amount of coin i withdrawn from the curve pool
     */
    function previewRemoveLiquidityOneCoinNG(
        address _curvePool,
        uint256 _lpTokenAmount,
        uint256 _i
    ) external view returns (uint256 minAmount) {
        (bool success, bytes memory responseData) = _curvePool.staticcall(
            abi.encodeCall(ICurveNGPool(address(0)).calc_withdraw_one_coin, (_lpTokenAmount, _i))
        );
        if (!success) {
            revert FailedToFetchExpectedCoinAmount();
        }
        minAmount = abi.decode(responseData, (uint256));
    }

    /**
     * @notice Returns the amount of coin i received for burning a given amount of LP tokens
     * @notice Method to be used with StableSwap NG pools
     * @param _curvePool The address of the curve pool
     * @param _lpTokenAmount The amount of the LP tokens to burn
     * @param _i The index of the unique coin to withdraw
     * @return minAmount The expected amount of coin i withdrawn from the curve pool
     */
    function previewRemoveLiquidityOneCoinSNG(
        address _curvePool,
        uint256 _lpTokenAmount,
        int128 _i
    ) external view returns (uint256 minAmount) {
        (bool success, bytes memory responseData) = _curvePool.staticcall(
            abi.encodeCall(IStableSwapNG(address(0)).calc_withdraw_one_coin, (_lpTokenAmount, _i))
        );
        if (!success) {
            revert FailedToFetchExpectedCoinAmount();
        }
        minAmount = abi.decode(responseData, (uint256));
    }

    /**
     * @notice Return the amount of IBT to deposit in the curve pool, given the total amount of IBT available for deposit
     * @param _amount The total amount of IBT available for deposit
     * @param _curvePool The address of the pool to deposit the amounts
     * @param _pt The address of the PT
     * @return ibts The amount of IBT which will be deposited in the curve pool
     */
    function calcIBTsToTokenizeForCurvePool(
        uint256 _amount,
        address _curvePool,
        address _pt
    ) external view returns (uint256 ibts) {
        (uint256 ibtBalance, uint256 ptBalance) = _getCurvePoolBalances(_curvePool);
        uint256 ibtBalanceInPT = IPrincipalToken(_pt).previewDepositIBT(ibtBalance);
        // Liquidity added in a ratio that (closely) matches the existing pool's ratio
        ibts = _amount.mulDiv(ptBalance, ibtBalanceInPT + ptBalance);
    }

    /**
     * @notice Return the amount of IBT to deposit in the curve pool given the proportion in which we want to deposit, given the total amount of IBT available for deposit
     * @param _amount The total amount of IBT available for deposit
     * @param _prop The proportion in which we want to make the deposit: _prop = nIBT / (nIBT + nPT)
     * @param _pt The address of the PT
     * @return ibts The amount of IBT which will be deposited in the curve pool
     */
    function calcIBTsToTokenizeForCurvePoolCustomProp(
        uint256 _amount,
        uint256 _prop,
        address _pt
    ) external view returns (uint256 ibts) {
        uint256 rate = IPrincipalToken(_pt).previewDepositIBT(_amount).mulDiv(CURVE_UNIT, _amount);
        ibts = _amount.mulDiv(CURVE_UNIT, CURVE_UNIT + _prop.mulDiv(rate, CURVE_UNIT));
    }

    /**
     * @param _curvePool : PT/IBT curve pool
     * @param _i token index
     * @param _j token index
     * @param _targetDy amount out desired
     * @return dx The amount of token to provide in order to obtain _targetDy after swap
     */
    function getDx(
        address _curvePool,
        uint256 _i,
        uint256 _j,
        uint256 _targetDy
    ) external view returns (uint256 dx) {
        // Initial guesses
        uint256 _minGuess = type(uint256).max;
        uint256 _maxGuess = type(uint256).max;
        uint256 _factor100;
        uint256 _guess = ICurvePool(_curvePool).get_dy(_i, _j, _targetDy);

        if (_guess > _targetDy) {
            _maxGuess = _targetDy;
            _factor100 = 10;
        } else {
            _minGuess = _targetDy;
            _factor100 = 1000;
        }
        uint256 loops;
        _guess = _targetDy;
        while (!_dxSolved(_curvePool, _i, _j, _guess, _targetDy, _minGuess, _maxGuess)) {
            loops++;

            (_minGuess, _maxGuess, _guess) = _runLoop(
                _minGuess,
                _maxGuess,
                _factor100,
                _guess,
                _targetDy,
                _curvePool,
                _i,
                _j
            );

            if (loops >= MAX_ITERATIONS_BINSEARCH) {
                revert SolutionNotFound();
            }
        }
        dx = _guess;
    }

    /**
     * @dev Runs bisection search
     * @param _minGuess lower bound on searched value
     * @param _maxGuess upper bound on searched value
     * @param _factor100 search interval scaling factor
     * @param _guess The previous guess for the `dx` value that is being refined through the search process
     * @param _targetDy The target output of the `get_dy` function, which the search aims to achieve by adjusting `dx`.
     * @param _curvePool PT/IBT curve pool
     * @param _i token index, either 0 or 1
     * @param _j token index, either 0 or 1, must be different than _i
     * @return The lower bound on _guess, upper bound on _guess and next _guess
     */
    function _runLoop(
        uint256 _minGuess,
        uint256 _maxGuess,
        uint256 _factor100,
        uint256 _guess,
        uint256 _targetDy,
        address _curvePool,
        uint256 _i,
        uint256 _j
    ) internal view returns (uint256, uint256, uint256) {
        if (_minGuess == type(uint256).max || _maxGuess == type(uint256).max) {
            _guess = (_guess * _factor100) / 100;
        } else {
            _guess = (_maxGuess + _minGuess) >> 1;
        }
        uint256 dy = ICurvePool(_curvePool).get_dy(_i, _j, _guess);
        if (dy < _targetDy) {
            _minGuess = _guess;
        } else if (dy > _targetDy) {
            _maxGuess = _guess;
        }
        return (_minGuess, _maxGuess, _guess);
    }

    /**
     * @dev Returns true if algorithm converged
     * @param _curvePool PT/IBT curve pool
     * @param _i token index, either 0 or 1
     * @param _j token index, either 0 or 1, must be different than _i
     * @param _dx The current guess for the `dx` value that is being refined through the search process.
     * @param _targetDy The target output of the `get_dy` function, which the search aims to achieve by adjusting `dx`.
     * @param _minGuess lower bound on searched value
     * @param _maxGuess upper bound on searched value
     * @return true if the solution to the search problem was found, false otherwise
     */
    function _dxSolved(
        address _curvePool,
        uint256 _i,
        uint256 _j,
        uint256 _dx,
        uint256 _targetDy,
        uint256 _minGuess,
        uint256 _maxGuess
    ) internal view returns (bool) {
        if (_minGuess == type(uint256).max || _maxGuess == type(uint256).max) {
            return false;
        }
        uint256 dy = ICurvePool(_curvePool).get_dy(_i, _j, _dx);
        if (dy == _targetDy) {
            return true;
        }
        uint256 dy1 = ICurvePool(_curvePool).get_dy(_i, _j, _dx + 1);
        if (dy < _targetDy && _targetDy < dy1) {
            return true;
        }
        return false;
    }

    /**
     * @notice Returns the balances of the two tokens in provided curve pool
     * @param _curvePool address of the curve pool
     * @return The IBT and PT balances of the curve pool
     */
    function _getCurvePoolBalances(address _curvePool) internal view returns (uint256, uint256) {
        return (ICurvePool(_curvePool).balances(0), ICurvePool(_curvePool).balances(1));
    }
}

File 23 of 36 : IERC20Metadata.sol
// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (interfaces/IERC20Metadata.sol)

pragma solidity ^0.8.20;

import {IERC20Metadata} from "../token/ERC20/extensions/IERC20Metadata.sol";

File 24 of 36 : AuthorityUtils.sol
// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (access/manager/AuthorityUtils.sol)

pragma solidity ^0.8.20;

import {IAuthority} from "./IAuthority.sol";

library AuthorityUtils {
    /**
     * @dev Since `AccessManager` implements an extended IAuthority interface, invoking `canCall` with backwards compatibility
     * for the preexisting `IAuthority` interface requires special care to avoid reverting on insufficient return data.
     * This helper function takes care of invoking `canCall` in a backwards compatible way without reverting.
     */
    function canCallWithDelay(
        address authority,
        address caller,
        address target,
        bytes4 selector
    ) internal view returns (bool immediate, uint32 delay) {
        (bool success, bytes memory data) = authority.staticcall(
            abi.encodeCall(IAuthority.canCall, (caller, target, selector))
        );
        if (success) {
            if (data.length >= 0x40) {
                (immediate, delay) = abi.decode(data, (bool, uint32));
            } else if (data.length >= 0x20) {
                immediate = abi.decode(data, (bool));
            }
        }
        return (immediate, delay);
    }
}

File 25 of 36 : IStableSwapNG.sol
// SPDX-License-Identifier: UNLICENSED
pragma solidity ^0.8.4;

interface IStableSwapNG {
    function A() external view returns (uint256);
    function A_precise() external view returns (uint256);
    function DOMAIN_SEPARATOR() external view returns (bytes32);
    function D_ma_time() external view returns (uint256);
    function D_oracle() external view returns (uint256);
    function N_COINS() external view returns (uint256);
    function add_liquidity(
        uint256[] memory _amounts,
        uint256 _min_mint_amount,
        address _receiver
    ) external returns (uint256);
    function admin_balances(uint256 arg0) external view returns (uint256);
    function admin_fee() external view returns (uint256);
    function allowance(address arg0, address arg1) external view returns (uint256);
    function approve(address _spender, uint256 _value) external returns (bool);
    function balanceOf(address arg0) external view returns (uint256);
    function balances(uint256 i) external view returns (uint256);
    function calc_token_amount(
        uint256[] memory _amounts,
        bool _is_deposit
    ) external view returns (uint256);
    function calc_withdraw_one_coin(uint256 _burn_amount, int128 i) external view returns (uint256);
    function coins(uint256 arg0) external view returns (address);
    function decimals() external view returns (uint8);
    function dynamic_fee(int128 i, int128 j) external view returns (uint256);
    function ema_price(uint256 i) external view returns (uint256);
    function exchange(int128 i, int128 j, uint256 _dx, uint256 _min_dy) external returns (uint256);
    function exchange(
        int128 i,
        int128 j,
        uint256 _dx,
        uint256 _min_dy,
        address _receiver
    ) external returns (uint256);
    function exchange_received(
        int128 i,
        int128 j,
        uint256 _dx,
        uint256 _min_dy
    ) external returns (uint256);
    function exchange_received(
        int128 i,
        int128 j,
        uint256 _dx,
        uint256 _min_dy,
        address _receiver
    ) external returns (uint256);
    function fee() external view returns (uint256);
    function future_A() external view returns (uint256);
    function future_A_time() external view returns (uint256);
    function get_balances() external view returns (uint256[] memory);
    function get_dx(int128 i, int128 j, uint256 dy) external view returns (uint256);
    function get_dy(int128 i, int128 j, uint256 dx) external view returns (uint256);
    function get_p(uint256 i) external view returns (uint256);
    function get_virtual_price() external view returns (uint256);
    function initial_A() external view returns (uint256);
    function initial_A_time() external view returns (uint256);
    function last_price(uint256 i) external view returns (uint256);
    function ma_exp_time() external view returns (uint256);
    function ma_last_time() external view returns (uint256);
    function name() external view returns (string memory);
    function nonces(address arg0) external view returns (uint256);
    function offpeg_fee_multiplier() external view returns (uint256);
    function permit(
        address _owner,
        address _spender,
        uint256 _value,
        uint256 _deadline,
        uint8 _v,
        bytes32 _r,
        bytes32 _s
    ) external returns (bool);
    function price_oracle(uint256 i) external view returns (uint256);
    function ramp_A(uint256 _future_A, uint256 _future_time) external;
    function remove_liquidity(
        uint256 _burn_amount,
        uint256[] memory _min_amounts
    ) external returns (uint256[] memory);
    function remove_liquidity(
        uint256 _burn_amount,
        uint256[] memory _min_amounts,
        address _receiver
    ) external returns (uint256[] memory);
    function remove_liquidity(
        uint256 _burn_amount,
        uint256[] memory _min_amounts,
        address _receiver,
        bool _claim_admin_fees
    ) external returns (uint256[] memory);
    function remove_liquidity_imbalance(
        uint256[] memory _amounts,
        uint256 _max_burn_amount
    ) external returns (uint256);
    function remove_liquidity_imbalance(
        uint256[] memory _amounts,
        uint256 _max_burn_amount,
        address _receiver
    ) external returns (uint256);
    function remove_liquidity_one_coin(
        uint256 _burn_amount,
        int128 i,
        uint256 _min_received
    ) external returns (uint256);
    function remove_liquidity_one_coin(
        uint256 _burn_amount,
        int128 i,
        uint256 _min_received,
        address _receiver
    ) external returns (uint256);
    function salt() external view returns (bytes32);
    function set_ma_exp_time(uint256 _ma_exp_time, uint256 _D_ma_time) external;
    function set_new_fee(uint256 _new_fee, uint256 _new_offpeg_fee_multiplier) external;
    function stop_ramp_A() external;
    function stored_rates() external view returns (uint256[] memory);
    function symbol() external view returns (string memory);
    function totalSupply() external view returns (uint256);
    function transfer(address _to, uint256 _value) external returns (bool);
    function transferFrom(address _from, address _to, uint256 _value) external returns (bool);
    function version() external view returns (string memory);
    function withdraw_admin_fees() external;
}

// SPDX-License-Identifier: BUSL-1.1

pragma solidity ^0.8.20;

/**
 * @dev Interface for Curve CryptoSwap pool
 */
interface ICurvePool {
    function coins(uint256 index) external view returns (address);

    function balances(uint256 index) external view returns (uint256);

    function A() external view returns (uint256);

    function gamma() external view returns (uint256);

    function D() external view returns (uint256);

    function token() external view returns (address);

    function price_scale() external view returns (uint256);

    function future_A_gamma_time() external view returns (uint256);

    function future_A_gamma() external view returns (uint256);

    function initial_A_gamma_time() external view returns (uint256);

    function initial_A_gamma() external view returns (uint256);

    function fee_gamma() external view returns (uint256);

    function mid_fee() external view returns (uint256);

    function out_fee() external view returns (uint256);

    function allowed_extra_profit() external view returns (uint256);

    function adjustment_step() external view returns (uint256);

    function admin_fee() external view returns (uint256);

    function ma_half_time() external view returns (uint256);

    function get_virtual_price() external view returns (uint256);

    function fee() external view returns (uint256);

    function get_dy(uint256 i, uint256 j, uint256 dx) external view returns (uint256);

    function last_prices() external view returns (uint256);

    function calc_token_amount(uint256[2] calldata amounts) external view returns (uint256);

    function calc_withdraw_one_coin(
        uint256 _token_amount,
        uint256 i
    ) external view returns (uint256);

    function exchange(
        uint256 i,
        uint256 j,
        uint256 dx,
        uint256 min_dy,
        bool use_eth,
        address receiver
    ) external returns (uint256);

    function add_liquidity(
        uint256[2] calldata amounts,
        uint256 min_mint_amount
    ) external returns (uint256);

    function add_liquidity(
        uint256[2] calldata amounts,
        uint256 min_mint_amount,
        bool use_eth,
        address receiver
    ) external returns (uint256);

    function remove_liquidity(uint256 amount, uint256[2] calldata min_amounts) external;

    function remove_liquidity(
        uint256 amount,
        uint256[2] calldata min_amounts,
        bool use_eth,
        address receiver
    ) external;

    function remove_liquidity_one_coin(
        uint256 token_amount,
        uint256 i,
        uint256 min_amount
    ) external;

    function remove_liquidity_one_coin(
        uint256 token_amount,
        uint256 i,
        uint256 min_amount,
        bool use_eth,
        address receiver
    ) external;
}

File 27 of 36 : SafeCast.sol
// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (utils/math/SafeCast.sol)
// This file was procedurally generated from scripts/generate/templates/SafeCast.js.

pragma solidity ^0.8.20;

/**
 * @dev Wrappers over Solidity's uintXX/intXX casting operators with added overflow
 * checks.
 *
 * Downcasting from uint256/int256 in Solidity does not revert on overflow. This can
 * easily result in undesired exploitation or bugs, since developers usually
 * assume that overflows raise errors. `SafeCast` restores this intuition by
 * reverting the transaction when such an operation overflows.
 *
 * Using this library instead of the unchecked operations eliminates an entire
 * class of bugs, so it's recommended to use it always.
 */
library SafeCast {
    /**
     * @dev Value doesn't fit in an uint of `bits` size.
     */
    error SafeCastOverflowedUintDowncast(uint8 bits, uint256 value);

    /**
     * @dev An int value doesn't fit in an uint of `bits` size.
     */
    error SafeCastOverflowedIntToUint(int256 value);

    /**
     * @dev Value doesn't fit in an int of `bits` size.
     */
    error SafeCastOverflowedIntDowncast(uint8 bits, int256 value);

    /**
     * @dev An uint value doesn't fit in an int of `bits` size.
     */
    error SafeCastOverflowedUintToInt(uint256 value);

    /**
     * @dev Returns the downcasted uint248 from uint256, reverting on
     * overflow (when the input is greater than largest uint248).
     *
     * Counterpart to Solidity's `uint248` operator.
     *
     * Requirements:
     *
     * - input must fit into 248 bits
     */
    function toUint248(uint256 value) internal pure returns (uint248) {
        if (value > type(uint248).max) {
            revert SafeCastOverflowedUintDowncast(248, value);
        }
        return uint248(value);
    }

    /**
     * @dev Returns the downcasted uint240 from uint256, reverting on
     * overflow (when the input is greater than largest uint240).
     *
     * Counterpart to Solidity's `uint240` operator.
     *
     * Requirements:
     *
     * - input must fit into 240 bits
     */
    function toUint240(uint256 value) internal pure returns (uint240) {
        if (value > type(uint240).max) {
            revert SafeCastOverflowedUintDowncast(240, value);
        }
        return uint240(value);
    }

    /**
     * @dev Returns the downcasted uint232 from uint256, reverting on
     * overflow (when the input is greater than largest uint232).
     *
     * Counterpart to Solidity's `uint232` operator.
     *
     * Requirements:
     *
     * - input must fit into 232 bits
     */
    function toUint232(uint256 value) internal pure returns (uint232) {
        if (value > type(uint232).max) {
            revert SafeCastOverflowedUintDowncast(232, value);
        }
        return uint232(value);
    }

    /**
     * @dev Returns the downcasted uint224 from uint256, reverting on
     * overflow (when the input is greater than largest uint224).
     *
     * Counterpart to Solidity's `uint224` operator.
     *
     * Requirements:
     *
     * - input must fit into 224 bits
     */
    function toUint224(uint256 value) internal pure returns (uint224) {
        if (value > type(uint224).max) {
            revert SafeCastOverflowedUintDowncast(224, value);
        }
        return uint224(value);
    }

    /**
     * @dev Returns the downcasted uint216 from uint256, reverting on
     * overflow (when the input is greater than largest uint216).
     *
     * Counterpart to Solidity's `uint216` operator.
     *
     * Requirements:
     *
     * - input must fit into 216 bits
     */
    function toUint216(uint256 value) internal pure returns (uint216) {
        if (value > type(uint216).max) {
            revert SafeCastOverflowedUintDowncast(216, value);
        }
        return uint216(value);
    }

    /**
     * @dev Returns the downcasted uint208 from uint256, reverting on
     * overflow (when the input is greater than largest uint208).
     *
     * Counterpart to Solidity's `uint208` operator.
     *
     * Requirements:
     *
     * - input must fit into 208 bits
     */
    function toUint208(uint256 value) internal pure returns (uint208) {
        if (value > type(uint208).max) {
            revert SafeCastOverflowedUintDowncast(208, value);
        }
        return uint208(value);
    }

    /**
     * @dev Returns the downcasted uint200 from uint256, reverting on
     * overflow (when the input is greater than largest uint200).
     *
     * Counterpart to Solidity's `uint200` operator.
     *
     * Requirements:
     *
     * - input must fit into 200 bits
     */
    function toUint200(uint256 value) internal pure returns (uint200) {
        if (value > type(uint200).max) {
            revert SafeCastOverflowedUintDowncast(200, value);
        }
        return uint200(value);
    }

    /**
     * @dev Returns the downcasted uint192 from uint256, reverting on
     * overflow (when the input is greater than largest uint192).
     *
     * Counterpart to Solidity's `uint192` operator.
     *
     * Requirements:
     *
     * - input must fit into 192 bits
     */
    function toUint192(uint256 value) internal pure returns (uint192) {
        if (value > type(uint192).max) {
            revert SafeCastOverflowedUintDowncast(192, value);
        }
        return uint192(value);
    }

    /**
     * @dev Returns the downcasted uint184 from uint256, reverting on
     * overflow (when the input is greater than largest uint184).
     *
     * Counterpart to Solidity's `uint184` operator.
     *
     * Requirements:
     *
     * - input must fit into 184 bits
     */
    function toUint184(uint256 value) internal pure returns (uint184) {
        if (value > type(uint184).max) {
            revert SafeCastOverflowedUintDowncast(184, value);
        }
        return uint184(value);
    }

    /**
     * @dev Returns the downcasted uint176 from uint256, reverting on
     * overflow (when the input is greater than largest uint176).
     *
     * Counterpart to Solidity's `uint176` operator.
     *
     * Requirements:
     *
     * - input must fit into 176 bits
     */
    function toUint176(uint256 value) internal pure returns (uint176) {
        if (value > type(uint176).max) {
            revert SafeCastOverflowedUintDowncast(176, value);
        }
        return uint176(value);
    }

    /**
     * @dev Returns the downcasted uint168 from uint256, reverting on
     * overflow (when the input is greater than largest uint168).
     *
     * Counterpart to Solidity's `uint168` operator.
     *
     * Requirements:
     *
     * - input must fit into 168 bits
     */
    function toUint168(uint256 value) internal pure returns (uint168) {
        if (value > type(uint168).max) {
            revert SafeCastOverflowedUintDowncast(168, value);
        }
        return uint168(value);
    }

    /**
     * @dev Returns the downcasted uint160 from uint256, reverting on
     * overflow (when the input is greater than largest uint160).
     *
     * Counterpart to Solidity's `uint160` operator.
     *
     * Requirements:
     *
     * - input must fit into 160 bits
     */
    function toUint160(uint256 value) internal pure returns (uint160) {
        if (value > type(uint160).max) {
            revert SafeCastOverflowedUintDowncast(160, value);
        }
        return uint160(value);
    }

    /**
     * @dev Returns the downcasted uint152 from uint256, reverting on
     * overflow (when the input is greater than largest uint152).
     *
     * Counterpart to Solidity's `uint152` operator.
     *
     * Requirements:
     *
     * - input must fit into 152 bits
     */
    function toUint152(uint256 value) internal pure returns (uint152) {
        if (value > type(uint152).max) {
            revert SafeCastOverflowedUintDowncast(152, value);
        }
        return uint152(value);
    }

    /**
     * @dev Returns the downcasted uint144 from uint256, reverting on
     * overflow (when the input is greater than largest uint144).
     *
     * Counterpart to Solidity's `uint144` operator.
     *
     * Requirements:
     *
     * - input must fit into 144 bits
     */
    function toUint144(uint256 value) internal pure returns (uint144) {
        if (value > type(uint144).max) {
            revert SafeCastOverflowedUintDowncast(144, value);
        }
        return uint144(value);
    }

    /**
     * @dev Returns the downcasted uint136 from uint256, reverting on
     * overflow (when the input is greater than largest uint136).
     *
     * Counterpart to Solidity's `uint136` operator.
     *
     * Requirements:
     *
     * - input must fit into 136 bits
     */
    function toUint136(uint256 value) internal pure returns (uint136) {
        if (value > type(uint136).max) {
            revert SafeCastOverflowedUintDowncast(136, value);
        }
        return uint136(value);
    }

    /**
     * @dev Returns the downcasted uint128 from uint256, reverting on
     * overflow (when the input is greater than largest uint128).
     *
     * Counterpart to Solidity's `uint128` operator.
     *
     * Requirements:
     *
     * - input must fit into 128 bits
     */
    function toUint128(uint256 value) internal pure returns (uint128) {
        if (value > type(uint128).max) {
            revert SafeCastOverflowedUintDowncast(128, value);
        }
        return uint128(value);
    }

    /**
     * @dev Returns the downcasted uint120 from uint256, reverting on
     * overflow (when the input is greater than largest uint120).
     *
     * Counterpart to Solidity's `uint120` operator.
     *
     * Requirements:
     *
     * - input must fit into 120 bits
     */
    function toUint120(uint256 value) internal pure returns (uint120) {
        if (value > type(uint120).max) {
            revert SafeCastOverflowedUintDowncast(120, value);
        }
        return uint120(value);
    }

    /**
     * @dev Returns the downcasted uint112 from uint256, reverting on
     * overflow (when the input is greater than largest uint112).
     *
     * Counterpart to Solidity's `uint112` operator.
     *
     * Requirements:
     *
     * - input must fit into 112 bits
     */
    function toUint112(uint256 value) internal pure returns (uint112) {
        if (value > type(uint112).max) {
            revert SafeCastOverflowedUintDowncast(112, value);
        }
        return uint112(value);
    }

    /**
     * @dev Returns the downcasted uint104 from uint256, reverting on
     * overflow (when the input is greater than largest uint104).
     *
     * Counterpart to Solidity's `uint104` operator.
     *
     * Requirements:
     *
     * - input must fit into 104 bits
     */
    function toUint104(uint256 value) internal pure returns (uint104) {
        if (value > type(uint104).max) {
            revert SafeCastOverflowedUintDowncast(104, value);
        }
        return uint104(value);
    }

    /**
     * @dev Returns the downcasted uint96 from uint256, reverting on
     * overflow (when the input is greater than largest uint96).
     *
     * Counterpart to Solidity's `uint96` operator.
     *
     * Requirements:
     *
     * - input must fit into 96 bits
     */
    function toUint96(uint256 value) internal pure returns (uint96) {
        if (value > type(uint96).max) {
            revert SafeCastOverflowedUintDowncast(96, value);
        }
        return uint96(value);
    }

    /**
     * @dev Returns the downcasted uint88 from uint256, reverting on
     * overflow (when the input is greater than largest uint88).
     *
     * Counterpart to Solidity's `uint88` operator.
     *
     * Requirements:
     *
     * - input must fit into 88 bits
     */
    function toUint88(uint256 value) internal pure returns (uint88) {
        if (value > type(uint88).max) {
            revert SafeCastOverflowedUintDowncast(88, value);
        }
        return uint88(value);
    }

    /**
     * @dev Returns the downcasted uint80 from uint256, reverting on
     * overflow (when the input is greater than largest uint80).
     *
     * Counterpart to Solidity's `uint80` operator.
     *
     * Requirements:
     *
     * - input must fit into 80 bits
     */
    function toUint80(uint256 value) internal pure returns (uint80) {
        if (value > type(uint80).max) {
            revert SafeCastOverflowedUintDowncast(80, value);
        }
        return uint80(value);
    }

    /**
     * @dev Returns the downcasted uint72 from uint256, reverting on
     * overflow (when the input is greater than largest uint72).
     *
     * Counterpart to Solidity's `uint72` operator.
     *
     * Requirements:
     *
     * - input must fit into 72 bits
     */
    function toUint72(uint256 value) internal pure returns (uint72) {
        if (value > type(uint72).max) {
            revert SafeCastOverflowedUintDowncast(72, value);
        }
        return uint72(value);
    }

    /**
     * @dev Returns the downcasted uint64 from uint256, reverting on
     * overflow (when the input is greater than largest uint64).
     *
     * Counterpart to Solidity's `uint64` operator.
     *
     * Requirements:
     *
     * - input must fit into 64 bits
     */
    function toUint64(uint256 value) internal pure returns (uint64) {
        if (value > type(uint64).max) {
            revert SafeCastOverflowedUintDowncast(64, value);
        }
        return uint64(value);
    }

    /**
     * @dev Returns the downcasted uint56 from uint256, reverting on
     * overflow (when the input is greater than largest uint56).
     *
     * Counterpart to Solidity's `uint56` operator.
     *
     * Requirements:
     *
     * - input must fit into 56 bits
     */
    function toUint56(uint256 value) internal pure returns (uint56) {
        if (value > type(uint56).max) {
            revert SafeCastOverflowedUintDowncast(56, value);
        }
        return uint56(value);
    }

    /**
     * @dev Returns the downcasted uint48 from uint256, reverting on
     * overflow (when the input is greater than largest uint48).
     *
     * Counterpart to Solidity's `uint48` operator.
     *
     * Requirements:
     *
     * - input must fit into 48 bits
     */
    function toUint48(uint256 value) internal pure returns (uint48) {
        if (value > type(uint48).max) {
            revert SafeCastOverflowedUintDowncast(48, value);
        }
        return uint48(value);
    }

    /**
     * @dev Returns the downcasted uint40 from uint256, reverting on
     * overflow (when the input is greater than largest uint40).
     *
     * Counterpart to Solidity's `uint40` operator.
     *
     * Requirements:
     *
     * - input must fit into 40 bits
     */
    function toUint40(uint256 value) internal pure returns (uint40) {
        if (value > type(uint40).max) {
            revert SafeCastOverflowedUintDowncast(40, value);
        }
        return uint40(value);
    }

    /**
     * @dev Returns the downcasted uint32 from uint256, reverting on
     * overflow (when the input is greater than largest uint32).
     *
     * Counterpart to Solidity's `uint32` operator.
     *
     * Requirements:
     *
     * - input must fit into 32 bits
     */
    function toUint32(uint256 value) internal pure returns (uint32) {
        if (value > type(uint32).max) {
            revert SafeCastOverflowedUintDowncast(32, value);
        }
        return uint32(value);
    }

    /**
     * @dev Returns the downcasted uint24 from uint256, reverting on
     * overflow (when the input is greater than largest uint24).
     *
     * Counterpart to Solidity's `uint24` operator.
     *
     * Requirements:
     *
     * - input must fit into 24 bits
     */
    function toUint24(uint256 value) internal pure returns (uint24) {
        if (value > type(uint24).max) {
            revert SafeCastOverflowedUintDowncast(24, value);
        }
        return uint24(value);
    }

    /**
     * @dev Returns the downcasted uint16 from uint256, reverting on
     * overflow (when the input is greater than largest uint16).
     *
     * Counterpart to Solidity's `uint16` operator.
     *
     * Requirements:
     *
     * - input must fit into 16 bits
     */
    function toUint16(uint256 value) internal pure returns (uint16) {
        if (value > type(uint16).max) {
            revert SafeCastOverflowedUintDowncast(16, value);
        }
        return uint16(value);
    }

    /**
     * @dev Returns the downcasted uint8 from uint256, reverting on
     * overflow (when the input is greater than largest uint8).
     *
     * Counterpart to Solidity's `uint8` operator.
     *
     * Requirements:
     *
     * - input must fit into 8 bits
     */
    function toUint8(uint256 value) internal pure returns (uint8) {
        if (value > type(uint8).max) {
            revert SafeCastOverflowedUintDowncast(8, value);
        }
        return uint8(value);
    }

    /**
     * @dev Converts a signed int256 into an unsigned uint256.
     *
     * Requirements:
     *
     * - input must be greater than or equal to 0.
     */
    function toUint256(int256 value) internal pure returns (uint256) {
        if (value < 0) {
            revert SafeCastOverflowedIntToUint(value);
        }
        return uint256(value);
    }

    /**
     * @dev Returns the downcasted int248 from int256, reverting on
     * overflow (when the input is less than smallest int248 or
     * greater than largest int248).
     *
     * Counterpart to Solidity's `int248` operator.
     *
     * Requirements:
     *
     * - input must fit into 248 bits
     */
    function toInt248(int256 value) internal pure returns (int248 downcasted) {
        downcasted = int248(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(248, value);
        }
    }

    /**
     * @dev Returns the downcasted int240 from int256, reverting on
     * overflow (when the input is less than smallest int240 or
     * greater than largest int240).
     *
     * Counterpart to Solidity's `int240` operator.
     *
     * Requirements:
     *
     * - input must fit into 240 bits
     */
    function toInt240(int256 value) internal pure returns (int240 downcasted) {
        downcasted = int240(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(240, value);
        }
    }

    /**
     * @dev Returns the downcasted int232 from int256, reverting on
     * overflow (when the input is less than smallest int232 or
     * greater than largest int232).
     *
     * Counterpart to Solidity's `int232` operator.
     *
     * Requirements:
     *
     * - input must fit into 232 bits
     */
    function toInt232(int256 value) internal pure returns (int232 downcasted) {
        downcasted = int232(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(232, value);
        }
    }

    /**
     * @dev Returns the downcasted int224 from int256, reverting on
     * overflow (when the input is less than smallest int224 or
     * greater than largest int224).
     *
     * Counterpart to Solidity's `int224` operator.
     *
     * Requirements:
     *
     * - input must fit into 224 bits
     */
    function toInt224(int256 value) internal pure returns (int224 downcasted) {
        downcasted = int224(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(224, value);
        }
    }

    /**
     * @dev Returns the downcasted int216 from int256, reverting on
     * overflow (when the input is less than smallest int216 or
     * greater than largest int216).
     *
     * Counterpart to Solidity's `int216` operator.
     *
     * Requirements:
     *
     * - input must fit into 216 bits
     */
    function toInt216(int256 value) internal pure returns (int216 downcasted) {
        downcasted = int216(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(216, value);
        }
    }

    /**
     * @dev Returns the downcasted int208 from int256, reverting on
     * overflow (when the input is less than smallest int208 or
     * greater than largest int208).
     *
     * Counterpart to Solidity's `int208` operator.
     *
     * Requirements:
     *
     * - input must fit into 208 bits
     */
    function toInt208(int256 value) internal pure returns (int208 downcasted) {
        downcasted = int208(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(208, value);
        }
    }

    /**
     * @dev Returns the downcasted int200 from int256, reverting on
     * overflow (when the input is less than smallest int200 or
     * greater than largest int200).
     *
     * Counterpart to Solidity's `int200` operator.
     *
     * Requirements:
     *
     * - input must fit into 200 bits
     */
    function toInt200(int256 value) internal pure returns (int200 downcasted) {
        downcasted = int200(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(200, value);
        }
    }

    /**
     * @dev Returns the downcasted int192 from int256, reverting on
     * overflow (when the input is less than smallest int192 or
     * greater than largest int192).
     *
     * Counterpart to Solidity's `int192` operator.
     *
     * Requirements:
     *
     * - input must fit into 192 bits
     */
    function toInt192(int256 value) internal pure returns (int192 downcasted) {
        downcasted = int192(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(192, value);
        }
    }

    /**
     * @dev Returns the downcasted int184 from int256, reverting on
     * overflow (when the input is less than smallest int184 or
     * greater than largest int184).
     *
     * Counterpart to Solidity's `int184` operator.
     *
     * Requirements:
     *
     * - input must fit into 184 bits
     */
    function toInt184(int256 value) internal pure returns (int184 downcasted) {
        downcasted = int184(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(184, value);
        }
    }

    /**
     * @dev Returns the downcasted int176 from int256, reverting on
     * overflow (when the input is less than smallest int176 or
     * greater than largest int176).
     *
     * Counterpart to Solidity's `int176` operator.
     *
     * Requirements:
     *
     * - input must fit into 176 bits
     */
    function toInt176(int256 value) internal pure returns (int176 downcasted) {
        downcasted = int176(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(176, value);
        }
    }

    /**
     * @dev Returns the downcasted int168 from int256, reverting on
     * overflow (when the input is less than smallest int168 or
     * greater than largest int168).
     *
     * Counterpart to Solidity's `int168` operator.
     *
     * Requirements:
     *
     * - input must fit into 168 bits
     */
    function toInt168(int256 value) internal pure returns (int168 downcasted) {
        downcasted = int168(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(168, value);
        }
    }

    /**
     * @dev Returns the downcasted int160 from int256, reverting on
     * overflow (when the input is less than smallest int160 or
     * greater than largest int160).
     *
     * Counterpart to Solidity's `int160` operator.
     *
     * Requirements:
     *
     * - input must fit into 160 bits
     */
    function toInt160(int256 value) internal pure returns (int160 downcasted) {
        downcasted = int160(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(160, value);
        }
    }

    /**
     * @dev Returns the downcasted int152 from int256, reverting on
     * overflow (when the input is less than smallest int152 or
     * greater than largest int152).
     *
     * Counterpart to Solidity's `int152` operator.
     *
     * Requirements:
     *
     * - input must fit into 152 bits
     */
    function toInt152(int256 value) internal pure returns (int152 downcasted) {
        downcasted = int152(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(152, value);
        }
    }

    /**
     * @dev Returns the downcasted int144 from int256, reverting on
     * overflow (when the input is less than smallest int144 or
     * greater than largest int144).
     *
     * Counterpart to Solidity's `int144` operator.
     *
     * Requirements:
     *
     * - input must fit into 144 bits
     */
    function toInt144(int256 value) internal pure returns (int144 downcasted) {
        downcasted = int144(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(144, value);
        }
    }

    /**
     * @dev Returns the downcasted int136 from int256, reverting on
     * overflow (when the input is less than smallest int136 or
     * greater than largest int136).
     *
     * Counterpart to Solidity's `int136` operator.
     *
     * Requirements:
     *
     * - input must fit into 136 bits
     */
    function toInt136(int256 value) internal pure returns (int136 downcasted) {
        downcasted = int136(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(136, value);
        }
    }

    /**
     * @dev Returns the downcasted int128 from int256, reverting on
     * overflow (when the input is less than smallest int128 or
     * greater than largest int128).
     *
     * Counterpart to Solidity's `int128` operator.
     *
     * Requirements:
     *
     * - input must fit into 128 bits
     */
    function toInt128(int256 value) internal pure returns (int128 downcasted) {
        downcasted = int128(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(128, value);
        }
    }

    /**
     * @dev Returns the downcasted int120 from int256, reverting on
     * overflow (when the input is less than smallest int120 or
     * greater than largest int120).
     *
     * Counterpart to Solidity's `int120` operator.
     *
     * Requirements:
     *
     * - input must fit into 120 bits
     */
    function toInt120(int256 value) internal pure returns (int120 downcasted) {
        downcasted = int120(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(120, value);
        }
    }

    /**
     * @dev Returns the downcasted int112 from int256, reverting on
     * overflow (when the input is less than smallest int112 or
     * greater than largest int112).
     *
     * Counterpart to Solidity's `int112` operator.
     *
     * Requirements:
     *
     * - input must fit into 112 bits
     */
    function toInt112(int256 value) internal pure returns (int112 downcasted) {
        downcasted = int112(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(112, value);
        }
    }

    /**
     * @dev Returns the downcasted int104 from int256, reverting on
     * overflow (when the input is less than smallest int104 or
     * greater than largest int104).
     *
     * Counterpart to Solidity's `int104` operator.
     *
     * Requirements:
     *
     * - input must fit into 104 bits
     */
    function toInt104(int256 value) internal pure returns (int104 downcasted) {
        downcasted = int104(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(104, value);
        }
    }

    /**
     * @dev Returns the downcasted int96 from int256, reverting on
     * overflow (when the input is less than smallest int96 or
     * greater than largest int96).
     *
     * Counterpart to Solidity's `int96` operator.
     *
     * Requirements:
     *
     * - input must fit into 96 bits
     */
    function toInt96(int256 value) internal pure returns (int96 downcasted) {
        downcasted = int96(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(96, value);
        }
    }

    /**
     * @dev Returns the downcasted int88 from int256, reverting on
     * overflow (when the input is less than smallest int88 or
     * greater than largest int88).
     *
     * Counterpart to Solidity's `int88` operator.
     *
     * Requirements:
     *
     * - input must fit into 88 bits
     */
    function toInt88(int256 value) internal pure returns (int88 downcasted) {
        downcasted = int88(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(88, value);
        }
    }

    /**
     * @dev Returns the downcasted int80 from int256, reverting on
     * overflow (when the input is less than smallest int80 or
     * greater than largest int80).
     *
     * Counterpart to Solidity's `int80` operator.
     *
     * Requirements:
     *
     * - input must fit into 80 bits
     */
    function toInt80(int256 value) internal pure returns (int80 downcasted) {
        downcasted = int80(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(80, value);
        }
    }

    /**
     * @dev Returns the downcasted int72 from int256, reverting on
     * overflow (when the input is less than smallest int72 or
     * greater than largest int72).
     *
     * Counterpart to Solidity's `int72` operator.
     *
     * Requirements:
     *
     * - input must fit into 72 bits
     */
    function toInt72(int256 value) internal pure returns (int72 downcasted) {
        downcasted = int72(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(72, value);
        }
    }

    /**
     * @dev Returns the downcasted int64 from int256, reverting on
     * overflow (when the input is less than smallest int64 or
     * greater than largest int64).
     *
     * Counterpart to Solidity's `int64` operator.
     *
     * Requirements:
     *
     * - input must fit into 64 bits
     */
    function toInt64(int256 value) internal pure returns (int64 downcasted) {
        downcasted = int64(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(64, value);
        }
    }

    /**
     * @dev Returns the downcasted int56 from int256, reverting on
     * overflow (when the input is less than smallest int56 or
     * greater than largest int56).
     *
     * Counterpart to Solidity's `int56` operator.
     *
     * Requirements:
     *
     * - input must fit into 56 bits
     */
    function toInt56(int256 value) internal pure returns (int56 downcasted) {
        downcasted = int56(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(56, value);
        }
    }

    /**
     * @dev Returns the downcasted int48 from int256, reverting on
     * overflow (when the input is less than smallest int48 or
     * greater than largest int48).
     *
     * Counterpart to Solidity's `int48` operator.
     *
     * Requirements:
     *
     * - input must fit into 48 bits
     */
    function toInt48(int256 value) internal pure returns (int48 downcasted) {
        downcasted = int48(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(48, value);
        }
    }

    /**
     * @dev Returns the downcasted int40 from int256, reverting on
     * overflow (when the input is less than smallest int40 or
     * greater than largest int40).
     *
     * Counterpart to Solidity's `int40` operator.
     *
     * Requirements:
     *
     * - input must fit into 40 bits
     */
    function toInt40(int256 value) internal pure returns (int40 downcasted) {
        downcasted = int40(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(40, value);
        }
    }

    /**
     * @dev Returns the downcasted int32 from int256, reverting on
     * overflow (when the input is less than smallest int32 or
     * greater than largest int32).
     *
     * Counterpart to Solidity's `int32` operator.
     *
     * Requirements:
     *
     * - input must fit into 32 bits
     */
    function toInt32(int256 value) internal pure returns (int32 downcasted) {
        downcasted = int32(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(32, value);
        }
    }

    /**
     * @dev Returns the downcasted int24 from int256, reverting on
     * overflow (when the input is less than smallest int24 or
     * greater than largest int24).
     *
     * Counterpart to Solidity's `int24` operator.
     *
     * Requirements:
     *
     * - input must fit into 24 bits
     */
    function toInt24(int256 value) internal pure returns (int24 downcasted) {
        downcasted = int24(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(24, value);
        }
    }

    /**
     * @dev Returns the downcasted int16 from int256, reverting on
     * overflow (when the input is less than smallest int16 or
     * greater than largest int16).
     *
     * Counterpart to Solidity's `int16` operator.
     *
     * Requirements:
     *
     * - input must fit into 16 bits
     */
    function toInt16(int256 value) internal pure returns (int16 downcasted) {
        downcasted = int16(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(16, value);
        }
    }

    /**
     * @dev Returns the downcasted int8 from int256, reverting on
     * overflow (when the input is less than smallest int8 or
     * greater than largest int8).
     *
     * Counterpart to Solidity's `int8` operator.
     *
     * Requirements:
     *
     * - input must fit into 8 bits
     */
    function toInt8(int256 value) internal pure returns (int8 downcasted) {
        downcasted = int8(value);
        if (downcasted != value) {
            revert SafeCastOverflowedIntDowncast(8, value);
        }
    }

    /**
     * @dev Converts an unsigned uint256 into a signed int256.
     *
     * Requirements:
     *
     * - input must be less than or equal to maxInt256.
     */
    function toInt256(uint256 value) internal pure returns (int256) {
        // Note: Unsafe cast below is okay because `type(int256).max` is guaranteed to be positive
        if (value > uint256(type(int256).max)) {
            revert SafeCastOverflowedUintToInt(value);
        }
        return int256(value);
    }
}

// SPDX-License-Identifier: BUSL-1.1
pragma solidity 0.8.20;

/**
 * @title RayMath library
 * @author Spectra Finance
 * @notice Provides conversions for/to any decimal tokens to/from ray.
 * @dev Conversions from Ray are rounded down.
 */
library RayMath {
    /// @dev 27 decimal unit
    uint256 public constant RAY_UNIT = 1e27;
    uint256 public constant RAY_DECIMALS = 27;

    /**
     * @dev Converts a value from Ray (27-decimal precision) to a representation with a specified number of decimals.
     * @param _a The amount in Ray to be converted. Ray is a fixed-point representation with 27 decimals.
     * @param _decimals The target decimal precision for the converted amount.
     * @return b The amount converted from Ray to the specified decimal precision.
     */
    function fromRay(uint256 _a, uint256 _decimals) internal pure returns (uint256 b) {
        uint256 decimals_ratio = 10 ** (RAY_DECIMALS - _decimals);
        assembly {
            b := div(_a, decimals_ratio)
        }
    }

    /**
     * @dev Converts a value from Ray (27-decimal precision) to a representation with a specified number of decimals.
     * @param _a The amount in Ray to be converted. Ray is a fixed-point representation with 27 decimals.
     * @param _decimals The target decimal precision for the converted amount.
     * @param _roundUp If true, the function rounds up the result to the nearest integer value.
     *                If false, it truncates (rounds down) to the nearest integer.
     * @return b The amount converted from Ray to the specified decimal precision, rounded as specified.
     */
    function fromRay(
        uint256 _a,
        uint256 _decimals,
        bool _roundUp
    ) internal pure returns (uint256 b) {
        uint256 decimals_ratio = 10 ** (RAY_DECIMALS - _decimals);
        assembly {
            b := div(_a, decimals_ratio)

            if and(eq(_roundUp, 1), gt(mod(_a, decimals_ratio), 0)) {
                b := add(b, 1)
            }
        }
    }

    /**
     * @dev Converts a value with a specified number of decimals to Ray (27-decimal precision).
     * @param _a The amount to be converted, specified in a decimal format.
     * @param _decimals The number of decimals in the representation of 'a'.
     * @return b The amount in Ray, converted from the specified decimal precision.
     *           Ensures that the conversion maintains the value's integrity (no overflow).
     */
    function toRay(uint256 _a, uint256 _decimals) internal pure returns (uint256 b) {
        uint256 decimals_ratio = 10 ** (RAY_DECIMALS - _decimals);
        // to avoid overflow, b/decimals_ratio == _a
        assembly {
            b := mul(_a, decimals_ratio)

            if iszero(eq(div(b, decimals_ratio), _a)) {
                revert(0, 0)
            }
        }
    }
}

File 29 of 36 : Constants.sol
// SPDX-License-Identifier: BUSL-1.1

pragma solidity 0.8.20;

library Constants {
    /// @dev 18 decimal unit
    uint256 internal constant UNIT = 1e18;

    /// @dev identifier for native ETH
    address public constant ETH = 0xEeeeeEeeeEeEeeEeEeEeeEEEeeeeEeeeeeeeEEeE;

    /// @dev maximal number of iterations in the secant method algorithm
    uint256 internal constant MAX_ITERATIONS_SECANT = 255;

    /// @dev maximal number of iterations in the linear search following secant method algorithm
    uint256 internal constant MAX_ITERATIONS_LINEAR_SEARCH = 255;

    /// @dev determines the rate at which an input value is scaled in each iteration of linear search
    uint256 internal constant SCALING_FACTOR_LINEAR_SEARCH = 1e6;

    /// @dev precision divisor for the secant method
    uint256 internal constant PRECISION_DIVISOR = 1000;

    /// @dev Used for identifying cases when this contract's balance of a token is to be used as an input
    /// This value is equivalent to 1<<255, i.e. a singular 1 in the most significant bit.
    uint256 internal constant CONTRACT_BALANCE =
        0x8000000000000000000000000000000000000000000000000000000000000000;

    /// @dev Used as a flag for identifying that msg.sender should be used, saves gas by sending more 0 bytes
    address internal constant MSG_SENDER = address(0xc0);

    /// @dev Used as a flag for identifying address(this) should be used, saves gas by sending more 0 bytes
    address internal constant ADDRESS_THIS = address(0xe0);
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (utils/Pausable.sol)

pragma solidity ^0.8.20;

import {ContextUpgradeable} from "../utils/ContextUpgradeable.sol";
import {Initializable} from "../proxy/utils/Initializable.sol";

/**
 * @dev Contract module which allows children to implement an emergency stop
 * mechanism that can be triggered by an authorized account.
 *
 * This module is used through inheritance. It will make available the
 * modifiers `whenNotPaused` and `whenPaused`, which can be applied to
 * the functions of your contract. Note that they will not be pausable by
 * simply including this module, only once the modifiers are put in place.
 */
abstract contract PausableUpgradeable is Initializable, ContextUpgradeable {
    /// @custom:storage-location erc7201:openzeppelin.storage.Pausable
    struct PausableStorage {
        bool _paused;
    }

    // keccak256(abi.encode(uint256(keccak256("openzeppelin.storage.Pausable")) - 1)) & ~bytes32(uint256(0xff))
    bytes32 private constant PausableStorageLocation = 0xcd5ed15c6e187e77e9aee88184c21f4f2182ab5827cb3b7e07fbedcd63f03300;

    function _getPausableStorage() private pure returns (PausableStorage storage $) {
        assembly {
            $.slot := PausableStorageLocation
        }
    }

    /**
     * @dev Emitted when the pause is triggered by `account`.
     */
    event Paused(address account);

    /**
     * @dev Emitted when the pause is lifted by `account`.
     */
    event Unpaused(address account);

    /**
     * @dev The operation failed because the contract is paused.
     */
    error EnforcedPause();

    /**
     * @dev The operation failed because the contract is not paused.
     */
    error ExpectedPause();

    /**
     * @dev Initializes the contract in unpaused state.
     */
    function __Pausable_init() internal onlyInitializing {
        __Pausable_init_unchained();
    }

    function __Pausable_init_unchained() internal onlyInitializing {
        PausableStorage storage $ = _getPausableStorage();
        $._paused = false;
    }

    /**
     * @dev Modifier to make a function callable only when the contract is not paused.
     *
     * Requirements:
     *
     * - The contract must not be paused.
     */
    modifier whenNotPaused() {
        _requireNotPaused();
        _;
    }

    /**
     * @dev Modifier to make a function callable only when the contract is paused.
     *
     * Requirements:
     *
     * - The contract must be paused.
     */
    modifier whenPaused() {
        _requirePaused();
        _;
    }

    /**
     * @dev Returns true if the contract is paused, and false otherwise.
     */
    function paused() public view virtual returns (bool) {
        PausableStorage storage $ = _getPausableStorage();
        return $._paused;
    }

    /**
     * @dev Throws if the contract is paused.
     */
    function _requireNotPaused() internal view virtual {
        if (paused()) {
            revert EnforcedPause();
        }
    }

    /**
     * @dev Throws if the contract is not paused.
     */
    function _requirePaused() internal view virtual {
        if (!paused()) {
            revert ExpectedPause();
        }
    }

    /**
     * @dev Triggers stopped state.
     *
     * Requirements:
     *
     * - The contract must not be paused.
     */
    function _pause() internal virtual whenNotPaused {
        PausableStorage storage $ = _getPausableStorage();
        $._paused = true;
        emit Paused(_msgSender());
    }

    /**
     * @dev Returns to normal state.
     *
     * Requirements:
     *
     * - The contract must be paused.
     */
    function _unpause() internal virtual whenPaused {
        PausableStorage storage $ = _getPausableStorage();
        $._paused = false;
        emit Unpaused(_msgSender());
    }
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (interfaces/IERC3156FlashLender.sol)

pragma solidity ^0.8.20;

import {IERC3156FlashBorrower} from "./IERC3156FlashBorrower.sol";

/**
 * @dev Interface of the ERC3156 FlashLender, as defined in
 * https://eips.ethereum.org/EIPS/eip-3156[ERC-3156].
 */
interface IERC3156FlashLender {
    /**
     * @dev The amount of currency available to be lended.
     * @param token The loan currency.
     * @return The amount of `token` that can be borrowed.
     */
    function maxFlashLoan(address token) external view returns (uint256);

    /**
     * @dev The fee to be charged for a given loan.
     * @param token The loan currency.
     * @param amount The amount of tokens lent.
     * @return The amount of `token` to be charged for the loan, on top of the returned principal.
     */
    function flashFee(address token, uint256 amount) external view returns (uint256);

    /**
     * @dev Initiate a flash loan.
     * @param receiver The receiver of the tokens in the loan, and the receiver of the callback.
     * @param token The loan currency.
     * @param amount The amount of tokens lent.
     * @param data Arbitrary data structure, intended to contain user-defined parameters.
     */
    function flashLoan(
        IERC3156FlashBorrower receiver,
        address token,
        uint256 amount,
        bytes calldata data
    ) external returns (bool);
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (token/ERC20/extensions/IERC20Permit.sol)

pragma solidity ^0.8.20;

/**
 * @dev Interface of the ERC20 Permit extension allowing approvals to be made via signatures, as defined in
 * https://eips.ethereum.org/EIPS/eip-2612[EIP-2612].
 *
 * Adds the {permit} method, which can be used to change an account's ERC20 allowance (see {IERC20-allowance}) by
 * presenting a message signed by the account. By not relying on {IERC20-approve}, the token holder account doesn't
 * need to send a transaction, and thus is not required to hold Ether at all.
 *
 * ==== Security Considerations
 *
 * There are two important considerations concerning the use of `permit`. The first is that a valid permit signature
 * expresses an allowance, and it should not be assumed to convey additional meaning. In particular, it should not be
 * considered as an intention to spend the allowance in any specific way. The second is that because permits have
 * built-in replay protection and can be submitted by anyone, they can be frontrun. A protocol that uses permits should
 * take this into consideration and allow a `permit` call to fail. Combining these two aspects, a pattern that may be
 * generally recommended is:
 *
 * ```solidity
 * function doThingWithPermit(..., uint256 value, uint256 deadline, uint8 v, bytes32 r, bytes32 s) public {
 *     try token.permit(msg.sender, address(this), value, deadline, v, r, s) {} catch {}
 *     doThing(..., value);
 * }
 *
 * function doThing(..., uint256 value) public {
 *     token.safeTransferFrom(msg.sender, address(this), value);
 *     ...
 * }
 * ```
 *
 * Observe that: 1) `msg.sender` is used as the owner, leaving no ambiguity as to the signer intent, and 2) the use of
 * `try/catch` allows the permit to fail and makes the code tolerant to frontrunning. (See also
 * {SafeERC20-safeTransferFrom}).
 *
 * Additionally, note that smart contract wallets (such as Argent or Safe) are not able to produce permit signatures, so
 * contracts should have entry points that don't rely on permit.
 */
interface IERC20Permit {
    /**
     * @dev Sets `value` as the allowance of `spender` over ``owner``'s tokens,
     * given ``owner``'s signed approval.
     *
     * IMPORTANT: The same issues {IERC20-approve} has related to transaction
     * ordering also apply here.
     *
     * Emits an {Approval} event.
     *
     * Requirements:
     *
     * - `spender` cannot be the zero address.
     * - `deadline` must be a timestamp in the future.
     * - `v`, `r` and `s` must be a valid `secp256k1` signature from `owner`
     * over the EIP712-formatted function arguments.
     * - the signature must use ``owner``'s current nonce (see {nonces}).
     *
     * For more information on the signature format, see the
     * https://eips.ethereum.org/EIPS/eip-2612#specification[relevant EIP
     * section].
     *
     * CAUTION: See Security Considerations above.
     */
    function permit(
        address owner,
        address spender,
        uint256 value,
        uint256 deadline,
        uint8 v,
        bytes32 r,
        bytes32 s
    ) external;

    /**
     * @dev Returns the current nonce for `owner`. This value must be
     * included whenever a signature is generated for {permit}.
     *
     * Every successful call to {permit} increases ``owner``'s nonce by one. This
     * prevents a signature from being used multiple times.
     */
    function nonces(address owner) external view returns (uint256);

    /**
     * @dev Returns the domain separator used in the encoding of the signature for {permit}, as defined by {EIP712}.
     */
    // solhint-disable-next-line func-name-mixedcase
    function DOMAIN_SEPARATOR() external view returns (bytes32);
}

// SPDX-License-Identifier: BUSL-1.1

pragma solidity ^0.8.20;

import {IERC20Metadata} from "openzeppelin-contracts/token/ERC20/extensions/IERC20Metadata.sol";

/**
 * @dev Interface for Curve TwoCrypto-NG pool
 */
interface ICurveNGPool is IERC20Metadata {
    function coins(uint256 index) external view returns (address);

    function balances(uint256 index) external view returns (uint256);

    function A() external view returns (uint256);

    function gamma() external view returns (uint256);

    function D() external view returns (uint256);

    function token() external view returns (address);

    function price_scale() external view returns (uint256);

    function price_oracle() external view returns (uint256);

    function future_A_gamma_time() external view returns (uint256);

    function future_A_gamma() external view returns (uint256);

    function initial_A_gamma_time() external view returns (uint256);

    function initial_A_gamma() external view returns (uint256);

    function fee_gamma() external view returns (uint256);

    function mid_fee() external view returns (uint256);

    function out_fee() external view returns (uint256);

    function allowed_extra_profit() external view returns (uint256);

    function adjustment_step() external view returns (uint256);

    function admin_fee() external view returns (uint256);

    function ma_time() external view returns (uint256);

    function get_virtual_price() external view returns (uint256);

    function fee() external view returns (uint256);

    function get_dy(uint256 i, uint256 j, uint256 dx) external view returns (uint256);

    function get_dx(uint256 i, uint256 j, uint256 dy) external view returns (uint256);

    function last_prices() external view returns (uint256);

    function calc_token_amount(
        uint256[2] calldata amounts,
        bool deposit
    ) external view returns (uint256);

    function calc_withdraw_one_coin(
        uint256 _token_amount,
        uint256 i
    ) external view returns (uint256);

    function exchange(uint256 i, uint256 j, uint256 dx, uint256 min_dy) external returns (uint256);

    function exchange(
        uint256 i,
        uint256 j,
        uint256 dx,
        uint256 min_dy,
        address receiver
    ) external returns (uint256);

    function add_liquidity(
        uint256[2] calldata amounts,
        uint256 min_mint_amount
    ) external returns (uint256);

    function add_liquidity(
        uint256[2] calldata amounts,
        uint256 min_mint_amount,
        address receiver
    ) external returns (uint256);

    function remove_liquidity(uint256 amount, uint256[2] calldata min_amounts) external;

    function remove_liquidity(
        uint256 amount,
        uint256[2] calldata min_amounts,
        address receiver
    ) external;

    function remove_liquidity_one_coin(
        uint256 token_amount,
        uint256 i,
        uint256 min_amount
    ) external;

    function remove_liquidity_one_coin(
        uint256 token_amount,
        uint256 i,
        uint256 min_amount,
        address receiver
    ) external;
}

// SPDX-License-Identifier: BUSL-1.1

pragma solidity ^0.8.20;

interface IRegistry {
    /* Errors
     *****************************************************************************************************************/
    error FeeGreaterThanMaxValue();
    error PTListUpdateFailed();
    error ReductionTooBig();
    error AddressError();

    /* GETTERS
     *****************************************************************************************************************/

    /**
     * @notice Getter for the factory address
     * @return The address of token factory
     */
    function getFactory() external view returns (address);

    /**
     * @notice Get the address of the router
     * @return The address of the router
     */
    function getRouter() external view returns (address);

    /**
     * @notice Get the address of the routerUtil
     * @return The address of the routerUtil
     */
    function getRouterUtil() external view returns (address);

    /**
     * @notice Get the address of the pt beacon
     * @return The address of PT beacon
     */
    function getPTBeacon() external view returns (address);

    /**
     * @notice Get the address of the yt beacon
     * @return The address of yt beacon
     */
    function getYTBeacon() external view returns (address);

    /**
     * @notice Get the value of tokenization fee
     * @return The value of tokenization fee
     */
    function getTokenizationFee() external view returns (uint256);

    /**
     * @notice Get the value of yield fee
     * @return The value of yield fee
     */
    function getYieldFee() external view returns (uint256);

    /**
     * @notice Get the value of PT flash loan fee
     * @return The value of PT flash loan fee
     */
    function getPTFlashLoanFee() external view returns (uint256);

    /**
     * @notice Get the address of the fee collector
     * @return The address of fee collector
     */
    function getFeeCollector() external view returns (address);

    /**
     * @notice Get the fee reduction of the given user for the given pt
     * @param _pt The address of the pt
     * @param _user The address of the user
     * @return The fee reduction of the given user for the given pt
     */
    function getFeeReduction(address _pt, address _user) external view returns (uint256);

    /**
     * @notice Getter to check if a pt is registered
     * @param _pt the address of the pt to check the registration of
     * @return true if it is, false otherwise
     */
    function isRegisteredPT(address _pt) external view returns (bool);

    /**
     * @notice Getter for the pt registered at an index
     * @param _index the index of the pt to return
     * @return The address of the corresponding pt
     */
    function getPTAt(uint256 _index) external view returns (address);

    /**
     * @notice Getter for number of PT registered
     * @return The number of PT registered
     */
    function pTCount() external view returns (uint256);

    /* SETTERS
     *****************************************************************************************************************/

    /**
     * @notice Setter for the tokens factory address
     * @param _newFactory The address of the new factory
     */
    function setFactory(address _newFactory) external;

    /**
     * @notice set the router
     * @param _router The address of the router
     */
    function setRouter(address _router) external;

    /**
     * @notice set the routerUtil
     * @param _routerUtil The address of the routerUtil
     */
    function setRouterUtil(address _routerUtil) external;

    /**
     * @notice set the tokenization fee
     * @param _tokenizationFee The value of tokenization fee
     */
    function setTokenizationFee(uint256 _tokenizationFee) external;

    /**
     * @notice set the yield fee
     * @param _yieldFee The value of yield fee
     */
    function setYieldFee(uint256 _yieldFee) external;

    /**
     * @notice set the PT flash loan fee
     * @param _ptFlashLoanFee The value of PT flash loan fee
     */
    function setPTFlashLoanFee(uint256 _ptFlashLoanFee) external;

    /**
     * @notice set the fee collector
     * @param _feeCollector The address of fee collector
     */
    function setFeeCollector(address _feeCollector) external;

    /**
     * @notice Set the fee reduction of the given pt for the given user
     * @param _pt The address of the pt
     * @param _user The address of the user
     * @param _reduction The fee reduction
     */
    function reduceFee(address _pt, address _user, uint256 _reduction) external;

    /**
     * @notice set the pt beacon
     * @param _ptBeacon The address of PT beacon
     */
    function setPTBeacon(address _ptBeacon) external;

    /**
     * @notice set the yt beacon
     * @param _ytBeacon The address of yt beacon
     */
    function setYTBeacon(address _ytBeacon) external;

    /**
     * @notice Add a pt to the registry
     * @param _pt The address of the pt to add to the registry
     */
    function addPT(address _pt) external;

    /**
     * @notice Remove a pt from the registry
     * @param _pt The address of the pt to remove from the registry
     */
    function removePT(address _pt) external;
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (proxy/utils/Initializable.sol)

pragma solidity ^0.8.20;

/**
 * @dev This is a base contract to aid in writing upgradeable contracts, or any kind of contract that will be deployed
 * behind a proxy. Since proxied contracts do not make use of a constructor, it's common to move constructor logic to an
 * external initializer function, usually called `initialize`. It then becomes necessary to protect this initializer
 * function so it can only be called once. The {initializer} modifier provided by this contract will have this effect.
 *
 * The initialization functions use a version number. Once a version number is used, it is consumed and cannot be
 * reused. This mechanism prevents re-execution of each "step" but allows the creation of new initialization steps in
 * case an upgrade adds a module that needs to be initialized.
 *
 * For example:
 *
 * [.hljs-theme-light.nopadding]
 * ```solidity
 * contract MyToken is ERC20Upgradeable {
 *     function initialize() initializer public {
 *         __ERC20_init("MyToken", "MTK");
 *     }
 * }
 *
 * contract MyTokenV2 is MyToken, ERC20PermitUpgradeable {
 *     function initializeV2() reinitializer(2) public {
 *         __ERC20Permit_init("MyToken");
 *     }
 * }
 * ```
 *
 * TIP: To avoid leaving the proxy in an uninitialized state, the initializer function should be called as early as
 * possible by providing the encoded function call as the `_data` argument to {ERC1967Proxy-constructor}.
 *
 * CAUTION: When used with inheritance, manual care must be taken to not invoke a parent initializer twice, or to ensure
 * that all initializers are idempotent. This is not verified automatically as constructors are by Solidity.
 *
 * [CAUTION]
 * ====
 * Avoid leaving a contract uninitialized.
 *
 * An uninitialized contract can be taken over by an attacker. This applies to both a proxy and its implementation
 * contract, which may impact the proxy. To prevent the implementation contract from being used, you should invoke
 * the {_disableInitializers} function in the constructor to automatically lock it when it is deployed:
 *
 * [.hljs-theme-light.nopadding]
 * ```
 * /// @custom:oz-upgrades-unsafe-allow constructor
 * constructor() {
 *     _disableInitializers();
 * }
 * ```
 * ====
 */
abstract contract Initializable {
    /**
     * @dev Storage of the initializable contract.
     *
     * It's implemented on a custom ERC-7201 namespace to reduce the risk of storage collisions
     * when using with upgradeable contracts.
     *
     * @custom:storage-location erc7201:openzeppelin.storage.Initializable
     */
    struct InitializableStorage {
        /**
         * @dev Indicates that the contract has been initialized.
         */
        uint64 _initialized;
        /**
         * @dev Indicates that the contract is in the process of being initialized.
         */
        bool _initializing;
    }

    // keccak256(abi.encode(uint256(keccak256("openzeppelin.storage.Initializable")) - 1)) & ~bytes32(uint256(0xff))
    bytes32 private constant INITIALIZABLE_STORAGE = 0xf0c57e16840df040f15088dc2f81fe391c3923bec73e23a9662efc9c229c6a00;

    /**
     * @dev The contract is already initialized.
     */
    error InvalidInitialization();

    /**
     * @dev The contract is not initializing.
     */
    error NotInitializing();

    /**
     * @dev Triggered when the contract has been initialized or reinitialized.
     */
    event Initialized(uint64 version);

    /**
     * @dev A modifier that defines a protected initializer function that can be invoked at most once. In its scope,
     * `onlyInitializing` functions can be used to initialize parent contracts.
     *
     * Similar to `reinitializer(1)`, except that in the context of a constructor an `initializer` may be invoked any
     * number of times. This behavior in the constructor can be useful during testing and is not expected to be used in
     * production.
     *
     * Emits an {Initialized} event.
     */
    modifier initializer() {
        // solhint-disable-next-line var-name-mixedcase
        InitializableStorage storage $ = _getInitializableStorage();

        // Cache values to avoid duplicated sloads
        bool isTopLevelCall = !$._initializing;
        uint64 initialized = $._initialized;

        // Allowed calls:
        // - initialSetup: the contract is not in the initializing state and no previous version was
        //                 initialized
        // - construction: the contract is initialized at version 1 (no reininitialization) and the
        //                 current contract is just being deployed
        bool initialSetup = initialized == 0 && isTopLevelCall;
        bool construction = initialized == 1 && address(this).code.length == 0;

        if (!initialSetup && !construction) {
            revert InvalidInitialization();
        }
        $._initialized = 1;
        if (isTopLevelCall) {
            $._initializing = true;
        }
        _;
        if (isTopLevelCall) {
            $._initializing = false;
            emit Initialized(1);
        }
    }

    /**
     * @dev A modifier that defines a protected reinitializer function that can be invoked at most once, and only if the
     * contract hasn't been initialized to a greater version before. In its scope, `onlyInitializing` functions can be
     * used to initialize parent contracts.
     *
     * A reinitializer may be used after the original initialization step. This is essential to configure modules that
     * are added through upgrades and that require initialization.
     *
     * When `version` is 1, this modifier is similar to `initializer`, except that functions marked with `reinitializer`
     * cannot be nested. If one is invoked in the context of another, execution will revert.
     *
     * Note that versions can jump in increments greater than 1; this implies that if multiple reinitializers coexist in
     * a contract, executing them in the right order is up to the developer or operator.
     *
     * WARNING: Setting the version to 2**64 - 1 will prevent any future reinitialization.
     *
     * Emits an {Initialized} event.
     */
    modifier reinitializer(uint64 version) {
        // solhint-disable-next-line var-name-mixedcase
        InitializableStorage storage $ = _getInitializableStorage();

        if ($._initializing || $._initialized >= version) {
            revert InvalidInitialization();
        }
        $._initialized = version;
        $._initializing = true;
        _;
        $._initializing = false;
        emit Initialized(version);
    }

    /**
     * @dev Modifier to protect an initialization function so that it can only be invoked by functions with the
     * {initializer} and {reinitializer} modifiers, directly or indirectly.
     */
    modifier onlyInitializing() {
        _checkInitializing();
        _;
    }

    /**
     * @dev Reverts if the contract is not in an initializing state. See {onlyInitializing}.
     */
    function _checkInitializing() internal view virtual {
        if (!_isInitializing()) {
            revert NotInitializing();
        }
    }

    /**
     * @dev Locks the contract, preventing any future reinitialization. This cannot be part of an initializer call.
     * Calling this in the constructor of a contract will prevent that contract from being initialized or reinitialized
     * to any version. It is recommended to use this to lock implementation contracts that are designed to be called
     * through proxies.
     *
     * Emits an {Initialized} event the first time it is successfully executed.
     */
    function _disableInitializers() internal virtual {
        // solhint-disable-next-line var-name-mixedcase
        InitializableStorage storage $ = _getInitializableStorage();

        if ($._initializing) {
            revert InvalidInitialization();
        }
        if ($._initialized != type(uint64).max) {
            $._initialized = type(uint64).max;
            emit Initialized(type(uint64).max);
        }
    }

    /**
     * @dev Returns the highest version that has been initialized. See {reinitializer}.
     */
    function _getInitializedVersion() internal view returns (uint64) {
        return _getInitializableStorage()._initialized;
    }

    /**
     * @dev Returns `true` if the contract is currently initializing. See {onlyInitializing}.
     */
    function _isInitializing() internal view returns (bool) {
        return _getInitializableStorage()._initializing;
    }

    /**
     * @dev Returns a pointer to the storage namespace.
     */
    // solhint-disable-next-line var-name-mixedcase
    function _getInitializableStorage() private pure returns (InitializableStorage storage $) {
        assembly {
            $.slot := INITIALIZABLE_STORAGE
        }
    }
}

// SPDX-License-Identifier: MIT
// OpenZeppelin Contracts (last updated v5.0.0) (utils/Address.sol)

pragma solidity ^0.8.20;

/**
 * @dev Collection of functions related to the address type
 */
library Address {
    /**
     * @dev The ETH balance of the account is not enough to perform the operation.
     */
    error AddressInsufficientBalance(address account);

    /**
     * @dev There's no code at `target` (it is not a contract).
     */
    error AddressEmptyCode(address target);

    /**
     * @dev A call to an address target failed. The target may have reverted.
     */
    error FailedInnerCall();

    /**
     * @dev Replacement for Solidity's `transfer`: sends `amount` wei to
     * `recipient`, forwarding all available gas and reverting on errors.
     *
     * https://eips.ethereum.org/EIPS/eip-1884[EIP1884] increases the gas cost
     * of certain opcodes, possibly making contracts go over the 2300 gas limit
     * imposed by `transfer`, making them unable to receive funds via
     * `transfer`. {sendValue} removes this limitation.
     *
     * https://consensys.net/diligence/blog/2019/09/stop-using-soliditys-transfer-now/[Learn more].
     *
     * IMPORTANT: because control is transferred to `recipient`, care must be
     * taken to not create reentrancy vulnerabilities. Consider using
     * {ReentrancyGuard} or the
     * https://solidity.readthedocs.io/en/v0.8.20/security-considerations.html#use-the-checks-effects-interactions-pattern[checks-effects-interactions pattern].
     */
    function sendValue(address payable recipient, uint256 amount) internal {
        if (address(this).balance < amount) {
            revert AddressInsufficientBalance(address(this));
        }

        (bool success, ) = recipient.call{value: amount}("");
        if (!success) {
            revert FailedInnerCall();
        }
    }

    /**
     * @dev Performs a Solidity function call using a low level `call`. A
     * plain `call` is an unsafe replacement for a function call: use this
     * function instead.
     *
     * If `target` reverts with a revert reason or custom error, it is bubbled
     * up by this function (like regular Solidity function calls). However, if
     * the call reverted with no returned reason, this function reverts with a
     * {FailedInnerCall} error.
     *
     * Returns the raw returned data. To convert to the expected return value,
     * use https://solidity.readthedocs.io/en/latest/units-and-global-variables.html?highlight=abi.decode#abi-encoding-and-decoding-functions[`abi.decode`].
     *
     * Requirements:
     *
     * - `target` must be a contract.
     * - calling `target` with `data` must not revert.
     */
    function functionCall(address target, bytes memory data) internal returns (bytes memory) {
        return functionCallWithValue(target, data, 0);
    }

    /**
     * @dev Same as {xref-Address-functionCall-address-bytes-}[`functionCall`],
     * but also transferring `value` wei to `target`.
     *
     * Requirements:
     *
     * - the calling contract must have an ETH balance of at least `value`.
     * - the called Solidity function must be `payable`.
     */
    function functionCallWithValue(address target, bytes memory data, uint256 value) internal returns (bytes memory) {
        if (address(this).balance < value) {
            revert AddressInsufficientBalance(address(this));
        }
        (bool success, bytes memory returndata) = target.call{value: value}(data);
        return verifyCallResultFromTarget(target, success, returndata);
    }

    /**
     * @dev Same as {xref-Address-functionCall-address-bytes-}[`functionCall`],
     * but performing a static call.
     */
    function functionStaticCall(address target, bytes memory data) internal view returns (bytes memory) {
        (bool success, bytes memory returndata) = target.staticcall(data);
        return verifyCallResultFromTarget(target, success, returndata);
    }

    /**
     * @dev Same as {xref-Address-functionCall-address-bytes-}[`functionCall`],
     * but performing a delegate call.
     */
    function functionDelegateCall(address target, bytes memory data) internal returns (bytes memory) {
        (bool success, bytes memory returndata) = target.delegatecall(data);
        return verifyCallResultFromTarget(target, success, returndata);
    }

    /**
     * @dev Tool to verify that a low level call to smart-contract was successful, and reverts if the target
     * was not a contract or bubbling up the revert reason (falling back to {FailedInnerCall}) in case of an
     * unsuccessful call.
     */
    function verifyCallResultFromTarget(
        address target,
        bool success,
        bytes memory returndata
    ) internal view returns (bytes memory) {
        if (!success) {
            _revert(returndata);
        } else {
            // only check if target is a contract if the call was successful and the return data is empty
            // otherwise we already know that it was a contract
            if (returndata.length == 0 && target.code.length == 0) {
                revert AddressEmptyCode(target);
            }
            return returndata;
        }
    }

    /**
     * @dev Tool to verify that a low level call was successful, and reverts if it wasn't, either by bubbling the
     * revert reason or with a default {FailedInnerCall} error.
     */
    function verifyCallResult(bool success, bytes memory returndata) internal pure returns (bytes memory) {
        if (!success) {
            _revert(returndata);
        } else {
            return returndata;
        }
    }

    /**
     * @dev Reverts with returndata if present. Otherwise reverts with {FailedInnerCall}.
     */
    function _revert(bytes memory returndata) private pure {
        // Look for revert reason and bubble it up if present
        if (returndata.length > 0) {
            // The easiest way to bubble the revert reason is using memory via assembly
            /// @solidity memory-safe-assembly
            assembly {
                let returndata_size := mload(returndata)
                revert(add(32, returndata), returndata_size)
            }
        } else {
            revert FailedInnerCall();
        }
    }
}

Settings
{
  "evmVersion": "shanghai",
  "libraries": {
    "src/libraries/CurvePoolUtil.sol": {
      "CurvePoolUtil": "0x27857F8E0EEE20596e7cE5be3901efd663E91e10"
    },
    "src/libraries/NamingUtil.sol": {
      "NamingUtil": "0x0347772f901f6324095aB8547FE5158B2eb93549"
    },
    "src/libraries/PrincipalTokenUtil.sol": {
      "PrincipalTokenUtil": "0x622BCCf6B8A472a89be0ED4dBEe6C02600cE37f3"
    }
  },
  "metadata": {
    "appendCBOR": true,
    "bytecodeHash": "ipfs",
    "useLiteralContent": false
  },
  "optimizer": {
    "enabled": true,
    "runs": 200
  },
  "outputSelection": {
    "*": {
      "*": [
        "evm.bytecode",
        "evm.deployedBytecode",
        "devdoc",
        "userdoc",
        "metadata",
        "abi"
      ]
    }
  },
  "remappings": [
    "ds-test/=lib/forge-std/lib/ds-test/src/",
    "erc4626-tests/=lib/openzeppelin-contracts/lib/erc4626-tests/",
    "forge-std/=lib/forge-std/src/",
    "openzeppelin-contracts-upgradeable/=lib/openzeppelin-contracts-upgradeable/contracts/",
    "openzeppelin-contracts/=lib/openzeppelin-contracts/contracts/",
    "openzeppelin-erc20-basic/=lib/openzeppelin-contracts/contracts/token/ERC20/",
    "openzeppelin-erc20-extensions/=lib/openzeppelin-contracts-upgradeable/contracts/token/ERC20/extensions/",
    "openzeppelin-erc20/=lib/openzeppelin-contracts-upgradeable/contracts/token/ERC20/",
    "openzeppelin-math/=lib/openzeppelin-contracts/contracts/utils/math/",
    "openzeppelin-proxy/=lib/openzeppelin-contracts-upgradeable/contracts/proxy/utils/",
    "openzeppelin-utils/=lib/openzeppelin-contracts/contracts/utils/",
    "config/=lib/spectra-contracts-configs/script/",
    "@openzeppelin/contracts-upgradeable/=lib/openzeppelin-contracts-upgradeable/contracts/",
    "@openzeppelin/contracts/=lib/openzeppelin-contracts/contracts/",
    "DiamondRouter/=lib/DiamondRouter/",
    "halmos-cheatcodes/=lib/DiamondRouter/lib/openzeppelin-contracts-upgradeable/lib/halmos-cheatcodes/src/",
    "solidity-stringutils/=lib/DiamondRouter/lib/solidity-stringutils/",
    "spectra-contracts-configs/=lib/spectra-contracts-configs/"
  ],
  "viaIR": false
}

Contract Security Audit

Contract ABI

API
[{"inputs":[{"internalType":"address","name":"_registry","type":"address"}],"stateMutability":"nonpayable","type":"constructor"},{"inputs":[{"internalType":"address","name":"authority","type":"address"}],"name":"AccessManagedInvalidAuthority","type":"error"},{"inputs":[{"internalType":"address","name":"caller","type":"address"},{"internalType":"uint32","name":"delay","type":"uint32"}],"name":"AccessManagedRequiredDelay","type":"error"},{"inputs":[{"internalType":"address","name":"caller","type":"address"}],"name":"AccessManagedUnauthorized","type":"error"},{"inputs":[{"internalType":"address","name":"target","type":"address"}],"name":"AddressEmptyCode","type":"error"},{"inputs":[],"name":"AddressError","type":"error"},{"inputs":[{"internalType":"address","name":"account","type":"address"}],"name":"AddressInsufficientBalance","type":"error"},{"inputs":[],"name":"AmountError","type":"error"},{"inputs":[],"name":"BalanceUnderflow","type":"error"},{"inputs":[],"name":"CallFailed","type":"error"},{"inputs":[],"name":"DirectOnFlashloanCall","type":"error"},{"inputs":[],"name":"EnforcedPause","type":"error"},{"inputs":[],"name":"ExpectedPause","type":"error"},{"inputs":[],"name":"FailedInnerCall","type":"error"},{"inputs":[{"internalType":"uint256","name":"commandType","type":"uint256"}],"name":"InvalidCommandType","type":"error"},{"inputs":[{"internalType":"address","name":"lender","type":"address"}],"name":"InvalidFlashloanLender","type":"error"},{"inputs":[],"name":"InvalidInitialization","type":"error"},{"inputs":[],"name":"KyberRouterNotSet","type":"error"},{"inputs":[],"name":"LengthMismatch","type":"error"},{"inputs":[],"name":"MathOverflowedMulDiv","type":"error"},{"inputs":[],"name":"MaxInvolvedTokensExceeded","type":"error"},{"inputs":[{"internalType":"address","name":"token","type":"address"},{"internalType":"address","name":"owner","type":"address"},{"internalType":"uint256","name":"minimumBalance","type":"uint256"},{"internalType":"uint256","name":"actualBalance","type":"uint256"}],"name":"MinimumBalanceNotReached","type":"error"},{"inputs":[],"name":"NotInitializing","type":"error"},{"inputs":[],"name":"PermitFailed","type":"error"},{"inputs":[{"internalType":"address","name":"token","type":"address"}],"name":"SafeERC20FailedOperation","type":"error"},{"inputs":[],"name":"TransactionDeadlinePassed","type":"error"},{"inputs":[],"name":"UnauthorizedOnFlashloanCaller","type":"error"},{"inputs":[],"name":"UnauthorizedReentrantCall","type":"error"},{"anonymous":false,"inputs":[{"indexed":false,"internalType":"address","name":"authority","type":"address"}],"name":"AuthorityUpdated","type":"event"},{"anonymous":false,"inputs":[{"indexed":false,"internalType":"uint64","name":"version","type":"uint64"}],"name":"Initialized","type":"event"},{"anonymous":false,"inputs":[{"indexed":true,"internalType":"address","name":"previousKyberRouter","type":"address"},{"indexed":true,"internalType":"address","name":"newKyberRouter","type":"address"}],"name":"KyberRouterChange","type":"event"},{"anonymous":false,"inputs":[{"indexed":false,"internalType":"address","name":"account","type":"address"}],"name":"Paused","type":"event"},{"anonymous":false,"inputs":[{"indexed":true,"internalType":"address","name":"previousRouterUtil","type":"address"},{"indexed":true,"internalType":"address","name":"newRouterUtil","type":"address"}],"name":"RouterUtilChange","type":"event"},{"anonymous":false,"inputs":[{"indexed":false,"internalType":"address","name":"account","type":"address"}],"name":"Unpaused","type":"event"},{"inputs":[],"name":"authority","outputs":[{"internalType":"address","name":"","type":"address"}],"stateMutability":"view","type":"function"},{"inputs":[{"internalType":"bytes","name":"_commands","type":"bytes"},{"internalType":"bytes[]","name":"_inputs","type":"bytes[]"}],"name":"execute","outputs":[],"stateMutability":"payable","type":"function"},{"inputs":[{"internalType":"bytes","name":"_commands","type":"bytes"},{"internalType":"bytes[]","name":"_inputs","type":"bytes[]"},{"internalType":"uint256","name":"_deadline","type":"uint256"}],"name":"execute","outputs":[],"stateMutability":"payable","type":"function"},{"inputs":[],"name":"getKyberRouter","outputs":[{"internalType":"address","name":"","type":"address"}],"stateMutability":"view","type":"function"},{"inputs":[],"name":"getRegistry","outputs":[{"internalType":"address","name":"","type":"address"}],"stateMutability":"view","type":"function"},{"inputs":[],"name":"getRouterUtil","outputs":[{"internalType":"address","name":"","type":"address"}],"stateMutability":"view","type":"function"},{"inputs":[{"internalType":"address","name":"_routerUtil","type":"address"},{"internalType":"address","name":"_kyberRouter","type":"address"},{"internalType":"address","name":"_initialAuthority","type":"address"}],"name":"initialize","outputs":[],"stateMutability":"nonpayable","type":"function"},{"inputs":[],"name":"isConsumingScheduledOp","outputs":[{"internalType":"bytes4","name":"","type":"bytes4"}],"stateMutability":"view","type":"function"},{"inputs":[{"internalType":"address","name":"","type":"address"},{"internalType":"address","name":"_token","type":"address"},{"internalType":"uint256","name":"_amount","type":"uint256"},{"internalType":"uint256","name":"_fee","type":"uint256"},{"internalType":"bytes","name":"_data","type":"bytes"}],"name":"onFlashLoan","outputs":[{"internalType":"bytes32","name":"","type":"bytes32"}],"stateMutability":"nonpayable","type":"function"},{"inputs":[],"name":"pause","outputs":[],"stateMutability":"nonpayable","type":"function"},{"inputs":[],"name":"paused","outputs":[{"internalType":"bool","name":"","type":"bool"}],"stateMutability":"view","type":"function"},{"inputs":[{"internalType":"bytes","name":"_commands","type":"bytes"},{"internalType":"bytes[]","name":"_inputs","type":"bytes[]"}],"name":"previewRate","outputs":[{"internalType":"uint256","name":"","type":"uint256"}],"stateMutability":"view","type":"function"},{"inputs":[{"internalType":"bytes","name":"_commands","type":"bytes"},{"internalType":"bytes[]","name":"_inputs","type":"bytes[]"}],"name":"previewSpotRate","outputs":[{"internalType":"uint256","name":"","type":"uint256"}],"stateMutability":"view","type":"function"},{"inputs":[{"internalType":"address","name":"newAuthority","type":"address"}],"name":"setAuthority","outputs":[],"stateMutability":"nonpayable","type":"function"},{"inputs":[{"internalType":"address","name":"_kyberRouter","type":"address"}],"name":"setKyberRouter","outputs":[],"stateMutability":"nonpayable","type":"function"},{"inputs":[{"internalType":"address","name":"_routerUtil","type":"address"}],"name":"setRouterUtil","outputs":[],"stateMutability":"nonpayable","type":"function"},{"inputs":[],"name":"unPause","outputs":[],"stateMutability":"nonpayable","type":"function"},{"stateMutability":"payable","type":"receive"}]

60c06040527f439148f0bbc682ca079e46d6e2c2f0c1e3b820f1a291b069d8882abf8cf18dd960a05234801562000034575f80fd5b506040516200606b3803806200606b833981016040819052620000579162000151565b806001600160a01b0381166200008057604051630c59659760e31b815260040160405180910390fd5b6001600160a01b0316608052620000966200009d565b5062000180565b7ff0c57e16840df040f15088dc2f81fe391c3923bec73e23a9662efc9c229c6a00805468010000000000000000900460ff1615620000ee5760405163f92ee8a960e01b815260040160405180910390fd5b80546001600160401b03908116146200014e5780546001600160401b0319166001600160401b0390811782556040519081527fc7f505b2f371ae2175ee4913f4499e1f2633a7b5936321eed1cdaeb6115181d29060200160405180910390a15b50565b5f6020828403121562000162575f80fd5b81516001600160a01b038116811462000179575f80fd5b9392505050565b60805160a051615ea6620001c55f395f61052901525f81816101a1015281816113440152818161152f0152818161195901528181611c740152611fd50152615ea65ff3fe6080604052600436106100fd575f3560e01c80637a9e5e4b116100925780638fb36037116100625780638fb36037146102a0578063b748f092146102cd578063bf7e214f146102ec578063c0c53b8b14610300578063f7b188a51461031f575f80fd5b80637a9e5e4b1461022f5780638456cb591461024e5780638b0c9584146102625780638b33203c14610281575f80fd5b80635ab1bd53116100cd5780635ab1bd53146101935780635c975abb146101c557806361fbaaaa146101f357806369dfa6c214610210575f80fd5b806323e30c8b1461010857806324856bc31461013a5780633593564c1461014f578063466489fb14610162575f80fd5b3661010457005b5f80fd5b348015610113575f80fd5b50610127610122366004614e69565b610333565b6040519081526020015b60405180910390f35b61014d610148366004614f1f565b610557565b005b61014d61015d366004614f85565b61065b565b34801561016d575f80fd5b506002546001600160a01b03165b6040516001600160a01b039091168152602001610131565b34801561019e575f80fd5b507f000000000000000000000000000000000000000000000000000000000000000061017b565b3480156101d0575f80fd5b505f80516020615e518339815191525460ff166040519015158152602001610131565b3480156101fe575f80fd5b506003546001600160a01b031661017b565b34801561021b575f80fd5b5061012761022a366004614f1f565b610689565b34801561023a575f80fd5b5061014d610249366004614ff2565b6106a0565b348015610259575f80fd5b5061014d61072b565b34801561026d575f80fd5b5061014d61027c366004614ff2565b610741565b34801561028c575f80fd5b5061014d61029b366004614ff2565b6107cc565b3480156102ab575f80fd5b506102b4610830565b6040516001600160e01b03199091168152602001610131565b3480156102d8575f80fd5b506101276102e7366004614f1f565b610866565b3480156102f7575f80fd5b5061017b610875565b34801561030b575f80fd5b5061014d61031a36600461500d565b610890565b34801561032a575f80fd5b5061014d6109a8565b5f80546001600160a01b031661035c57604051630606fd0760e51b815260040160405180910390fd5b6001546001600160a01b031633146103875760405163242762f960e01b815260040160405180910390fd5b5f8061039584860186615126565b6040516324856bc360e01b8152919350915030906324856bc3906103bf9085908590600401615245565b5f604051808303815f87803b1580156103d6575f80fd5b505af11580156103e8573d5f803e3d5ffd5b505050505f86886103f991906152c9565b604051636eb1769f60e11b81523060048201523360248201529091505f906001600160a01b038b169063dd62ed3e90604401602060405180830381865afa158015610446573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061046a91906152dc565b905081811015610488576104886001600160a01b038b1633846109b9565b6040516370a0823160e01b81523060048201525f906001600160a01b038c16906370a0823190602401602060405180830381865afa1580156104cc573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906104f091906152dc565b905082811015610526575f54610526906001600160a01b03163061051484876152f3565b6001600160a01b038f16929190610a7c565b507f00000000000000000000000000000000000000000000000000000000000000009b9a5050505050505050505050565b61055f610ab5565b82818114610583576040516001621398b960e31b0319815260040160405180910390fd5b5f80546001600160a01b03166105b057505f80546001600160a01b031916331790553460045560016105d0565b3330146105d05760405163f9ce257360e01b815260040160405180910390fd5b5f5b82811015610639575f8787838181106105ed576105ed615306565b9050013560f81c60f81b9050365f87878581811061060d5761060d615306565b905060200281019061061f919061531a565b9150915061062e838383610ae5565b5050506001016105d2565b508015610653575f80546001600160a01b03191681556004555b505050505050565b808042111561067d57604051632dfb7c8b60e11b815260040160405180910390fd5b61065386868686610557565b5f610697858585855f612e8c565b95945050505050565b336106a9610875565b6001600160a01b0316816001600160a01b0316146106e95760405162d1953b60e31b81526001600160a01b03821660048201526024015b60405180910390fd5b816001600160a01b03163b5f0361071e576040516361798f2f60e11b81526001600160a01b03831660048201526024016106e0565b61072782612fb0565b5050565b610737335b5f36613010565b61073f613106565b565b61074a33610730565b6001600160a01b03811661077157604051630c59659760e31b815260040160405180910390fd5b6002546040516001600160a01b038084169216907fbacf07ffb3274576773b014d636ae5319ff022a18a5b0f958eaac799cf68439b905f90a3600280546001600160a01b0319166001600160a01b0392909216919091179055565b6107d533610730565b6003546040516001600160a01b038084169216907f775376a8cc8424fc322e2ac2b50230180c9622951b05587f5ab18ff432a03d49905f90a3600380546001600160a01b0319166001600160a01b0392909216919091179055565b5f80516020615e3183398151915280545f9190600160a01b900460ff16610857575f610860565b638fb3603760e01b5b91505090565b5f610697858585856001612e8c565b5f80516020615e31833981519152546001600160a01b031690565b7ff0c57e16840df040f15088dc2f81fe391c3923bec73e23a9662efc9c229c6a008054600160401b810460ff1615906001600160401b03165f811580156108d45750825b90505f826001600160401b031660011480156108ef5750303b155b9050811580156108fd575080155b1561091b5760405163f92ee8a960e01b815260040160405180910390fd5b845467ffffffffffffffff19166001178555831561094557845460ff60401b1916600160401b1785555b61094f8888613168565b610958866131c5565b831561099e57845460ff60401b19168555604051600181527fc7f505b2f371ae2175ee4913f4499e1f2633a7b5936321eed1cdaeb6115181d29060200160405180910390a15b5050505050505050565b6109b133610730565b61073f6131d9565b604080516001600160a01b038416602482015260448082018490528251808303909101815260649091019091526020810180516001600160e01b031663095ea7b360e01b179052610a0a848261321e565b610a76576040516001600160a01b0384811660248301525f6044830152610a6c91869182169063095ea7b3906064015b604051602081830303815290604052915060e01b6020820180516001600160e01b0383818316178352505050506132c1565b610a7684826132c1565b50505050565b6040516001600160a01b038481166024830152838116604483015260648201839052610a769186918216906323b872dd90608401610a3a565b5f80516020615e518339815191525460ff161561073f5760405163d93c066560e01b815260040160405180910390fd5b60f883901c603f1680610b26575f80610b008486018661535c565b5f549193509150610b1f906001600160a01b0380851691163084610a7c565b5050610a76565b60018103610c8e575f8080808080610b40888a018a615386565b5f5460405163d505accf60e01b81526001600160a01b039182166004820152306024820152604481018790526064810186905260ff8516608482015260a4810184905260c48101839052969c50949a509298509096509450925087169063d505accf9060e4015f604051808303815f87803b158015610bbd575f80fd5b505af1925050508015610bce575060015b610c69575f8054604051636eb1769f60e11b81526001600160a01b0391821660048201523060248201529088169063dd62ed3e90604401602060405180830381865afa158015610c20573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610c4491906152dc565b905085811015610c675760405163b78cb0dd60e01b815260040160405180910390fd5b505b5f54610c83906001600160a01b0388811691163088610a7c565b505050505050610a76565b60028103610ce4575f8080610ca5858701876153e3565b925092509250610cb482613327565b9150610cc0838261336c565b90508015610cdc57610cdc6001600160a01b03841683836133eb565b505050610a76565b6003811480610cf35750601581145b80610cfe5750601e81145b15610f53575f8080808080610d15888a018a615421565b9550955095509550955095505f866001600160a01b031663c6610657876040518263ffffffff1660e01b8152600401610d5091815260200190565b602060405180830381865afa158015610d6b573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610d8f919061547b565b9050610d9b818561336c565b9350610da682613327565b9150610dbc6001600160a01b03821688866109b9565b60038803610e565760405163ce7d650360e01b8152600481018790526024810186905260448101859052606481018490525f60848201526001600160a01b0383811660a483015288169063ce7d65039060c4015b6020604051808303815f875af1158015610e2c573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610e5091906152dc565b50610f33565b60158803610ea857604051630532419d60e51b8152600481018790526024810186905260448101859052606481018490526001600160a01b03838116608483015288169063a64833a09060a401610e10565b60405163ddc1f59d60e01b8152600f87810b600483015286900b602482015260448101859052606481018490526001600160a01b03838116608483015288169063ddc1f59d9060a4016020604051808303815f875af1158015610f0d573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610f3191906152dc565b505b610f476001600160a01b038216885f6109b9565b50505050505050610a76565b60108103611097575f808080610f6b86880188615496565b93509350935093505f846001600160a01b031663732e86fe6040518163ffffffff1660e01b8152600401602060405180830381865afa158015610fb0573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610fd4919061547b565b9050610fdf83613327565b9250610feb818561336c565b93506110016001600160a01b03821686866109b9565b60405163680d5c7760e11b8152600481018590526001600160a01b0384811660248301526044820184905286169063d01ab8ee906064016020604051808303815f875af1158015611054573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061107891906152dc565b5061108d6001600160a01b038216865f6109b9565b5050505050610a76565b60118103611141575f8080806110af86880188615496565b93509350935093506110c082613327565b91506110cc848461336c565b604051631886c6df60e21b81529093506001600160a01b0385169063621b1b7c906111019086908690309087906004016154db565b6020604051808303815f875af115801561111d573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061108d91906152dc565b6004810361127a575f808061115885870187615500565b9250925092505f836001600160a01b03166338d52e0f6040518163ffffffff1660e01b8152600401602060405180830381865afa15801561119b573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906111bf919061547b565b90506111cb818461336c565b92506111d682613327565b91506111ec6001600160a01b03821685856109b9565b604051636e553f6560e01b8152600481018490526001600160a01b038381166024830152851690636e553f65906044016020604051808303815f875af1158015611238573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061125c91906152dc565b506112716001600160a01b038216855f6109b9565b50505050610a76565b60058103611465575f8080808061129387890189615534565b945094509450945094505f856001600160a01b0316636f307dc36040518163ffffffff1660e01b8152600401602060405180830381865afa1580156112da573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906112fe919061547b565b905061130a818661336c565b945061131584613327565b935061132083613327565b60405163f5e306f760e01b81526001600160a01b0388811660048301529194505f917f0000000000000000000000000000000000000000000000000000000000000000169063f5e306f790602401602060405180830381865afa158015611389573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906113ad919061559a565b905080156113c5576113c082888861341c565b6113d9565b6113d96001600160a01b03831688886109b9565b604051630e4cca4b60e41b81526001600160a01b0388169063e4cca4b09061140b9089908990899089906004016154db565b6020604051808303815f875af1158015611427573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061144b91906152dc565b5080610f4757610f476001600160a01b038316885f6109b9565b600681036115f6575f8080808061147e87890189615534565b945094509450945094505f856001600160a01b031663c644fe946040518163ffffffff1660e01b8152600401602060405180830381865afa1580156114c5573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906114e9919061547b565b90506114f5818661336c565b945061150084613327565b935061150b83613327565b60405163f5e306f760e01b81526001600160a01b0388811660048301529194505f917f0000000000000000000000000000000000000000000000000000000000000000169063f5e306f790602401602060405180830381865afa158015611574573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611598919061559a565b905080156115b0576115ab82888861341c565b6115c4565b6115c46001600160a01b03831688886109b9565b604051631520940360e11b81526001600160a01b03881690632a4128069061140b9089908990899089906004016154db565b600781036116a2575f808061160d85870187615500565b92509250925061161d838361336c565b915061162881613327565b604051635d043b2960e11b8152600481018490526001600160a01b0380831660248301523060448301529192509084169063ba087652906064016020604051808303815f875af115801561167e573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061127191906152dc565b60088114806116b15750600981145b15611917575f8080806116c686880188615496565b93509350935093506116d782613327565b91506116e3848461336c565b92505f846001600160a01b031663204f83f96040518163ffffffff1660e01b8152600401602060405180830381865afa158015611722573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061174691906152dc565b42106117525783611823565b61182384866001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015611792573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906117b6919061547b565b6040516370a0823160e01b81523060048201526001600160a01b0391909116906370a0823190602401602060405180830381865afa1580156117fa573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061181e91906152dc565b6134ac565b9050600886036118a557604051639f40a7b360e01b81526001600160a01b03861690639f40a7b39061185f9084908790309088906004016154db565b6020604051808303815f875af115801561187b573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061189f91906152dc565b5061108d565b6040516385326f4560e01b81526001600160a01b038616906385326f45906118d79084908790309088906004016154db565b6020604051808303815f875af11580156118f3573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610c8391906152dc565b600a8103611a8c575f80808061192f868801886155b3565b60405163f5e306f760e01b81526001600160a01b03858116600483015294985092965090945092507f00000000000000000000000000000000000000000000000000000000000000009091169063f5e306f790602401602060405180830381865afa1580156119a0573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906119c4919061559a565b6119ec5760405163e8c4926760e01b81526001600160a01b03851660048201526024016106e0565b600180546001600160a01b0319166001600160a01b038616908117909155604051632e7ff4ef60e11b8152635cffe9de90611a3190309087908790879060040161561a565b6020604051808303815f875af1158015611a4d573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611a71919061559a565b5050600180546001600160a01b031916905550610a76915050565b600b811480611a9b5750601681145b80611aa65750601a81145b15611deb575f80808080611abc87890189615534565b94509450945094509450611acf83613327565b9250611ada82613327565b60405163c661065760e01b81525f600482018190529193506001600160a01b0387169063c661065790602401602060405180830381865afa158015611b21573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611b45919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0388169063c661065790602401602060405180830381865afa158015611b8d573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611bb1919061547b565b9050611bbd828761336c565b60405163fbfc779760e01b8152600481018290526001600160a01b03808a166024830152831660448201529096505f907327857f8e0eee20596e7ce5be3901efd663e91e109063fbfc779790606401602060405180830381865af4158015611c27573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611c4b91906152dc565b90508015611d995760405163f5e306f760e01b81526001600160a01b0383811660048301525f917f00000000000000000000000000000000000000000000000000000000000000009091169063f5e306f790602401602060405180830381865afa158015611cbb573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611cdf919061559a565b90508015611cf757611cf284848461341c565b611d0b565b611d0b6001600160a01b03851684846109b9565b604051631520940360e11b81526001600160a01b03841690632a41280690611d3d9085908b908b908b906004016154db565b6020604051808303815f875af1158015611d59573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611d7d91906152dc565b5080611d9757611d976001600160a01b038516845f6109b9565b505b6001600160a01b0386163014801590611dba5750611db781886152f3565b15155b15611dde57611dde86611dcd838a6152f3565b6001600160a01b03861691906133eb565b5050505050505050610a76565b601f811480611dfa5750602081145b80611e055750602181145b1561213c575f8080808080611e1c888a018a61564c565b955095509550955095509550611e3183613327565b9250611e3c82613327565b60405163c661065760e01b81525f600482018190529193506001600160a01b0388169063c661065790602401602060405180830381865afa158015611e83573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611ea7919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0389169063c661065790602401602060405180830381865afa158015611eef573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611f13919061547b565b9050611f1f828861336c565b60405163013b28a760e51b815260048101829052602481018890526001600160a01b03831660448201529097505f907327857f8e0eee20596e7ce5be3901efd663e91e109063276514e090606401602060405180830381865af4158015611f88573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611fac91906152dc565b905080156120fa5760405163f5e306f760e01b81526001600160a01b0383811660048301525f917f00000000000000000000000000000000000000000000000000000000000000009091169063f5e306f790602401602060405180830381865afa15801561201c573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612040919061559a565b905080156120585761205384848461341c565b61206c565b61206c6001600160a01b03851684846109b9565b604051631520940360e11b81526001600160a01b03841690632a4128069061209e9085908b908b908b906004016154db565b6020604051808303815f875af11580156120ba573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906120de91906152dc565b50806120f8576120f86001600160a01b038516845f6109b9565b505b6001600160a01b038616301480159061211b575061211881896152f3565b15155b1561212e5761212e86611dcd838b6152f3565b505050505050505050610a76565b600c81148061214b5750601781145b156123b9575f8080806121608688018861571b565b935093509350935061217181613327565b60405163c661065760e01b81525f600482018190529192506001600160a01b0386169063c661065790602401602060405180830381865afa1580156121b8573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906121dc919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0387169063c661065790602401602060405180830381865afa158015612224573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612248919061547b565b905061225b82865f5b602002015161336c565b855261226981866001612251565b60208601528451612286906001600160a01b0384169088906109b9565b60208501516122a1906001600160a01b0383169088906109b9565b600c871461231e5760405163030f92d560e21b81526001600160a01b03871690630c3e4b54906122d99088908890889060040161578c565b6020604051808303815f875af11580156122f5573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061231991906152dc565b612390565b604051637328333b60e01b81526001600160a01b03871690637328333b9061235090889088905f9089906004016157b9565b6020604051808303815f875af115801561236c573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061239091906152dc565b506123a56001600160a01b038316875f6109b9565b610c836001600160a01b038216875f6109b9565b600d8114806123c85750601881145b15612532575f8080806123dd868801886157eb565b93509350935093506123ee81613327565b90505f600d86146123ff578461245f565b846001600160a01b031663fc0c546a6040518163ffffffff1660e01b8152600401602060405180830381865afa15801561243b573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061245f919061547b565b905061246b818561336c565b9350600d86146124d757604051633eb1719f60e01b81526001600160a01b03861690633eb1719f906124a59087908790879060040161582f565b5f604051808303815f87803b1580156124bc575f80fd5b505af11580156124ce573d5f803e3d5ffd5b5050505061108d565b604051630c04742560e11b81526001600160a01b03861690631808e84a9061250990879087905f90889060040161585c565b5f604051808303815f87803b158015612520575f80fd5b505af115801561212e573d5f803e3d5ffd5b60198114806125415750600e81145b156126dd575f8080808061255787890189615890565b9450945094509450945061256a81613327565b90505f600e871461257b57856125db565b856001600160a01b031663fc0c546a6040518163ffffffff1660e01b8152600401602060405180830381865afa1580156125b7573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906125db919061547b565b90506125e7818661336c565b9450600e8714612661576040516307de773760e11b81526004810186905260248101859052604481018490526001600160a01b038381166064830152871690630fbcee6e906084015f604051808303815f87803b158015612646575f80fd5b505af1158015612658573d5f803e3d5ffd5b50505050610c83565b6040516307329bcd60e01b81526004810186905260248101859052604481018490525f60648201526001600160a01b0383811660848301528716906307329bcd9060a4015f604051808303815f87803b1580156126bc575f80fd5b505af11580156126ce573d5f803e3d5ffd5b50505050505050505050610a76565b601281036128fa576003546001600160a01b031661270e576040516327a8fdaf60e11b815260040160405180910390fd5b5f80808061271e868801886158e2565b94505093509350935073eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee6001600160a01b0316826001600160a01b03160361276d57604051630c59659760e31b815260040160405180910390fd5b73eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeed196001600160a01b0385160161283c5782600454146127b457604051634ff64a9f60e01b815260040160405180910390fd5b6003546004546040515f926001600160a01b031691906127d5908590615952565b5f6040518083038185875af1925050503d805f811461280f576040519150601f19603f3d011682016040523d82523d5f602084013e612814565b606091505b505090508061283657604051633204506f60e01b815260040160405180910390fd5b50611271565b612846848461336c565b600354909350612863906001600160a01b038681169116856109b9565b6003546040515f916001600160a01b031690612880908490615952565b5f604051808303815f865af19150503d805f81146128b9576040519150601f19603f3d011682016040523d82523d5f602084013e6128be565b606091505b50509050806128e057604051633204506f60e01b815260040160405180910390fd5b60035461108d906001600160a01b0387811691165f6109b9565b600f81036129d1575f8080612911858701876153e3565b92509250925061292082613327565b6040516370a0823160e01b81526001600160a01b0380831660048301529193505f918516906370a0823190602401602060405180830381865afa158015612969573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061298d91906152dc565b9050818110156112715760405163b250459b60e01b81526001600160a01b0380861660048301528416602482015260448101839052606481018290526084016106e0565b601b8103612be9575f8080806129e9868801886159d0565b93509350935093506129fa81613327565b60405163c661065760e01b81525f600482018190529192506001600160a01b0386169063c661065790602401602060405180830381865afa158015612a41573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612a65919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0387169063c661065790602401602060405180830381865afa158015612aad573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612ad1919061547b565b9050612af682865f81518110612ae957612ae9615306565b602002602001015161336c565b855f81518110612b0857612b08615306565b602002602001018181525050612b2b8186600181518110612ae957612ae9615306565b85600181518110612b3e57612b3e615306565b602002602001018181525050612b8186865f81518110612b6057612b60615306565b6020026020010151846001600160a01b03166109b99092919063ffffffff16565b612bb98686600181518110612b9857612b98615306565b6020026020010151836001600160a01b03166109b99092919063ffffffff16565b60405163a7256d0960e01b81526001600160a01b0387169063a7256d099061235090889088908890600401615a65565b601c8103612c93575f808080612c0186880188615a97565b9350935093509350612c1281613327565b9050612c1e848461336c565b604051632f30266960e11b81529093506001600160a01b03851690635e604cd290612c5190869086908690600401615af3565b5f604051808303815f875af1158015612c6c573d5f803e3d5ffd5b505050506040513d5f823e601f3d908101601f1916820160405261108d9190810190615b23565b601d8103612d15575f80808080612cac87890189615bae565b94509450945094509450612cbf81613327565b9050612ccb858561336c565b60405163081579a560e01b815260048101829052600f85900b6024820152604481018490526001600160a01b0383811660648301529195509086169063081579a5906084016118d7565b60228103612d7a575f80612d2b8486018661535c565b91509150816001600160a01b031663d0e30db0826040518263ffffffff1660e01b81526004015f604051808303818588803b158015612d68575f80fd5b505af1158015610f47573d5f803e3d5ffd5b60238103612de6575f80612d908486018661535c565b604051632e1a7d4d60e01b81526004810182905291935091506001600160a01b03831690632e1a7d4d906024015f604051808303815f87803b158015612dd4575f80fd5b505af1158015610c83573d5f803e3d5ffd5b60248103612e70575f80612dfc8486018661535c565b915091505f826001600160a01b0316826040515f6040518083038185875af1925050503d805f8114612e49576040519150601f19603f3d011682016040523d82523d5f602084013e612e4e565b606091505b5050905080610cdc57604051633204506f60e01b815260040160405180910390fd5b604051636bb50f4f60e11b8152600481018290526024016106e0565b5f612e95610ab5565b84838114612eb9576040516001621398b960e31b0319815260040160405180910390fd5b60408051601e8082526103e082019092525f91816020015b604080518082019091525f8082526020820152815260200190600190039081612ed1579050509050676765c793fa10079d601b1b5f5b83811015612fa3575f8a8a83818110612f2257612f22615306565b9050013560f81c60f81b9050365f8a8a85818110612f4257612f42615306565b9050602002810190612f54919061531a565b915091505f612f668484848d8b6134c1565b9050676765c793fa10079d601b1b8114612f9357612f908682676765c793fa10079d601b1b614782565b95505b505060019092019150612f079050565b5098975050505050505050565b5f80516020615e3183398151915280546001600160a01b0383166001600160a01b03199091168117825560408051918252517f2f658b440c35314f52658ea8a740e05b284cdc84dc9ae01e891f21b8933e7cad9181900360200190a15050565b5f80516020615e318339815191525f8061304861302b610875565b873061303a60045f8a8c615c01565b61304391615c28565b614841565b91509150816106535763ffffffff8116156130e357825460ff60a01b1916600160a01b178355613076610875565b6001600160a01b03166394c7d7ee8787876040518463ffffffff1660e01b81526004016130a593929190615c58565b5f604051808303815f87803b1580156130bc575f80fd5b505af11580156130ce573d5f803e3d5ffd5b5050845460ff60a01b19168555506106539050565b60405162d1953b60e31b81526001600160a01b03871660048201526024016106e0565b61310e610ab5565b5f80516020615e51833981519152805460ff191660011781557f62e78cea01bee320cd4e420270b5ea74000d11b0c9f74754ebdbfc544b05a258335b6040516001600160a01b03909116815260200160405180910390a150565b613170614949565b6001600160a01b03821661319757604051630c59659760e31b815260040160405180910390fd5b600280546001600160a01b039384166001600160a01b03199182161790915560038054929093169116179055565b6131cd614949565b6131d681614992565b50565b6131e16149a3565b5f80516020615e51833981519152805460ff191681557f5db9ee0a495bf2e6ff9c91a7834c1ba4fdd244a5e8aa4e537bd38aeae4b073aa3361314a565b5f805f846001600160a01b0316846040516132399190615952565b5f604051808303815f865af19150503d805f8114613272576040519150601f19603f3d011682016040523d82523d5f602084013e613277565b606091505b50915091508180156132a15750805115806132a15750808060200190518101906132a1919061559a565b80156132b657505f856001600160a01b03163b115b925050505b92915050565b5f6132d56001600160a01b038416836149d2565b905080515f141580156132f95750808060200190518101906132f7919061559a565b155b1561332257604051635274afe760e01b81526001600160a01b03841660048201526024016106e0565b505050565b5f60df196001600160a01b03831601613341575030919050565b60bf196001600160a01b038316016133635750505f546001600160a01b031690565b5090565b919050565b5f600160ff1b821461337e57816133e4565b6040516370a0823160e01b81523060048201526001600160a01b038416906370a0823190602401602060405180830381865afa1580156133c0573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906133e491906152dc565b9392505050565b6040516001600160a01b0383811660248301526044820183905261332291859182169063a9059cbb90606401610a3a565b604051636eb1769f60e11b81523060048201526001600160a01b0383811660248301525f919085169063dd62ed3e90604401602060405180830381865afa158015613469573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061348d91906152dc565b905081811015610a7657610a766001600160a01b038516845f196109b9565b5f8183106134ba57816133e4565b5090919050565b5f60f886901c603f168015806134d75750600181145b156135165783613502575f806134ef8789018961535c565b915091506134fe8183876149df565b5050505b676765c793fa10079d601b1b915050610697565b600281036135765783613502575f8080613532888a018a6153e3565b92509250925061354182613327565b91506001600160a01b03821630146134fe5761355e818488614b43565b50505050676765c793fa10079d601b1b915050610697565b60038114806135855750601581145b806135905750601e81145b1561390c575f808080806135a68a8c018c615421565b95505094509450945094505f89156136de575f60038814806135c85750601588145b61364f5760025460405163028c676d60e31b81526001600160a01b038981166004830152600f89810b602484015288900b6044830152909116906314633b6890606401602060405180830381865afa158015613626573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061364a91906152dc565b6136c9565b60025460405163044e3c3f60e31b81526001600160a01b038981166004830152602482018990526044820188905290911690632271e1f890606401602060405180830381865afa1580156136a5573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906136c991906152dc565b90506136d6816012614cc0565b9150506138fe565b60405163c661065760e01b8152600481018690526137519084906001600160a01b0389169063c661065790602401602060405180830381865afa158015613727573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061374b919061547b565b8b614b43565b92505f601e88036137dc57604051635e0d443f60e01b8152600f87810b600483015286900b6024820152604481018590526001600160a01b03881690635e0d443f90606401602060405180830381865afa1580156137b1573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906137d591906152dc565b9050613854565b60405163556d6e9f60e01b81526004810187905260248101869052604481018590526001600160a01b0388169063556d6e9f90606401602060405180830381865afa15801561382d573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061385191906152dc565b90505b61385d83613327565b9250306001600160a01b038416036138e45760405163c661065760e01b8152600481018690526138e29082906001600160a01b038a169063c661065790602401602060405180830381865afa1580156138b8573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906138dc919061547b565b8c6149df565b505b6138fa81676765c793fa10079d601b1b86614782565b9150505b965061069795505050505050565b60108103613aca575f8080613923888a018a615500565b9250925092505f836001600160a01b031663732e86fe6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613966573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061398a919061547b565b90508715613a0557600254604051635fa5a49760e01b81526001600160a01b03838116600483015290911690635fa5a49790602401602060405180830381865afa1580156139da573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906139fe91906152dc565b9250613a13565b613a10838289614b43565b92505b60405163404b9d8160e01b8152600481018490525f906001600160a01b0386169063404b9d81906024015b602060405180830381865afa158015613a59573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613a7d91906152dc565b9050613a8883613327565b9250306001600160a01b03841603613aa757613aa581868a6149df565b505b613abd81676765c793fa10079d601b1b86614782565b9650505050505050610697565b60118103613c82575f8080613ae1888a018a615500565b9250925092508615613b6057600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa158015613b35573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613b5991906152dc565b9150613b6e565b613b6b828488614b43565b91505b60405163554d83a760e11b8152600481018390525f906001600160a01b0385169063aa9b074e90602401602060405180830381865afa158015613bb3573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613bd791906152dc565b9050613be282613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b031663732e86fe6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613c58919061547b565b896149df565b505b613c7681676765c793fa10079d601b1b85614782565b95505050505050610697565b60048103613db8575f8080613c99888a018a615500565b9250925092505f836001600160a01b03166338d52e0f6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613cdc573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613d00919061547b565b90508715613d7b57600254604051635fa5a49760e01b81526001600160a01b03838116600483015290911690635fa5a49790602401602060405180830381865afa158015613d50573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613d7491906152dc565b9250613d89565b613d86838289614b43565b92505b60405163ef8b30f760e01b8152600481018490525f906001600160a01b0386169063ef8b30f790602401613a3e565b60058103613fd7575f808080613dd0898b018b615c97565b93509350935093508715613e5157600254604051633e3f205760e21b81526001600160a01b0386811660048301529091169063f8fc815c90602401602060405180830381865afa158015613e26573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613e4a91906152dc565b9250613ebe565b613ebb83856001600160a01b0316636f307dc36040518163ffffffff1660e01b8152600401602060405180830381865afa158015613e91573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613eb5919061547b565b89614b43565b92505b60405163ef8b30f760e01b8152600481018490525f906001600160a01b0386169063ef8b30f7906024015b602060405180830381865afa158015613f04573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613f2891906152dc565b9050613f3383613327565b9250306001600160a01b03841603613f5257613f5081868a6149df565b505b613f5b82613327565b9150306001600160a01b03831603613aa757613aa581866001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613fad573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613fd1919061547b565b8a6149df565b600681036140e2575f808080613fef898b018b615c97565b9350935093509350871561407057600254604051635fa5a49760e01b81526001600160a01b03868116600483015290911690635fa5a49790602401602060405180830381865afa158015614045573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061406991906152dc565b92506140b3565b6140b083856001600160a01b031663c644fe946040518163ffffffff1660e01b8152600401602060405180830381865afa158015613e91573d5f803e3d5ffd5b92505b6040516302f6fa9560e11b8152600481018490525f906001600160a01b038616906305edf52a90602401613ee9565b6007810361424c575f80806140f9888a018a615500565b925092509250861561417857600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa15801561414d573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061417191906152dc565b9150614186565b614183828488614b43565b91505b60405163266d6a8360e11b8152600481018390525f906001600160a01b03851690634cdad50690602401602060405180830381865afa1580156141cb573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906141ef91906152dc565b90506141fa82613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b03166338d52e0f6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b60088103614488575f8080614263888a018a615500565b92509250925086156142e257600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa1580156142b7573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906142db91906152dc565b91506143c2565b6142ed828488614b43565b9150826001600160a01b031663204f83f96040518163ffffffff1660e01b8152600401602060405180830381865afa15801561432b573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061434f91906152dc565b4210156143c2576143c082846001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015614396573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906143ba919061547b565b88614b43565b505b60405163266d6a8360e11b8152600481018390525f906001600160a01b03851690634cdad50690602401602060405180830381865afa158015614407573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061442b91906152dc565b905061443682613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b0316636f307dc36040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b6009810361469a575f808061449f888a018a615500565b925092509250861561451e57600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa1580156144f3573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061451791906152dc565b91506145d4565b614529828488614b43565b9150826001600160a01b031663204f83f96040518163ffffffff1660e01b8152600401602060405180830381865afa158015614567573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061458b91906152dc565b4210156145d4576145d282846001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015614396573d5f803e3d5ffd5b505b604051633460fbfb60e11b8152600481018390525f906001600160a01b038516906368c1f7f690602401602060405180830381865afa158015614619573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061463d91906152dc565b905061464882613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b031663c644fe946040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b60128103614766576003546001600160a01b03166146cb576040516327a8fdaf60e11b815260040160405180910390fd5b5f8080806146db898b018b615496565b935093509350935073eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee6001600160a01b0316826001600160a01b03160361472957604051630c59659760e31b815260040160405180910390fd5b6001600160a01b03841673eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee1461475b57614758838589614b43565b92505b613c5e8183896149df565b600f8103612e7057676765c793fa10079d601b1b915050610697565b5f838302815f1985870982811083820303915050805f036147b6578382816147ac576147ac615cdc565b04925050506133e4565b8084116147d65760405163227bc15360e01b815260040160405180910390fd5b5f848688095f868103871696879004966002600389028118808a02820302808a02820302808a02820302808a02820302808a02820302808a02909103029181900381900460010186841190950394909402919094039290920491909117919091029150509392505050565b6040516001600160a01b03848116602483015283811660448301526001600160e01b0319831660648301525f9182918291829189169060840160408051601f198184030181529181526020820180516001600160e01b031663b700961360e01b179052516148af9190615952565b5f60405180830381855afa9150503d805f81146148e7576040519150601f19603f3d011682016040523d82523d5f602084013e6148ec565b606091505b5091509150811561493e57604081511061491e57808060200190518101906149149190615cf0565b909450925061493e565b602081511061493e578080602001905181019061493b919061559a565b93505b505094509492505050565b7ff0c57e16840df040f15088dc2f81fe391c3923bec73e23a9662efc9c229c6a0054600160401b900460ff1661073f57604051631afcd79f60e31b815260040160405180910390fd5b61499a614949565b6131d681612fb0565b5f80516020615e518339815191525460ff1661073f57604051638dfc202b60e01b815260040160405180910390fd5b60606133e483835f614cf3565b5f6001600160a01b038316614a0757604051630c59659760e31b815260040160405180910390fd5b81515f5b81811015614b29575f6001600160a01b0316848281518110614a2f57614a2f615306565b60200260200101515f01516001600160a01b031603614a8d576040518060400160405280866001600160a01b0316815260200187815250848281518110614a7857614a78615306565b602002602001018190525085925050506133e4565b846001600160a01b0316848281518110614aa957614aa9615306565b60200260200101515f01516001600160a01b031603614b195785848281518110614ad557614ad5615306565b6020026020010151602001818151614aed91906152c9565b9052508351849082908110614b0457614b04615306565b602002602001015160200151925050506133e4565b614b2281615d2d565b9050614a0b565b50604051638b48412160e01b815260040160405180910390fd5b5f6001600160a01b038316614b6b57604051630c59659760e31b815260040160405180910390fd5b81515f5b81811015614ca6575f6001600160a01b0316848281518110614b9357614b93615306565b60200260200101515f01516001600160a01b03160315614ca657846001600160a01b0316848281518110614bc957614bc9615306565b60200260200101515f01516001600160a01b031603614c9657600160ff1b8603614c39575f848281518110614c0057614c00615306565b60200260200101516020015190505f858381518110614c2157614c21615306565b602090810291909101810151015292506133e4915050565b85848281518110614c4c57614c4c615306565b60200260200101516020015110614ca65785848281518110614c7057614c70615306565b6020026020010151602001818151614c8891906152f3565b9052508592506133e4915050565b614c9f81615d2d565b9050614b6f565b506040516305e72d3960e11b815260040160405180910390fd5b5f80614ccd83601b6152f3565b614cd890600a615e25565b905080840291508381830414614cec575f80fd5b5092915050565b606081471015614d185760405163cd78605960e01b81523060048201526024016106e0565b5f80856001600160a01b03168486604051614d339190615952565b5f6040518083038185875af1925050503d805f8114614d6d576040519150601f19603f3d011682016040523d82523d5f602084013e614d72565b606091505b5091509150614d82868383614d8c565b9695505050505050565b606082614da157614d9c82614de8565b6133e4565b8151158015614db857506001600160a01b0384163b155b15614de157604051639996b31560e01b81526001600160a01b03851660048201526024016106e0565b50806133e4565b805115614df85780518082602001fd5b604051630a12f52160e11b815260040160405180910390fd5b6001600160a01b03811681146131d6575f80fd5b5f8083601f840112614e35575f80fd5b5081356001600160401b03811115614e4b575f80fd5b602083019150836020828501011115614e62575f80fd5b9250929050565b5f805f805f8060a08789031215614e7e575f80fd5b8635614e8981614e11565b95506020870135614e9981614e11565b9450604087013593506060870135925060808701356001600160401b03811115614ec1575f80fd5b614ecd89828a01614e25565b979a9699509497509295939492505050565b5f8083601f840112614eef575f80fd5b5081356001600160401b03811115614f05575f80fd5b6020830191508360208260051b8501011115614e62575f80fd5b5f805f8060408587031215614f32575f80fd5b84356001600160401b0380821115614f48575f80fd5b614f5488838901614e25565b90965094506020870135915080821115614f6c575f80fd5b50614f7987828801614edf565b95989497509550505050565b5f805f805f60608688031215614f99575f80fd5b85356001600160401b0380821115614faf575f80fd5b614fbb89838a01614e25565b90975095506020880135915080821115614fd3575f80fd5b50614fe088828901614edf565b96999598509660400135949350505050565b5f60208284031215615002575f80fd5b81356133e481614e11565b5f805f6060848603121561501f575f80fd5b833561502a81614e11565b9250602084013561503a81614e11565b9150604084013561504a81614e11565b809150509250925092565b634e487b7160e01b5f52604160045260245ffd5b604051601f8201601f191681016001600160401b038111828210171561509157615091615055565b604052919050565b5f82601f8301126150a8575f80fd5b81356001600160401b038111156150c1576150c1615055565b6150d4601f8201601f1916602001615069565b8181528460208386010111156150e8575f80fd5b816020850160208301375f918101602001919091529392505050565b5f6001600160401b0382111561511c5761511c615055565b5060051b60200190565b5f8060408385031215615137575f80fd5b82356001600160401b038082111561514d575f80fd5b61515986838701615099565b935060209150818501358181111561516f575f80fd5b8501601f8101871361517f575f80fd5b803561519261518d82615104565b615069565b81815260059190911b820184019084810190898311156151b0575f80fd5b8584015b838110156151e7578035868111156151cb575f8081fd5b6151d98c8983890101615099565b8452509186019186016151b4565b508096505050505050509250929050565b5f5b838110156152125781810151838201526020016151fa565b50505f910152565b5f81518084526152318160208601602086016151f8565b601f01601f19169290920160200192915050565b604081525f615257604083018561521a565b6020838203818501528185518084528284019150828160051b8501018388015f5b838110156152a657601f1987840301855261529483835161521a565b94860194925090850190600101615278565b50909998505050505050505050565b634e487b7160e01b5f52601160045260245ffd5b808201808211156132bb576132bb6152b5565b5f602082840312156152ec575f80fd5b5051919050565b818103818111156132bb576132bb6152b5565b634e487b7160e01b5f52603260045260245ffd5b5f808335601e1984360301811261532f575f80fd5b8301803591506001600160401b03821115615348575f80fd5b602001915036819003821315614e62575f80fd5b5f806040838503121561536d575f80fd5b823561537881614e11565b946020939093013593505050565b5f805f805f8060c0878903121561539b575f80fd5b86356153a681614e11565b95506020870135945060408701359350606087013560ff811681146153c9575f80fd5b9598949750929560808101359460a0909101359350915050565b5f805f606084860312156153f5575f80fd5b833561540081614e11565b9250602084013561541081614e11565b929592945050506040919091013590565b5f805f805f8060c08789031215615436575f80fd5b863561544181614e11565b95506020870135945060408701359350606087013592506080870135915060a087013561546d81614e11565b809150509295509295509295565b5f6020828403121561548b575f80fd5b81516133e481614e11565b5f805f80608085870312156154a9575f80fd5b84356154b481614e11565b93506020850135925060408501356154cb81614e11565b9396929550929360600135925050565b9384526001600160a01b03928316602085015291166040830152606082015260800190565b5f805f60608486031215615512575f80fd5b833561551d81614e11565b925060208401359150604084013561504a81614e11565b5f805f805f60a08688031215615548575f80fd5b853561555381614e11565b945060208601359350604086013561556a81614e11565b9250606086013561557a81614e11565b949793965091946080013592915050565b80518015158114613367575f80fd5b5f602082840312156155aa575f80fd5b6133e48261558b565b5f805f80608085870312156155c6575f80fd5b84356155d181614e11565b935060208501356155e181614e11565b92506040850135915060608501356001600160401b03811115615602575f80fd5b61560e87828801615099565b91505092959194509250565b6001600160a01b03858116825284166020820152604081018390526080606082018190525f90614d829083018461521a565b5f805f805f8060c08789031215615661575f80fd5b863561566c81614e11565b95506020870135945060408701359350606087013561568a81614e11565b9250608087013561569a81614e11565b8092505060a087013590509295509295509295565b5f82601f8301126156be575f80fd5b604051604081018181106001600160401b03821117156156e0576156e0615055565b80604052508060408401858111156156f6575f80fd5b845b818110156157105780358352602092830192016156f8565b509195945050505050565b5f805f8060a0858703121561572e575f80fd5b843561573981614e11565b935061574886602087016156af565b925060608501359150608085013561575f81614e11565b939692955090935050565b805f5b6002811015610a7657815184526020938401939091019060010161576d565b6080810161579a828661576a565b60408201939093526001600160a01b0391909116606090910152919050565b60a081016157c7828761576a565b604082019490945291151560608301526001600160a01b0316608090910152919050565b5f805f8060a085870312156157fe575f80fd5b843561580981614e11565b93506020850135925061581f86604087016156af565b9150608085013561575f81614e11565b83815260808101615843602083018561576a565b6001600160a01b03929092166060919091015292915050565b84815260a08101615870602083018661576a565b92151560608201526001600160a01b039190911660809091015292915050565b5f805f805f60a086880312156158a4575f80fd5b85356158af81614e11565b945060208601359350604086013592506060860135915060808601356158d481614e11565b809150509295509295909350565b5f805f805f60a086880312156158f6575f80fd5b853561590181614e11565b945060208601359350604086013561591881614e11565b92506060860135915060808601356001600160401b03811115615939575f80fd5b61594588828901615099565b9150509295509295909350565b5f82516159638184602087016151f8565b9190910192915050565b5f82601f83011261597c575f80fd5b8135602061598c61518d83615104565b82815260059290921b840181019181810190868411156159aa575f80fd5b8286015b848110156159c557803583529183019183016159ae565b509695505050505050565b5f805f80608085870312156159e3575f80fd5b84356159ee81614e11565b935060208501356001600160401b03811115615a08575f80fd5b615a148782880161596d565b93505060408501359150606085013561575f81614e11565b5f8151808452602080850194508084015f5b83811015615a5a57815187529582019590820190600101615a3e565b509495945050505050565b606081525f615a776060830186615a2c565b6020830194909452506001600160a01b0391909116604090910152919050565b5f805f8060808587031215615aaa575f80fd5b8435615ab581614e11565b93506020850135925060408501356001600160401b03811115615ad6575f80fd5b615ae28782880161596d565b925050606085013561575f81614e11565b838152606060208201525f615b0b6060830185615a2c565b905060018060a01b0383166040830152949350505050565b5f6020808385031215615b34575f80fd5b82516001600160401b03811115615b49575f80fd5b8301601f81018513615b59575f80fd5b8051615b6761518d82615104565b81815260059190911b82018301908381019087831115615b85575f80fd5b928401925b82841015615ba357835182529284019290840190615b8a565b979650505050505050565b5f805f805f60a08688031215615bc2575f80fd5b8535615bcd81614e11565b9450602086013593506040860135600f81900b8114615bea575f80fd5b92506060860135915060808601356158d481614e11565b5f8085851115615c0f575f80fd5b83861115615c1b575f80fd5b5050820193919092039150565b6001600160e01b03198135818116916004851015615c505780818660040360031b1b83161692505b505092915050565b6001600160a01b03841681526040602082018190528101829052818360608301375f818301606090810191909152601f909201601f1916010192915050565b5f805f8060808587031215615caa575f80fd5b8435615cb581614e11565b9350602085013592506040850135615ccc81614e11565b9150606085013561575f81614e11565b634e487b7160e01b5f52601260045260245ffd5b5f8060408385031215615d01575f80fd5b615d0a8361558b565b9150602083015163ffffffff81168114615d22575f80fd5b809150509250929050565b5f60018201615d3e57615d3e6152b5565b5060010190565b600181815b80851115615d7f57815f1904821115615d6557615d656152b5565b80851615615d7257918102915b93841c9390800290615d4a565b509250929050565b5f82615d95575060016132bb565b81615da157505f6132bb565b8160018114615db75760028114615dc157615ddd565b60019150506132bb565b60ff841115615dd257615dd26152b5565b50506001821b6132bb565b5060208310610133831016604e8410600b8410161715615e00575081810a6132bb565b615e0a8383615d45565b805f1904821115615e1d57615e1d6152b5565b029392505050565b5f6133e48383615d8756fef3177357ab46d8af007ab3fdb9af81da189e1068fefdc0073dca88a2cab40a00cd5ed15c6e187e77e9aee88184c21f4f2182ab5827cb3b7e07fbedcd63f03300a264697066735822122057591e54a916f3b9443c691928a96f6d9c4d16f411ae8a4a77f39bb28fbcef9864736f6c6343000814003300000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b7

Deployed Bytecode

0x6080604052600436106100fd575f3560e01c80637a9e5e4b116100925780638fb36037116100625780638fb36037146102a0578063b748f092146102cd578063bf7e214f146102ec578063c0c53b8b14610300578063f7b188a51461031f575f80fd5b80637a9e5e4b1461022f5780638456cb591461024e5780638b0c9584146102625780638b33203c14610281575f80fd5b80635ab1bd53116100cd5780635ab1bd53146101935780635c975abb146101c557806361fbaaaa146101f357806369dfa6c214610210575f80fd5b806323e30c8b1461010857806324856bc31461013a5780633593564c1461014f578063466489fb14610162575f80fd5b3661010457005b5f80fd5b348015610113575f80fd5b50610127610122366004614e69565b610333565b6040519081526020015b60405180910390f35b61014d610148366004614f1f565b610557565b005b61014d61015d366004614f85565b61065b565b34801561016d575f80fd5b506002546001600160a01b03165b6040516001600160a01b039091168152602001610131565b34801561019e575f80fd5b507f00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b761017b565b3480156101d0575f80fd5b505f80516020615e518339815191525460ff166040519015158152602001610131565b3480156101fe575f80fd5b506003546001600160a01b031661017b565b34801561021b575f80fd5b5061012761022a366004614f1f565b610689565b34801561023a575f80fd5b5061014d610249366004614ff2565b6106a0565b348015610259575f80fd5b5061014d61072b565b34801561026d575f80fd5b5061014d61027c366004614ff2565b610741565b34801561028c575f80fd5b5061014d61029b366004614ff2565b6107cc565b3480156102ab575f80fd5b506102b4610830565b6040516001600160e01b03199091168152602001610131565b3480156102d8575f80fd5b506101276102e7366004614f1f565b610866565b3480156102f7575f80fd5b5061017b610875565b34801561030b575f80fd5b5061014d61031a36600461500d565b610890565b34801561032a575f80fd5b5061014d6109a8565b5f80546001600160a01b031661035c57604051630606fd0760e51b815260040160405180910390fd5b6001546001600160a01b031633146103875760405163242762f960e01b815260040160405180910390fd5b5f8061039584860186615126565b6040516324856bc360e01b8152919350915030906324856bc3906103bf9085908590600401615245565b5f604051808303815f87803b1580156103d6575f80fd5b505af11580156103e8573d5f803e3d5ffd5b505050505f86886103f991906152c9565b604051636eb1769f60e11b81523060048201523360248201529091505f906001600160a01b038b169063dd62ed3e90604401602060405180830381865afa158015610446573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061046a91906152dc565b905081811015610488576104886001600160a01b038b1633846109b9565b6040516370a0823160e01b81523060048201525f906001600160a01b038c16906370a0823190602401602060405180830381865afa1580156104cc573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906104f091906152dc565b905082811015610526575f54610526906001600160a01b03163061051484876152f3565b6001600160a01b038f16929190610a7c565b507f439148f0bbc682ca079e46d6e2c2f0c1e3b820f1a291b069d8882abf8cf18dd99b9a5050505050505050505050565b61055f610ab5565b82818114610583576040516001621398b960e31b0319815260040160405180910390fd5b5f80546001600160a01b03166105b057505f80546001600160a01b031916331790553460045560016105d0565b3330146105d05760405163f9ce257360e01b815260040160405180910390fd5b5f5b82811015610639575f8787838181106105ed576105ed615306565b9050013560f81c60f81b9050365f87878581811061060d5761060d615306565b905060200281019061061f919061531a565b9150915061062e838383610ae5565b5050506001016105d2565b508015610653575f80546001600160a01b03191681556004555b505050505050565b808042111561067d57604051632dfb7c8b60e11b815260040160405180910390fd5b61065386868686610557565b5f610697858585855f612e8c565b95945050505050565b336106a9610875565b6001600160a01b0316816001600160a01b0316146106e95760405162d1953b60e31b81526001600160a01b03821660048201526024015b60405180910390fd5b816001600160a01b03163b5f0361071e576040516361798f2f60e11b81526001600160a01b03831660048201526024016106e0565b61072782612fb0565b5050565b610737335b5f36613010565b61073f613106565b565b61074a33610730565b6001600160a01b03811661077157604051630c59659760e31b815260040160405180910390fd5b6002546040516001600160a01b038084169216907fbacf07ffb3274576773b014d636ae5319ff022a18a5b0f958eaac799cf68439b905f90a3600280546001600160a01b0319166001600160a01b0392909216919091179055565b6107d533610730565b6003546040516001600160a01b038084169216907f775376a8cc8424fc322e2ac2b50230180c9622951b05587f5ab18ff432a03d49905f90a3600380546001600160a01b0319166001600160a01b0392909216919091179055565b5f80516020615e3183398151915280545f9190600160a01b900460ff16610857575f610860565b638fb3603760e01b5b91505090565b5f610697858585856001612e8c565b5f80516020615e31833981519152546001600160a01b031690565b7ff0c57e16840df040f15088dc2f81fe391c3923bec73e23a9662efc9c229c6a008054600160401b810460ff1615906001600160401b03165f811580156108d45750825b90505f826001600160401b031660011480156108ef5750303b155b9050811580156108fd575080155b1561091b5760405163f92ee8a960e01b815260040160405180910390fd5b845467ffffffffffffffff19166001178555831561094557845460ff60401b1916600160401b1785555b61094f8888613168565b610958866131c5565b831561099e57845460ff60401b19168555604051600181527fc7f505b2f371ae2175ee4913f4499e1f2633a7b5936321eed1cdaeb6115181d29060200160405180910390a15b5050505050505050565b6109b133610730565b61073f6131d9565b604080516001600160a01b038416602482015260448082018490528251808303909101815260649091019091526020810180516001600160e01b031663095ea7b360e01b179052610a0a848261321e565b610a76576040516001600160a01b0384811660248301525f6044830152610a6c91869182169063095ea7b3906064015b604051602081830303815290604052915060e01b6020820180516001600160e01b0383818316178352505050506132c1565b610a7684826132c1565b50505050565b6040516001600160a01b038481166024830152838116604483015260648201839052610a769186918216906323b872dd90608401610a3a565b5f80516020615e518339815191525460ff161561073f5760405163d93c066560e01b815260040160405180910390fd5b60f883901c603f1680610b26575f80610b008486018661535c565b5f549193509150610b1f906001600160a01b0380851691163084610a7c565b5050610a76565b60018103610c8e575f8080808080610b40888a018a615386565b5f5460405163d505accf60e01b81526001600160a01b039182166004820152306024820152604481018790526064810186905260ff8516608482015260a4810184905260c48101839052969c50949a509298509096509450925087169063d505accf9060e4015f604051808303815f87803b158015610bbd575f80fd5b505af1925050508015610bce575060015b610c69575f8054604051636eb1769f60e11b81526001600160a01b0391821660048201523060248201529088169063dd62ed3e90604401602060405180830381865afa158015610c20573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610c4491906152dc565b905085811015610c675760405163b78cb0dd60e01b815260040160405180910390fd5b505b5f54610c83906001600160a01b0388811691163088610a7c565b505050505050610a76565b60028103610ce4575f8080610ca5858701876153e3565b925092509250610cb482613327565b9150610cc0838261336c565b90508015610cdc57610cdc6001600160a01b03841683836133eb565b505050610a76565b6003811480610cf35750601581145b80610cfe5750601e81145b15610f53575f8080808080610d15888a018a615421565b9550955095509550955095505f866001600160a01b031663c6610657876040518263ffffffff1660e01b8152600401610d5091815260200190565b602060405180830381865afa158015610d6b573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610d8f919061547b565b9050610d9b818561336c565b9350610da682613327565b9150610dbc6001600160a01b03821688866109b9565b60038803610e565760405163ce7d650360e01b8152600481018790526024810186905260448101859052606481018490525f60848201526001600160a01b0383811660a483015288169063ce7d65039060c4015b6020604051808303815f875af1158015610e2c573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610e5091906152dc565b50610f33565b60158803610ea857604051630532419d60e51b8152600481018790526024810186905260448101859052606481018490526001600160a01b03838116608483015288169063a64833a09060a401610e10565b60405163ddc1f59d60e01b8152600f87810b600483015286900b602482015260448101859052606481018490526001600160a01b03838116608483015288169063ddc1f59d9060a4016020604051808303815f875af1158015610f0d573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610f3191906152dc565b505b610f476001600160a01b038216885f6109b9565b50505050505050610a76565b60108103611097575f808080610f6b86880188615496565b93509350935093505f846001600160a01b031663732e86fe6040518163ffffffff1660e01b8152600401602060405180830381865afa158015610fb0573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610fd4919061547b565b9050610fdf83613327565b9250610feb818561336c565b93506110016001600160a01b03821686866109b9565b60405163680d5c7760e11b8152600481018590526001600160a01b0384811660248301526044820184905286169063d01ab8ee906064016020604051808303815f875af1158015611054573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061107891906152dc565b5061108d6001600160a01b038216865f6109b9565b5050505050610a76565b60118103611141575f8080806110af86880188615496565b93509350935093506110c082613327565b91506110cc848461336c565b604051631886c6df60e21b81529093506001600160a01b0385169063621b1b7c906111019086908690309087906004016154db565b6020604051808303815f875af115801561111d573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061108d91906152dc565b6004810361127a575f808061115885870187615500565b9250925092505f836001600160a01b03166338d52e0f6040518163ffffffff1660e01b8152600401602060405180830381865afa15801561119b573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906111bf919061547b565b90506111cb818461336c565b92506111d682613327565b91506111ec6001600160a01b03821685856109b9565b604051636e553f6560e01b8152600481018490526001600160a01b038381166024830152851690636e553f65906044016020604051808303815f875af1158015611238573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061125c91906152dc565b506112716001600160a01b038216855f6109b9565b50505050610a76565b60058103611465575f8080808061129387890189615534565b945094509450945094505f856001600160a01b0316636f307dc36040518163ffffffff1660e01b8152600401602060405180830381865afa1580156112da573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906112fe919061547b565b905061130a818661336c565b945061131584613327565b935061132083613327565b60405163f5e306f760e01b81526001600160a01b0388811660048301529194505f917f00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b7169063f5e306f790602401602060405180830381865afa158015611389573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906113ad919061559a565b905080156113c5576113c082888861341c565b6113d9565b6113d96001600160a01b03831688886109b9565b604051630e4cca4b60e41b81526001600160a01b0388169063e4cca4b09061140b9089908990899089906004016154db565b6020604051808303815f875af1158015611427573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061144b91906152dc565b5080610f4757610f476001600160a01b038316885f6109b9565b600681036115f6575f8080808061147e87890189615534565b945094509450945094505f856001600160a01b031663c644fe946040518163ffffffff1660e01b8152600401602060405180830381865afa1580156114c5573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906114e9919061547b565b90506114f5818661336c565b945061150084613327565b935061150b83613327565b60405163f5e306f760e01b81526001600160a01b0388811660048301529194505f917f00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b7169063f5e306f790602401602060405180830381865afa158015611574573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611598919061559a565b905080156115b0576115ab82888861341c565b6115c4565b6115c46001600160a01b03831688886109b9565b604051631520940360e11b81526001600160a01b03881690632a4128069061140b9089908990899089906004016154db565b600781036116a2575f808061160d85870187615500565b92509250925061161d838361336c565b915061162881613327565b604051635d043b2960e11b8152600481018490526001600160a01b0380831660248301523060448301529192509084169063ba087652906064016020604051808303815f875af115801561167e573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061127191906152dc565b60088114806116b15750600981145b15611917575f8080806116c686880188615496565b93509350935093506116d782613327565b91506116e3848461336c565b92505f846001600160a01b031663204f83f96040518163ffffffff1660e01b8152600401602060405180830381865afa158015611722573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061174691906152dc565b42106117525783611823565b61182384866001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015611792573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906117b6919061547b565b6040516370a0823160e01b81523060048201526001600160a01b0391909116906370a0823190602401602060405180830381865afa1580156117fa573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061181e91906152dc565b6134ac565b9050600886036118a557604051639f40a7b360e01b81526001600160a01b03861690639f40a7b39061185f9084908790309088906004016154db565b6020604051808303815f875af115801561187b573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061189f91906152dc565b5061108d565b6040516385326f4560e01b81526001600160a01b038616906385326f45906118d79084908790309088906004016154db565b6020604051808303815f875af11580156118f3573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190610c8391906152dc565b600a8103611a8c575f80808061192f868801886155b3565b60405163f5e306f760e01b81526001600160a01b03858116600483015294985092965090945092507f00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b79091169063f5e306f790602401602060405180830381865afa1580156119a0573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906119c4919061559a565b6119ec5760405163e8c4926760e01b81526001600160a01b03851660048201526024016106e0565b600180546001600160a01b0319166001600160a01b038616908117909155604051632e7ff4ef60e11b8152635cffe9de90611a3190309087908790879060040161561a565b6020604051808303815f875af1158015611a4d573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611a71919061559a565b5050600180546001600160a01b031916905550610a76915050565b600b811480611a9b5750601681145b80611aa65750601a81145b15611deb575f80808080611abc87890189615534565b94509450945094509450611acf83613327565b9250611ada82613327565b60405163c661065760e01b81525f600482018190529193506001600160a01b0387169063c661065790602401602060405180830381865afa158015611b21573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611b45919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0388169063c661065790602401602060405180830381865afa158015611b8d573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611bb1919061547b565b9050611bbd828761336c565b60405163fbfc779760e01b8152600481018290526001600160a01b03808a166024830152831660448201529096505f907327857f8e0eee20596e7ce5be3901efd663e91e109063fbfc779790606401602060405180830381865af4158015611c27573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611c4b91906152dc565b90508015611d995760405163f5e306f760e01b81526001600160a01b0383811660048301525f917f00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b79091169063f5e306f790602401602060405180830381865afa158015611cbb573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611cdf919061559a565b90508015611cf757611cf284848461341c565b611d0b565b611d0b6001600160a01b03851684846109b9565b604051631520940360e11b81526001600160a01b03841690632a41280690611d3d9085908b908b908b906004016154db565b6020604051808303815f875af1158015611d59573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611d7d91906152dc565b5080611d9757611d976001600160a01b038516845f6109b9565b505b6001600160a01b0386163014801590611dba5750611db781886152f3565b15155b15611dde57611dde86611dcd838a6152f3565b6001600160a01b03861691906133eb565b5050505050505050610a76565b601f811480611dfa5750602081145b80611e055750602181145b1561213c575f8080808080611e1c888a018a61564c565b955095509550955095509550611e3183613327565b9250611e3c82613327565b60405163c661065760e01b81525f600482018190529193506001600160a01b0388169063c661065790602401602060405180830381865afa158015611e83573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611ea7919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0389169063c661065790602401602060405180830381865afa158015611eef573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611f13919061547b565b9050611f1f828861336c565b60405163013b28a760e51b815260048101829052602481018890526001600160a01b03831660448201529097505f907327857f8e0eee20596e7ce5be3901efd663e91e109063276514e090606401602060405180830381865af4158015611f88573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190611fac91906152dc565b905080156120fa5760405163f5e306f760e01b81526001600160a01b0383811660048301525f917f00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b79091169063f5e306f790602401602060405180830381865afa15801561201c573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612040919061559a565b905080156120585761205384848461341c565b61206c565b61206c6001600160a01b03851684846109b9565b604051631520940360e11b81526001600160a01b03841690632a4128069061209e9085908b908b908b906004016154db565b6020604051808303815f875af11580156120ba573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906120de91906152dc565b50806120f8576120f86001600160a01b038516845f6109b9565b505b6001600160a01b038616301480159061211b575061211881896152f3565b15155b1561212e5761212e86611dcd838b6152f3565b505050505050505050610a76565b600c81148061214b5750601781145b156123b9575f8080806121608688018861571b565b935093509350935061217181613327565b60405163c661065760e01b81525f600482018190529192506001600160a01b0386169063c661065790602401602060405180830381865afa1580156121b8573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906121dc919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0387169063c661065790602401602060405180830381865afa158015612224573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612248919061547b565b905061225b82865f5b602002015161336c565b855261226981866001612251565b60208601528451612286906001600160a01b0384169088906109b9565b60208501516122a1906001600160a01b0383169088906109b9565b600c871461231e5760405163030f92d560e21b81526001600160a01b03871690630c3e4b54906122d99088908890889060040161578c565b6020604051808303815f875af11580156122f5573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061231991906152dc565b612390565b604051637328333b60e01b81526001600160a01b03871690637328333b9061235090889088905f9089906004016157b9565b6020604051808303815f875af115801561236c573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061239091906152dc565b506123a56001600160a01b038316875f6109b9565b610c836001600160a01b038216875f6109b9565b600d8114806123c85750601881145b15612532575f8080806123dd868801886157eb565b93509350935093506123ee81613327565b90505f600d86146123ff578461245f565b846001600160a01b031663fc0c546a6040518163ffffffff1660e01b8152600401602060405180830381865afa15801561243b573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061245f919061547b565b905061246b818561336c565b9350600d86146124d757604051633eb1719f60e01b81526001600160a01b03861690633eb1719f906124a59087908790879060040161582f565b5f604051808303815f87803b1580156124bc575f80fd5b505af11580156124ce573d5f803e3d5ffd5b5050505061108d565b604051630c04742560e11b81526001600160a01b03861690631808e84a9061250990879087905f90889060040161585c565b5f604051808303815f87803b158015612520575f80fd5b505af115801561212e573d5f803e3d5ffd5b60198114806125415750600e81145b156126dd575f8080808061255787890189615890565b9450945094509450945061256a81613327565b90505f600e871461257b57856125db565b856001600160a01b031663fc0c546a6040518163ffffffff1660e01b8152600401602060405180830381865afa1580156125b7573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906125db919061547b565b90506125e7818661336c565b9450600e8714612661576040516307de773760e11b81526004810186905260248101859052604481018490526001600160a01b038381166064830152871690630fbcee6e906084015f604051808303815f87803b158015612646575f80fd5b505af1158015612658573d5f803e3d5ffd5b50505050610c83565b6040516307329bcd60e01b81526004810186905260248101859052604481018490525f60648201526001600160a01b0383811660848301528716906307329bcd9060a4015f604051808303815f87803b1580156126bc575f80fd5b505af11580156126ce573d5f803e3d5ffd5b50505050505050505050610a76565b601281036128fa576003546001600160a01b031661270e576040516327a8fdaf60e11b815260040160405180910390fd5b5f80808061271e868801886158e2565b94505093509350935073eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee6001600160a01b0316826001600160a01b03160361276d57604051630c59659760e31b815260040160405180910390fd5b73eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeed196001600160a01b0385160161283c5782600454146127b457604051634ff64a9f60e01b815260040160405180910390fd5b6003546004546040515f926001600160a01b031691906127d5908590615952565b5f6040518083038185875af1925050503d805f811461280f576040519150601f19603f3d011682016040523d82523d5f602084013e612814565b606091505b505090508061283657604051633204506f60e01b815260040160405180910390fd5b50611271565b612846848461336c565b600354909350612863906001600160a01b038681169116856109b9565b6003546040515f916001600160a01b031690612880908490615952565b5f604051808303815f865af19150503d805f81146128b9576040519150601f19603f3d011682016040523d82523d5f602084013e6128be565b606091505b50509050806128e057604051633204506f60e01b815260040160405180910390fd5b60035461108d906001600160a01b0387811691165f6109b9565b600f81036129d1575f8080612911858701876153e3565b92509250925061292082613327565b6040516370a0823160e01b81526001600160a01b0380831660048301529193505f918516906370a0823190602401602060405180830381865afa158015612969573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061298d91906152dc565b9050818110156112715760405163b250459b60e01b81526001600160a01b0380861660048301528416602482015260448101839052606481018290526084016106e0565b601b8103612be9575f8080806129e9868801886159d0565b93509350935093506129fa81613327565b60405163c661065760e01b81525f600482018190529192506001600160a01b0386169063c661065790602401602060405180830381865afa158015612a41573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612a65919061547b565b60405163c661065760e01b8152600160048201529091505f906001600160a01b0387169063c661065790602401602060405180830381865afa158015612aad573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190612ad1919061547b565b9050612af682865f81518110612ae957612ae9615306565b602002602001015161336c565b855f81518110612b0857612b08615306565b602002602001018181525050612b2b8186600181518110612ae957612ae9615306565b85600181518110612b3e57612b3e615306565b602002602001018181525050612b8186865f81518110612b6057612b60615306565b6020026020010151846001600160a01b03166109b99092919063ffffffff16565b612bb98686600181518110612b9857612b98615306565b6020026020010151836001600160a01b03166109b99092919063ffffffff16565b60405163a7256d0960e01b81526001600160a01b0387169063a7256d099061235090889088908890600401615a65565b601c8103612c93575f808080612c0186880188615a97565b9350935093509350612c1281613327565b9050612c1e848461336c565b604051632f30266960e11b81529093506001600160a01b03851690635e604cd290612c5190869086908690600401615af3565b5f604051808303815f875af1158015612c6c573d5f803e3d5ffd5b505050506040513d5f823e601f3d908101601f1916820160405261108d9190810190615b23565b601d8103612d15575f80808080612cac87890189615bae565b94509450945094509450612cbf81613327565b9050612ccb858561336c565b60405163081579a560e01b815260048101829052600f85900b6024820152604481018490526001600160a01b0383811660648301529195509086169063081579a5906084016118d7565b60228103612d7a575f80612d2b8486018661535c565b91509150816001600160a01b031663d0e30db0826040518263ffffffff1660e01b81526004015f604051808303818588803b158015612d68575f80fd5b505af1158015610f47573d5f803e3d5ffd5b60238103612de6575f80612d908486018661535c565b604051632e1a7d4d60e01b81526004810182905291935091506001600160a01b03831690632e1a7d4d906024015f604051808303815f87803b158015612dd4575f80fd5b505af1158015610c83573d5f803e3d5ffd5b60248103612e70575f80612dfc8486018661535c565b915091505f826001600160a01b0316826040515f6040518083038185875af1925050503d805f8114612e49576040519150601f19603f3d011682016040523d82523d5f602084013e612e4e565b606091505b5050905080610cdc57604051633204506f60e01b815260040160405180910390fd5b604051636bb50f4f60e11b8152600481018290526024016106e0565b5f612e95610ab5565b84838114612eb9576040516001621398b960e31b0319815260040160405180910390fd5b60408051601e8082526103e082019092525f91816020015b604080518082019091525f8082526020820152815260200190600190039081612ed1579050509050676765c793fa10079d601b1b5f5b83811015612fa3575f8a8a83818110612f2257612f22615306565b9050013560f81c60f81b9050365f8a8a85818110612f4257612f42615306565b9050602002810190612f54919061531a565b915091505f612f668484848d8b6134c1565b9050676765c793fa10079d601b1b8114612f9357612f908682676765c793fa10079d601b1b614782565b95505b505060019092019150612f079050565b5098975050505050505050565b5f80516020615e3183398151915280546001600160a01b0383166001600160a01b03199091168117825560408051918252517f2f658b440c35314f52658ea8a740e05b284cdc84dc9ae01e891f21b8933e7cad9181900360200190a15050565b5f80516020615e318339815191525f8061304861302b610875565b873061303a60045f8a8c615c01565b61304391615c28565b614841565b91509150816106535763ffffffff8116156130e357825460ff60a01b1916600160a01b178355613076610875565b6001600160a01b03166394c7d7ee8787876040518463ffffffff1660e01b81526004016130a593929190615c58565b5f604051808303815f87803b1580156130bc575f80fd5b505af11580156130ce573d5f803e3d5ffd5b5050845460ff60a01b19168555506106539050565b60405162d1953b60e31b81526001600160a01b03871660048201526024016106e0565b61310e610ab5565b5f80516020615e51833981519152805460ff191660011781557f62e78cea01bee320cd4e420270b5ea74000d11b0c9f74754ebdbfc544b05a258335b6040516001600160a01b03909116815260200160405180910390a150565b613170614949565b6001600160a01b03821661319757604051630c59659760e31b815260040160405180910390fd5b600280546001600160a01b039384166001600160a01b03199182161790915560038054929093169116179055565b6131cd614949565b6131d681614992565b50565b6131e16149a3565b5f80516020615e51833981519152805460ff191681557f5db9ee0a495bf2e6ff9c91a7834c1ba4fdd244a5e8aa4e537bd38aeae4b073aa3361314a565b5f805f846001600160a01b0316846040516132399190615952565b5f604051808303815f865af19150503d805f8114613272576040519150601f19603f3d011682016040523d82523d5f602084013e613277565b606091505b50915091508180156132a15750805115806132a15750808060200190518101906132a1919061559a565b80156132b657505f856001600160a01b03163b115b925050505b92915050565b5f6132d56001600160a01b038416836149d2565b905080515f141580156132f95750808060200190518101906132f7919061559a565b155b1561332257604051635274afe760e01b81526001600160a01b03841660048201526024016106e0565b505050565b5f60df196001600160a01b03831601613341575030919050565b60bf196001600160a01b038316016133635750505f546001600160a01b031690565b5090565b919050565b5f600160ff1b821461337e57816133e4565b6040516370a0823160e01b81523060048201526001600160a01b038416906370a0823190602401602060405180830381865afa1580156133c0573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906133e491906152dc565b9392505050565b6040516001600160a01b0383811660248301526044820183905261332291859182169063a9059cbb90606401610a3a565b604051636eb1769f60e11b81523060048201526001600160a01b0383811660248301525f919085169063dd62ed3e90604401602060405180830381865afa158015613469573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061348d91906152dc565b905081811015610a7657610a766001600160a01b038516845f196109b9565b5f8183106134ba57816133e4565b5090919050565b5f60f886901c603f168015806134d75750600181145b156135165783613502575f806134ef8789018961535c565b915091506134fe8183876149df565b5050505b676765c793fa10079d601b1b915050610697565b600281036135765783613502575f8080613532888a018a6153e3565b92509250925061354182613327565b91506001600160a01b03821630146134fe5761355e818488614b43565b50505050676765c793fa10079d601b1b915050610697565b60038114806135855750601581145b806135905750601e81145b1561390c575f808080806135a68a8c018c615421565b95505094509450945094505f89156136de575f60038814806135c85750601588145b61364f5760025460405163028c676d60e31b81526001600160a01b038981166004830152600f89810b602484015288900b6044830152909116906314633b6890606401602060405180830381865afa158015613626573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061364a91906152dc565b6136c9565b60025460405163044e3c3f60e31b81526001600160a01b038981166004830152602482018990526044820188905290911690632271e1f890606401602060405180830381865afa1580156136a5573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906136c991906152dc565b90506136d6816012614cc0565b9150506138fe565b60405163c661065760e01b8152600481018690526137519084906001600160a01b0389169063c661065790602401602060405180830381865afa158015613727573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061374b919061547b565b8b614b43565b92505f601e88036137dc57604051635e0d443f60e01b8152600f87810b600483015286900b6024820152604481018590526001600160a01b03881690635e0d443f90606401602060405180830381865afa1580156137b1573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906137d591906152dc565b9050613854565b60405163556d6e9f60e01b81526004810187905260248101869052604481018590526001600160a01b0388169063556d6e9f90606401602060405180830381865afa15801561382d573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061385191906152dc565b90505b61385d83613327565b9250306001600160a01b038416036138e45760405163c661065760e01b8152600481018690526138e29082906001600160a01b038a169063c661065790602401602060405180830381865afa1580156138b8573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906138dc919061547b565b8c6149df565b505b6138fa81676765c793fa10079d601b1b86614782565b9150505b965061069795505050505050565b60108103613aca575f8080613923888a018a615500565b9250925092505f836001600160a01b031663732e86fe6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613966573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061398a919061547b565b90508715613a0557600254604051635fa5a49760e01b81526001600160a01b03838116600483015290911690635fa5a49790602401602060405180830381865afa1580156139da573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906139fe91906152dc565b9250613a13565b613a10838289614b43565b92505b60405163404b9d8160e01b8152600481018490525f906001600160a01b0386169063404b9d81906024015b602060405180830381865afa158015613a59573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613a7d91906152dc565b9050613a8883613327565b9250306001600160a01b03841603613aa757613aa581868a6149df565b505b613abd81676765c793fa10079d601b1b86614782565b9650505050505050610697565b60118103613c82575f8080613ae1888a018a615500565b9250925092508615613b6057600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa158015613b35573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613b5991906152dc565b9150613b6e565b613b6b828488614b43565b91505b60405163554d83a760e11b8152600481018390525f906001600160a01b0385169063aa9b074e90602401602060405180830381865afa158015613bb3573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613bd791906152dc565b9050613be282613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b031663732e86fe6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613c58919061547b565b896149df565b505b613c7681676765c793fa10079d601b1b85614782565b95505050505050610697565b60048103613db8575f8080613c99888a018a615500565b9250925092505f836001600160a01b03166338d52e0f6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613cdc573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613d00919061547b565b90508715613d7b57600254604051635fa5a49760e01b81526001600160a01b03838116600483015290911690635fa5a49790602401602060405180830381865afa158015613d50573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613d7491906152dc565b9250613d89565b613d86838289614b43565b92505b60405163ef8b30f760e01b8152600481018490525f906001600160a01b0386169063ef8b30f790602401613a3e565b60058103613fd7575f808080613dd0898b018b615c97565b93509350935093508715613e5157600254604051633e3f205760e21b81526001600160a01b0386811660048301529091169063f8fc815c90602401602060405180830381865afa158015613e26573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613e4a91906152dc565b9250613ebe565b613ebb83856001600160a01b0316636f307dc36040518163ffffffff1660e01b8152600401602060405180830381865afa158015613e91573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613eb5919061547b565b89614b43565b92505b60405163ef8b30f760e01b8152600481018490525f906001600160a01b0386169063ef8b30f7906024015b602060405180830381865afa158015613f04573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613f2891906152dc565b9050613f3383613327565b9250306001600160a01b03841603613f5257613f5081868a6149df565b505b613f5b82613327565b9150306001600160a01b03831603613aa757613aa581866001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613fad573d5f803e3d5ffd5b505050506040513d601f19601f82011682018060405250810190613fd1919061547b565b8a6149df565b600681036140e2575f808080613fef898b018b615c97565b9350935093509350871561407057600254604051635fa5a49760e01b81526001600160a01b03868116600483015290911690635fa5a49790602401602060405180830381865afa158015614045573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061406991906152dc565b92506140b3565b6140b083856001600160a01b031663c644fe946040518163ffffffff1660e01b8152600401602060405180830381865afa158015613e91573d5f803e3d5ffd5b92505b6040516302f6fa9560e11b8152600481018490525f906001600160a01b038616906305edf52a90602401613ee9565b6007810361424c575f80806140f9888a018a615500565b925092509250861561417857600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa15801561414d573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061417191906152dc565b9150614186565b614183828488614b43565b91505b60405163266d6a8360e11b8152600481018390525f906001600160a01b03851690634cdad50690602401602060405180830381865afa1580156141cb573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906141ef91906152dc565b90506141fa82613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b03166338d52e0f6040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b60088103614488575f8080614263888a018a615500565b92509250925086156142e257600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa1580156142b7573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906142db91906152dc565b91506143c2565b6142ed828488614b43565b9150826001600160a01b031663204f83f96040518163ffffffff1660e01b8152600401602060405180830381865afa15801561432b573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061434f91906152dc565b4210156143c2576143c082846001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015614396573d5f803e3d5ffd5b505050506040513d601f19601f820116820180604052508101906143ba919061547b565b88614b43565b505b60405163266d6a8360e11b8152600481018390525f906001600160a01b03851690634cdad50690602401602060405180830381865afa158015614407573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061442b91906152dc565b905061443682613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b0316636f307dc36040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b6009810361469a575f808061449f888a018a615500565b925092509250861561451e57600254604051635fa5a49760e01b81526001600160a01b03858116600483015290911690635fa5a49790602401602060405180830381865afa1580156144f3573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061451791906152dc565b91506145d4565b614529828488614b43565b9150826001600160a01b031663204f83f96040518163ffffffff1660e01b8152600401602060405180830381865afa158015614567573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061458b91906152dc565b4210156145d4576145d282846001600160a01b03166304aa50ad6040518163ffffffff1660e01b8152600401602060405180830381865afa158015614396573d5f803e3d5ffd5b505b604051633460fbfb60e11b8152600481018390525f906001600160a01b038516906368c1f7f690602401602060405180830381865afa158015614619573d5f803e3d5ffd5b505050506040513d601f19601f8201168201806040525081019061463d91906152dc565b905061464882613327565b9150306001600160a01b03831603613c6057613c5e81856001600160a01b031663c644fe946040518163ffffffff1660e01b8152600401602060405180830381865afa158015613c34573d5f803e3d5ffd5b60128103614766576003546001600160a01b03166146cb576040516327a8fdaf60e11b815260040160405180910390fd5b5f8080806146db898b018b615496565b935093509350935073eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee6001600160a01b0316826001600160a01b03160361472957604051630c59659760e31b815260040160405180910390fd5b6001600160a01b03841673eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee1461475b57614758838589614b43565b92505b613c5e8183896149df565b600f8103612e7057676765c793fa10079d601b1b915050610697565b5f838302815f1985870982811083820303915050805f036147b6578382816147ac576147ac615cdc565b04925050506133e4565b8084116147d65760405163227bc15360e01b815260040160405180910390fd5b5f848688095f868103871696879004966002600389028118808a02820302808a02820302808a02820302808a02820302808a02820302808a02909103029181900381900460010186841190950394909402919094039290920491909117919091029150509392505050565b6040516001600160a01b03848116602483015283811660448301526001600160e01b0319831660648301525f9182918291829189169060840160408051601f198184030181529181526020820180516001600160e01b031663b700961360e01b179052516148af9190615952565b5f60405180830381855afa9150503d805f81146148e7576040519150601f19603f3d011682016040523d82523d5f602084013e6148ec565b606091505b5091509150811561493e57604081511061491e57808060200190518101906149149190615cf0565b909450925061493e565b602081511061493e578080602001905181019061493b919061559a565b93505b505094509492505050565b7ff0c57e16840df040f15088dc2f81fe391c3923bec73e23a9662efc9c229c6a0054600160401b900460ff1661073f57604051631afcd79f60e31b815260040160405180910390fd5b61499a614949565b6131d681612fb0565b5f80516020615e518339815191525460ff1661073f57604051638dfc202b60e01b815260040160405180910390fd5b60606133e483835f614cf3565b5f6001600160a01b038316614a0757604051630c59659760e31b815260040160405180910390fd5b81515f5b81811015614b29575f6001600160a01b0316848281518110614a2f57614a2f615306565b60200260200101515f01516001600160a01b031603614a8d576040518060400160405280866001600160a01b0316815260200187815250848281518110614a7857614a78615306565b602002602001018190525085925050506133e4565b846001600160a01b0316848281518110614aa957614aa9615306565b60200260200101515f01516001600160a01b031603614b195785848281518110614ad557614ad5615306565b6020026020010151602001818151614aed91906152c9565b9052508351849082908110614b0457614b04615306565b602002602001015160200151925050506133e4565b614b2281615d2d565b9050614a0b565b50604051638b48412160e01b815260040160405180910390fd5b5f6001600160a01b038316614b6b57604051630c59659760e31b815260040160405180910390fd5b81515f5b81811015614ca6575f6001600160a01b0316848281518110614b9357614b93615306565b60200260200101515f01516001600160a01b03160315614ca657846001600160a01b0316848281518110614bc957614bc9615306565b60200260200101515f01516001600160a01b031603614c9657600160ff1b8603614c39575f848281518110614c0057614c00615306565b60200260200101516020015190505f858381518110614c2157614c21615306565b602090810291909101810151015292506133e4915050565b85848281518110614c4c57614c4c615306565b60200260200101516020015110614ca65785848281518110614c7057614c70615306565b6020026020010151602001818151614c8891906152f3565b9052508592506133e4915050565b614c9f81615d2d565b9050614b6f565b506040516305e72d3960e11b815260040160405180910390fd5b5f80614ccd83601b6152f3565b614cd890600a615e25565b905080840291508381830414614cec575f80fd5b5092915050565b606081471015614d185760405163cd78605960e01b81523060048201526024016106e0565b5f80856001600160a01b03168486604051614d339190615952565b5f6040518083038185875af1925050503d805f8114614d6d576040519150601f19603f3d011682016040523d82523d5f602084013e614d72565b606091505b5091509150614d82868383614d8c565b9695505050505050565b606082614da157614d9c82614de8565b6133e4565b8151158015614db857506001600160a01b0384163b155b15614de157604051639996b31560e01b81526001600160a01b03851660048201526024016106e0565b50806133e4565b805115614df85780518082602001fd5b604051630a12f52160e11b815260040160405180910390fd5b6001600160a01b03811681146131d6575f80fd5b5f8083601f840112614e35575f80fd5b5081356001600160401b03811115614e4b575f80fd5b602083019150836020828501011115614e62575f80fd5b9250929050565b5f805f805f8060a08789031215614e7e575f80fd5b8635614e8981614e11565b95506020870135614e9981614e11565b9450604087013593506060870135925060808701356001600160401b03811115614ec1575f80fd5b614ecd89828a01614e25565b979a9699509497509295939492505050565b5f8083601f840112614eef575f80fd5b5081356001600160401b03811115614f05575f80fd5b6020830191508360208260051b8501011115614e62575f80fd5b5f805f8060408587031215614f32575f80fd5b84356001600160401b0380821115614f48575f80fd5b614f5488838901614e25565b90965094506020870135915080821115614f6c575f80fd5b50614f7987828801614edf565b95989497509550505050565b5f805f805f60608688031215614f99575f80fd5b85356001600160401b0380821115614faf575f80fd5b614fbb89838a01614e25565b90975095506020880135915080821115614fd3575f80fd5b50614fe088828901614edf565b96999598509660400135949350505050565b5f60208284031215615002575f80fd5b81356133e481614e11565b5f805f6060848603121561501f575f80fd5b833561502a81614e11565b9250602084013561503a81614e11565b9150604084013561504a81614e11565b809150509250925092565b634e487b7160e01b5f52604160045260245ffd5b604051601f8201601f191681016001600160401b038111828210171561509157615091615055565b604052919050565b5f82601f8301126150a8575f80fd5b81356001600160401b038111156150c1576150c1615055565b6150d4601f8201601f1916602001615069565b8181528460208386010111156150e8575f80fd5b816020850160208301375f918101602001919091529392505050565b5f6001600160401b0382111561511c5761511c615055565b5060051b60200190565b5f8060408385031215615137575f80fd5b82356001600160401b038082111561514d575f80fd5b61515986838701615099565b935060209150818501358181111561516f575f80fd5b8501601f8101871361517f575f80fd5b803561519261518d82615104565b615069565b81815260059190911b820184019084810190898311156151b0575f80fd5b8584015b838110156151e7578035868111156151cb575f8081fd5b6151d98c8983890101615099565b8452509186019186016151b4565b508096505050505050509250929050565b5f5b838110156152125781810151838201526020016151fa565b50505f910152565b5f81518084526152318160208601602086016151f8565b601f01601f19169290920160200192915050565b604081525f615257604083018561521a565b6020838203818501528185518084528284019150828160051b8501018388015f5b838110156152a657601f1987840301855261529483835161521a565b94860194925090850190600101615278565b50909998505050505050505050565b634e487b7160e01b5f52601160045260245ffd5b808201808211156132bb576132bb6152b5565b5f602082840312156152ec575f80fd5b5051919050565b818103818111156132bb576132bb6152b5565b634e487b7160e01b5f52603260045260245ffd5b5f808335601e1984360301811261532f575f80fd5b8301803591506001600160401b03821115615348575f80fd5b602001915036819003821315614e62575f80fd5b5f806040838503121561536d575f80fd5b823561537881614e11565b946020939093013593505050565b5f805f805f8060c0878903121561539b575f80fd5b86356153a681614e11565b95506020870135945060408701359350606087013560ff811681146153c9575f80fd5b9598949750929560808101359460a0909101359350915050565b5f805f606084860312156153f5575f80fd5b833561540081614e11565b9250602084013561541081614e11565b929592945050506040919091013590565b5f805f805f8060c08789031215615436575f80fd5b863561544181614e11565b95506020870135945060408701359350606087013592506080870135915060a087013561546d81614e11565b809150509295509295509295565b5f6020828403121561548b575f80fd5b81516133e481614e11565b5f805f80608085870312156154a9575f80fd5b84356154b481614e11565b93506020850135925060408501356154cb81614e11565b9396929550929360600135925050565b9384526001600160a01b03928316602085015291166040830152606082015260800190565b5f805f60608486031215615512575f80fd5b833561551d81614e11565b925060208401359150604084013561504a81614e11565b5f805f805f60a08688031215615548575f80fd5b853561555381614e11565b945060208601359350604086013561556a81614e11565b9250606086013561557a81614e11565b949793965091946080013592915050565b80518015158114613367575f80fd5b5f602082840312156155aa575f80fd5b6133e48261558b565b5f805f80608085870312156155c6575f80fd5b84356155d181614e11565b935060208501356155e181614e11565b92506040850135915060608501356001600160401b03811115615602575f80fd5b61560e87828801615099565b91505092959194509250565b6001600160a01b03858116825284166020820152604081018390526080606082018190525f90614d829083018461521a565b5f805f805f8060c08789031215615661575f80fd5b863561566c81614e11565b95506020870135945060408701359350606087013561568a81614e11565b9250608087013561569a81614e11565b8092505060a087013590509295509295509295565b5f82601f8301126156be575f80fd5b604051604081018181106001600160401b03821117156156e0576156e0615055565b80604052508060408401858111156156f6575f80fd5b845b818110156157105780358352602092830192016156f8565b509195945050505050565b5f805f8060a0858703121561572e575f80fd5b843561573981614e11565b935061574886602087016156af565b925060608501359150608085013561575f81614e11565b939692955090935050565b805f5b6002811015610a7657815184526020938401939091019060010161576d565b6080810161579a828661576a565b60408201939093526001600160a01b0391909116606090910152919050565b60a081016157c7828761576a565b604082019490945291151560608301526001600160a01b0316608090910152919050565b5f805f8060a085870312156157fe575f80fd5b843561580981614e11565b93506020850135925061581f86604087016156af565b9150608085013561575f81614e11565b83815260808101615843602083018561576a565b6001600160a01b03929092166060919091015292915050565b84815260a08101615870602083018661576a565b92151560608201526001600160a01b039190911660809091015292915050565b5f805f805f60a086880312156158a4575f80fd5b85356158af81614e11565b945060208601359350604086013592506060860135915060808601356158d481614e11565b809150509295509295909350565b5f805f805f60a086880312156158f6575f80fd5b853561590181614e11565b945060208601359350604086013561591881614e11565b92506060860135915060808601356001600160401b03811115615939575f80fd5b61594588828901615099565b9150509295509295909350565b5f82516159638184602087016151f8565b9190910192915050565b5f82601f83011261597c575f80fd5b8135602061598c61518d83615104565b82815260059290921b840181019181810190868411156159aa575f80fd5b8286015b848110156159c557803583529183019183016159ae565b509695505050505050565b5f805f80608085870312156159e3575f80fd5b84356159ee81614e11565b935060208501356001600160401b03811115615a08575f80fd5b615a148782880161596d565b93505060408501359150606085013561575f81614e11565b5f8151808452602080850194508084015f5b83811015615a5a57815187529582019590820190600101615a3e565b509495945050505050565b606081525f615a776060830186615a2c565b6020830194909452506001600160a01b0391909116604090910152919050565b5f805f8060808587031215615aaa575f80fd5b8435615ab581614e11565b93506020850135925060408501356001600160401b03811115615ad6575f80fd5b615ae28782880161596d565b925050606085013561575f81614e11565b838152606060208201525f615b0b6060830185615a2c565b905060018060a01b0383166040830152949350505050565b5f6020808385031215615b34575f80fd5b82516001600160401b03811115615b49575f80fd5b8301601f81018513615b59575f80fd5b8051615b6761518d82615104565b81815260059190911b82018301908381019087831115615b85575f80fd5b928401925b82841015615ba357835182529284019290840190615b8a565b979650505050505050565b5f805f805f60a08688031215615bc2575f80fd5b8535615bcd81614e11565b9450602086013593506040860135600f81900b8114615bea575f80fd5b92506060860135915060808601356158d481614e11565b5f8085851115615c0f575f80fd5b83861115615c1b575f80fd5b5050820193919092039150565b6001600160e01b03198135818116916004851015615c505780818660040360031b1b83161692505b505092915050565b6001600160a01b03841681526040602082018190528101829052818360608301375f818301606090810191909152601f909201601f1916010192915050565b5f805f8060808587031215615caa575f80fd5b8435615cb581614e11565b9350602085013592506040850135615ccc81614e11565b9150606085013561575f81614e11565b634e487b7160e01b5f52601260045260245ffd5b5f8060408385031215615d01575f80fd5b615d0a8361558b565b9150602083015163ffffffff81168114615d22575f80fd5b809150509250929050565b5f60018201615d3e57615d3e6152b5565b5060010190565b600181815b80851115615d7f57815f1904821115615d6557615d656152b5565b80851615615d7257918102915b93841c9390800290615d4a565b509250929050565b5f82615d95575060016132bb565b81615da157505f6132bb565b8160018114615db75760028114615dc157615ddd565b60019150506132bb565b60ff841115615dd257615dd26152b5565b50506001821b6132bb565b5060208310610133831016604e8410600b8410161715615e00575081810a6132bb565b615e0a8383615d45565b805f1904821115615e1d57615e1d6152b5565b029392505050565b5f6133e48383615d8756fef3177357ab46d8af007ab3fdb9af81da189e1068fefdc0073dca88a2cab40a00cd5ed15c6e187e77e9aee88184c21f4f2182ab5827cb3b7e07fbedcd63f03300a264697066735822122057591e54a916f3b9443c691928a96f6d9c4d16f411ae8a4a77f39bb28fbcef9864736f6c63430008140033

Constructor Arguments (ABI-Encoded and is the last bytes of the Contract Creation Code above)

00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b7

-----Decoded View---------------
Arg [0] : _registry (address): 0x09176eacAA413cc0722aa5AD716820E8f19682b7

-----Encoded View---------------
1 Constructor Arguments found :
Arg [0] : 00000000000000000000000009176eacaa413cc0722aa5ad716820e8f19682b7


Block Transaction Difficulty Gas Used Reward
View All Blocks Produced

Block Uncle Number Difficulty Gas Used Reward
View All Uncles
Loading...
Loading
Loading...
Loading

Validator Index Block Amount
View All Withdrawals

Transaction Hash Block Value Eth2 PubKey Valid
View All Deposits
Loading...
Loading

A contract address hosts a smart contract, which is a set of code stored on the blockchain that runs when predetermined conditions are met. Learn more about addresses in our Knowledge Base.